pyfstat.py 81.1 KB
Newer Older
1
2
3
4
5
6
7
8
9
10
""" Classes for various types of searches using ComputeFstatistic """
import os
import sys
import itertools
import logging
import argparse
import copy
import glob
import inspect
from functools import wraps
11
import subprocess
12
from collections import OrderedDict
13
14
15

import numpy as np
import matplotlib
16
matplotlib.use('Agg')
17
18
19
20
import matplotlib.pyplot as plt
import emcee
import corner
import dill as pickle
21
import lal
22
23
import lalpulsar

24
25
26
27
28
29
try:
    from tqdm import tqdm
except ImportError:
    def tqdm(x):
        return x

30
plt.rcParams['text.usetex'] = True
31
plt.rcParams['axes.formatter.useoffset'] = False
32

33
34
35
36
37
38
39
config_file = os.path.expanduser('~')+'/.pyfstat.conf'
if os.path.isfile(config_file):
    d = {}
    with open(config_file, 'r') as f:
        for line in f:
            k, v = line.split('=')
            k = k.replace(' ', '')
40
            v = v.replace(' ', '').replace("'", "").replace('"', '').replace('\n', '')
41
42
43
44
45
46
            d[k] = v
    earth_ephem = d['earth_ephem']
    sun_ephem = d['sun_ephem']
else:
    logging.warning('No ~/.pyfstat.conf file found please provide the paths '
                    'when initialising searches')
47
48
49
    earth_ephem = None
    sun_ephem = None

50
51
52
53
54
parser = argparse.ArgumentParser()
parser.add_argument("-q", "--quite", help="Decrease output verbosity",
                    action="store_true")
parser.add_argument("-c", "--clean", help="Don't use cached data",
                    action="store_true")
55
parser.add_argument("-u", "--use-old-data", action="store_true")
56
57
58
59
parser.add_argument('unittest_args', nargs='*')
args, unknown = parser.parse_known_args()
sys.argv[1:] = args.unittest_args

Gregory Ashton's avatar
Gregory Ashton committed
60
61
62
63

logger = logging.getLogger()
logger.setLevel(logging.DEBUG)
stream_handler = logging.StreamHandler()
64
if args.quite:
Gregory Ashton's avatar
Gregory Ashton committed
65
    stream_handler.setLevel(logging.WARNING)
66
else:
Gregory Ashton's avatar
Gregory Ashton committed
67
68
69
70
    stream_handler.setLevel(logging.DEBUG)
stream_handler.setFormatter(logging.Formatter(
    '%(asctime)s %(levelname)-8s: %(message)s', datefmt='%H:%M'))
logger.addHandler(stream_handler)
71

72
73

def initializer(func):
74
    """ Decorator function to automatically assign the parameters to self """
75
76
77
78
79
80
81
82
83
84
85
86
87
88
89
90
91
    names, varargs, keywords, defaults = inspect.getargspec(func)

    @wraps(func)
    def wrapper(self, *args, **kargs):
        for name, arg in list(zip(names[1:], args)) + list(kargs.items()):
            setattr(self, name, arg)

        for name, default in zip(reversed(names), reversed(defaults)):
            if not hasattr(self, name):
                setattr(self, name, default)

        func(self, *args, **kargs)

    return wrapper


def read_par(label, outdir):
92
    """ Read in a .par file, returns a dictionary of the values """
93
94
95
96
    filename = '{}/{}.par'.format(outdir, label)
    d = {}
    with open(filename, 'r') as f:
        for line in f:
97
98
99
            if len(line.split('=')) > 1:
                key, val = line.rstrip('\n').split(' = ')
                key = key.strip()
100
                d[key] = np.float64(eval(val.rstrip('; ')))
101
102
103
104
    return d


class BaseSearchClass(object):
105
    """ The base search class, provides general functions """
106
107
108
109

    earth_ephem_default = earth_ephem
    sun_ephem_default = sun_ephem

110
    def add_log_file(self):
111
        """ Log output to a file, requires class to have outdir and label """
112
113
        logfilename = '{}/{}.log'.format(self.outdir, self.label)
        fh = logging.FileHandler(logfilename)
Gregory Ashton's avatar
Gregory Ashton committed
114
        fh.setLevel(logging.INFO)
115
116
117
118
119
        fh.setFormatter(logging.Formatter(
            '%(asctime)s %(levelname)-8s: %(message)s',
            datefmt='%y-%m-%d %H:%M'))
        logging.getLogger().addHandler(fh)

120
    def shift_matrix(self, n, dT):
121
122
123
124
125
126
127
128
129
130
131
132
133
134
135
        """ Generate the shift matrix

        Parameters
        ----------
        n: int
            The dimension of the shift-matrix to generate
        dT: float
            The time delta of the shift matrix

        Returns
        -------
        m: array (n, n)
            The shift matrix
        """

136
137
138
139
140
141
142
143
144
145
146
147
148
149
150
151
152
153
154
155
156
157
        m = np.zeros((n, n))
        factorial = np.math.factorial
        for i in range(n):
            for j in range(n):
                if i == j:
                    m[i, j] = 1.0
                elif i > j:
                    m[i, j] = 0.0
                else:
                    if i == 0:
                        m[i, j] = 2*np.pi*float(dT)**(j-i) / factorial(j-i)
                    else:
                        m[i, j] = float(dT)**(j-i) / factorial(j-i)
        return m

    def shift_coefficients(self, theta, dT):
        """ Shift a set of coefficients by dT

        Parameters
        ----------
        theta: array-like, shape (n,)
            vector of the expansion coefficients to transform starting from the
158
            lowest degree e.g [phi, F0, F1,...].
159
        dT: float
160
            difference between the two reference times as tref_new - tref_old.
161
162
163
164

        Returns
        -------
        theta_new: array-like shape (n,)
165
            vector of the coefficients as evaluate as the new reference time.
166
        """
167

168
169
170
171
        n = len(theta)
        m = self.shift_matrix(n, dT)
        return np.dot(m, theta)

172
    def calculate_thetas(self, theta, delta_thetas, tbounds, theta0_idx=0):
173
174
175
        """ Calculates the set of coefficients for the post-glitch signal """
        thetas = [theta]
        for i, dt in enumerate(delta_thetas):
176
177
178
179
180
181
182
183
184
185
186
187
188
            if i < theta0_idx:
                pre_theta_at_ith_glitch = self.shift_coefficients(
                    thetas[0], tbounds[i+1] - self.tref)
                post_theta_at_ith_glitch = pre_theta_at_ith_glitch - dt
                thetas.insert(0, self.shift_coefficients(
                    post_theta_at_ith_glitch, self.tref - tbounds[i+1]))

            elif i >= theta0_idx:
                pre_theta_at_ith_glitch = self.shift_coefficients(
                    thetas[i], tbounds[i+1] - self.tref)
                post_theta_at_ith_glitch = pre_theta_at_ith_glitch + dt
                thetas.append(self.shift_coefficients(
                    post_theta_at_ith_glitch, self.tref - tbounds[i+1]))
189
190
191
        return thetas


Gregory Ashton's avatar
Gregory Ashton committed
192
class ComputeFstat(object):
193
    """ Base class providing interface to `lalpulsar.ComputeFstat` """
Gregory Ashton's avatar
Gregory Ashton committed
194
195
196
197
198

    earth_ephem_default = earth_ephem
    sun_ephem_default = sun_ephem

    @initializer
199
200
    def __init__(self, tref, sftfilepath=None, minStartTime=None,
                 maxStartTime=None, binary=False, transient=True, BSGL=False,
Gregory Ashton's avatar
Gregory Ashton committed
201
202
203
                 BSGL_PREFACTOR=1, BSGL_FLOOR=None, detector=None,
                 minCoverFreq=None, maxCoverFreq=None, earth_ephem=None,
                 sun_ephem=None,
204
                 ):
205
206
207
208
209
        """
        Parameters
        ----------
        tref: int
            GPS seconds of the reference time.
210
211
        sftfilepath: str
            File patern to match SFTs
212
213
214
215
216
217
218
219
220
221
222
223
224
        minStartTime, maxStartTime: float GPStime
            Only use SFTs with timestemps starting from (including, excluding)
            this epoch
        binary: bool
            If true, search of binary parameters.
        transient: bool
            If true, allow for the Fstat to be computed over a transient range.
        BSGL: bool
            If true, compute the BSGL rather than the twoF value.
        BSGL_PREFACTOR: float
            If BSGL is True, one can specify a prefactor to multiply the
            computed BSGL value by, useful in MCMC searches to amplify the
            peaks.
Gregory Ashton's avatar
Gregory Ashton committed
225
226
        BSGL_FLOOR: float
            IF BSGL < BSGL_FLOOR -> BSGL_FLOOR
227
228
229
        detector: str
            Two character reference to the data to use, specify None for no
            contraint.
230
231
232
233
234
235
236
237
238
239
        minCoverFreq, maxCoverFreq: float
            The min and max cover frequency passed to CreateFstatInput, if
            either is None the range of frequencies in the SFT less 1Hz is
            used.
        earth_ephem, sun_ephem: str
            Paths of the two files containing positions of Earth and Sun,
            respectively at evenly spaced times, as passed to CreateFstatInput.
            If None defaults defined in BaseSearchClass will be used.

        """
Gregory Ashton's avatar
Gregory Ashton committed
240
241
242
243
244
245
246
247
248
249
250
251
252
253
254

        if earth_ephem is None:
            self.earth_ephem = self.earth_ephem_default
        if sun_ephem is None:
            self.sun_ephem = self.sun_ephem_default

        self.init_computefstatistic_single_point()

    def init_computefstatistic_single_point(self):
        """ Initilisation step of run_computefstatistic for a single point """

        logging.info('Initialising SFTCatalog')
        constraints = lalpulsar.SFTConstraints()
        if self.detector:
            constraints.detector = self.detector
255
256
257
258
259
        if self.minStartTime:
            constraints.minStartTime = lal.LIGOTimeGPS(self.minStartTime)
        if self.maxStartTime:
            constraints.maxStartTime = lal.LIGOTimeGPS(self.maxStartTime)

260
        logging.info('Loading data matching pattern {}'.format(
261
262
                     self.sftfilepath))
        SFTCatalog = lalpulsar.SFTdataFind(self.sftfilepath, constraints)
Gregory Ashton's avatar
Gregory Ashton committed
263
        names = list(set([d.header.name for d in SFTCatalog.data]))
264
        SFT_timestamps = [d.header.epoch for d in SFTCatalog.data]
265
        logging.info(
266
            'Loaded {} data files from detectors {} spanning {} to {}'.format(
267
268
269
                len(SFT_timestamps), names, int(SFT_timestamps[0]),
                int(SFT_timestamps[-1])))
        self.SFT_timestamps = SFT_timestamps
Gregory Ashton's avatar
Gregory Ashton committed
270
271
272
273
274
275

        logging.info('Initialising ephems')
        ephems = lalpulsar.InitBarycenter(self.earth_ephem, self.sun_ephem)

        logging.info('Initialising FstatInput')
        dFreq = 0
276
277
278
279
280
        if self.transient:
            self.whatToCompute = lalpulsar.FSTATQ_ATOMS_PER_DET
        else:
            self.whatToCompute = lalpulsar.FSTATQ_2F

Gregory Ashton's avatar
Gregory Ashton committed
281
282
283
284
285
286
287
288
        FstatOptionalArgs = lalpulsar.FstatOptionalArgsDefaults

        if self.minCoverFreq is None or self.maxCoverFreq is None:
            fA = SFTCatalog.data[0].header.f0
            numBins = SFTCatalog.data[0].numBins
            fB = fA + (numBins-1)*SFTCatalog.data[0].header.deltaF
            self.minCoverFreq = fA + 0.5
            self.maxCoverFreq = fB - 0.5
289
290
291
            logging.info('Min/max cover freqs not provided, using '
                         '{} and {}, est. from SFTs'.format(
                             self.minCoverFreq, self.maxCoverFreq))
Gregory Ashton's avatar
Gregory Ashton committed
292
293
294
295
296
297
298
299
300
301
302
303
304
305
306
307
308
309
310
311

        self.FstatInput = lalpulsar.CreateFstatInput(SFTCatalog,
                                                     self.minCoverFreq,
                                                     self.maxCoverFreq,
                                                     dFreq,
                                                     ephems,
                                                     FstatOptionalArgs
                                                     )

        logging.info('Initialising PulsarDoplerParams')
        PulsarDopplerParams = lalpulsar.PulsarDopplerParams()
        PulsarDopplerParams.refTime = self.tref
        PulsarDopplerParams.Alpha = 1
        PulsarDopplerParams.Delta = 1
        PulsarDopplerParams.fkdot = np.array([0, 0, 0, 0, 0, 0, 0])
        self.PulsarDopplerParams = PulsarDopplerParams

        logging.info('Initialising FstatResults')
        self.FstatResults = lalpulsar.FstatResults()

312
        if self.BSGL:
Gregory Ashton's avatar
Gregory Ashton committed
313
314
            if len(names) < 2:
                raise ValueError("Can't use BSGL with single detector data")
315
316
317
318
319
320
321
322
323
324
            if self.BSGL_FLOOR is None:
                logging.info('Initialising BSGL with prefactor {:2.2f}'
                             .format(self.BSGL_PREFACTOR)
                             )
            else:
                logging.info('Initialising BSGL with prefactor {:0.2f} and '
                             'floor {}'.format(self.BSGL_PREFACTOR,
                                               self.BSGL_FLOOR)
                             )

325
326
            # Tuning parameters - to be reviewed
            numDetectors = 2
Gregory Ashton's avatar
Gregory Ashton committed
327
            Fstar0sc = 15.
328
            oLGX = np.zeros(10)
Gregory Ashton's avatar
Gregory Ashton committed
329
            oLGX[:numDetectors] = 1./numDetectors
330
331
332
            self.BSGLSetup = lalpulsar.CreateBSGLSetup(numDetectors,
                                                       Fstar0sc,
                                                       oLGX,
333
                                                       True,
334
335
                                                       1)
            self.twoFX = np.zeros(10)
Gregory Ashton's avatar
Gregory Ashton committed
336
            self.whatToCompute = (self.whatToCompute +
337
338
                                  lalpulsar.FSTATQ_2F_PER_DET)

339
        if self.transient:
340
            logging.info('Initialising transient parameters')
341
342
343
344
345
346
            self.windowRange = lalpulsar.transientWindowRange_t()
            self.windowRange.type = lalpulsar.TRANSIENT_RECTANGULAR
            self.windowRange.t0Band = 0
            self.windowRange.dt0 = 1
            self.windowRange.tauBand = 0
            self.windowRange.dtau = 1
347

Gregory Ashton's avatar
Gregory Ashton committed
348
    def run_computefstatistic_single_point(self, tstart, tend, F0, F1,
349
350
351
                                           F2, Alpha, Delta, asini=None,
                                           period=None, ecc=None, tp=None,
                                           argp=None):
352
        """ Returns the twoF fully-coherently at a single point """
Gregory Ashton's avatar
Gregory Ashton committed
353
354
355
356

        self.PulsarDopplerParams.fkdot = np.array([F0, F1, F2, 0, 0, 0, 0])
        self.PulsarDopplerParams.Alpha = Alpha
        self.PulsarDopplerParams.Delta = Delta
357
358
359
360
361
362
        if self.binary:
            self.PulsarDopplerParams.asini = asini
            self.PulsarDopplerParams.period = period
            self.PulsarDopplerParams.ecc = ecc
            self.PulsarDopplerParams.tp = tp
            self.PulsarDopplerParams.argp = argp
Gregory Ashton's avatar
Gregory Ashton committed
363
364
365
366

        lalpulsar.ComputeFstat(self.FstatResults,
                               self.FstatInput,
                               self.PulsarDopplerParams,
367
                               1,
Gregory Ashton's avatar
Gregory Ashton committed
368
369
370
                               self.whatToCompute
                               )

371
        if self.transient is False:
372
373
374
375
376
377
378
379
            if self.BSGL is False:
                return self.FstatResults.twoF[0]

            twoF = np.float(self.FstatResults.twoF[0])
            self.twoFX[0] = self.FstatResults.twoFPerDet(0)
            self.twoFX[1] = self.FstatResults.twoFPerDet(1)
            BSGL = lalpulsar.ComputeBSGL(twoF, self.twoFX,
                                         self.BSGLSetup)
380
381
            if self.BSGL_FLOOR is not None and BSGL < self.BSGL_FLOOR:
                return self.BSGL_FLOOR
Gregory Ashton's avatar
Gregory Ashton committed
382
383
            else:
                return self.BSGL_PREFACTOR * BSGL/np.log10(np.exp(1))
384

385
386
        self.windowRange.t0 = int(tstart)  # TYPE UINT4
        self.windowRange.tau = int(tend - tstart)  # TYPE UINT4
387

Gregory Ashton's avatar
Gregory Ashton committed
388
        FS = lalpulsar.ComputeTransientFstatMap(
389
            self.FstatResults.multiFatoms[0], self.windowRange, False)
390
391
392
393
394
395
396
397
398
399
400
401
402
403
404
405
406
407

        if self.BSGL is False:
            return 2*FS.F_mn.data[0][0]

        FstatResults_single = copy.copy(self.FstatResults)
        FstatResults_single.lenth = 1
        FstatResults_single.data = self.FstatResults.multiFatoms[0].data[0]
        FS0 = lalpulsar.ComputeTransientFstatMap(
            FstatResults_single.multiFatoms[0], self.windowRange, False)
        FstatResults_single.data = self.FstatResults.multiFatoms[0].data[1]
        FS1 = lalpulsar.ComputeTransientFstatMap(
            FstatResults_single.multiFatoms[0], self.windowRange, False)

        self.twoFX[0] = 2*FS0.F_mn.data[0][0]
        self.twoFX[1] = 2*FS1.F_mn.data[0][0]
        BSGL = lalpulsar.ComputeBSGL(2*FS.F_mn.data[0][0], self.twoFX,
                                     self.BSGLSetup)

Gregory Ashton's avatar
Gregory Ashton committed
408
409
410
411
        if self.BSGL_FLOOR and BSGL < self.BSGL_FLOOR:
            return self.BSGL_FLOOR
        else:
            return self.BSGL_PREFACTOR * BSGL/np.log10(np.exp(1))
Gregory Ashton's avatar
Gregory Ashton committed
412

413
414
415
416
417
418
419
420
421
422
423
424
425
426
427
428
429
430
431
432
433
434
435
436
437
438
439
440
441
442
443
    def calculate_twoF_cumulative(self, F0, F1, F2, Alpha, Delta, asini=None,
                                  period=None, ecc=None, tp=None, argp=None,
                                  tstart=None, tend=None, Npoints=1000,
                                  minfraction=0.01):
        """ Calculate the cumulative twoF along the obseration span """
        duration = tend - tstart
        taus = np.linspace(minfraction*duration, duration, Npoints)
        twoFs = []
        for tau in taus:
            twoFs.append(self.run_computefstatistic_single_point(
                tstart=tstart, tend=tstart+tau, F0=F0, F1=F1, F2=F2,
                Alpha=Alpha, Delta=Delta, asini=asini, period=period, ecc=ecc,
                tp=tp, argp=argp))

        return taus, np.array(twoFs)

    def plot_twoF_cumulative(self, label, outdir, ax=None, c='k', savefig=True,
                             **kwargs):
        taus, twoFs = self.calculate_twoF_cumulative(**kwargs)
        if ax is None:
            fig, ax = plt.subplots()
        ax.plot(taus/86400., twoFs, label=label, color=c)
        ax.set_xlabel(r'Days from $t_{{\rm start}}={:.0f}$'.format(
            kwargs['tstart']))
        ax.set_ylabel(r'$\widetilde{2\mathcal{F}}_{\rm cumulative}$')
        ax.set_xlim(0, taus[-1]/86400)
        if savefig:
            plt.savefig('{}/{}_twoFcumulative.png'.format(outdir, label))
        else:
            return ax

Gregory Ashton's avatar
Gregory Ashton committed
444
445

class SemiCoherentGlitchSearch(BaseSearchClass, ComputeFstat):
446
447
448
449
450
451
452
453
454
    """ A semi-coherent glitch search

    This implements a basic `semi-coherent glitch F-stat in which the data
    is divided into two segments either side of the proposed glitch and the
    fully-coherent F-stat in each segment is averaged to give the semi-coherent
    F-stat
    """

    @initializer
Gregory Ashton's avatar
Gregory Ashton committed
455
    def __init__(self, label, outdir, tref, tstart, tend, nglitch=0,
456
                 sftfilepath=None, theta0_idx=0, BSGL=False, BSGL_PREFACTOR=1,
Gregory Ashton's avatar
Gregory Ashton committed
457
458
459
                 BSGL_FLOOR=None, minStartTime=None, maxStartTime=None,
                 minCoverFreq=None, maxCoverFreq=None, detector=None,
                 earth_ephem=None, sun_ephem=None):
460
461
462
463
        """
        Parameters
        ----------
        label, outdir: str
464
465
466
467
468
469
            A label and directory to read/write data from/to.
        tref, tstart, tend: int
            GPS seconds of the reference time, and start and end of the data.
        nglitch: int
            The (fixed) number of glitches; this can zero, but occasionally
            this causes issue (in which case just use ComputeFstat).
470
471
        sftfilepath: str
            File patern to match SFTs
472
473
474
475
        theta0_idx, int
            Index (zero-based) of which segment the theta refers to - uyseful
            if providing a tight prior on theta to allow the signal to jump
            too theta (and not just from)
476
477

        For all other parameters, see pyfstat.ComputeFStat.
478
479
480
481
482
483
484
        """

        self.fs_file_name = "{}/{}_FS.dat".format(self.outdir, self.label)
        if self.earth_ephem is None:
            self.earth_ephem = self.earth_ephem_default
        if self.sun_ephem is None:
            self.sun_ephem = self.sun_ephem_default
485
486
        self.transient = True
        self.binary = False
487
488
489
        self.init_computefstatistic_single_point()

    def compute_nglitch_fstat(self, F0, F1, F2, Alpha, Delta, *args):
490
        """ Returns the semi-coherent glitch summed twoF """
491
492
493

        args = list(args)
        tboundaries = [self.tstart] + args[-self.nglitch:] + [self.tend]
494
495
496
497
498
499
500
501
        delta_F0s = args[-3*self.nglitch:-2*self.nglitch]
        delta_F1s = args[-2*self.nglitch:-self.nglitch]
        delta_F2 = np.zeros(len(delta_F0s))
        delta_phi = np.zeros(len(delta_F0s))
        theta = [0, F0, F1, F2]
        delta_thetas = np.atleast_2d(
                np.array([delta_phi, delta_F0s, delta_F1s, delta_F2]).T)

502
503
        thetas = self.calculate_thetas(theta, delta_thetas, tboundaries,
                                       theta0_idx=self.theta0_idx)
504
505

        twoFSum = 0
506
        for i, theta_i_at_tref in enumerate(thetas):
507
508
509
            ts, te = tboundaries[i], tboundaries[i+1]

            twoFVal = self.run_computefstatistic_single_point(
510
511
                ts, te, theta_i_at_tref[1], theta_i_at_tref[2],
                theta_i_at_tref[3], Alpha, Delta)
512
513
            twoFSum += twoFVal

514
515
516
        if np.isfinite(twoFSum):
            return twoFSum
        else:
517
            return -np.inf
518
519
520

    def compute_glitch_fstat_single(self, F0, F1, F2, Alpha, Delta, delta_F0,
                                    delta_F1, tglitch):
521
522
523
524
        """ Returns the semi-coherent glitch summed twoF for nglitch=1

        Note: used for testing
        """
525
526
527
528
529
530
531
532
533
534
535

        theta = [F0, F1, F2]
        delta_theta = [delta_F0, delta_F1, 0]
        tref = self.tref

        theta_at_glitch = self.shift_coefficients(theta, tglitch - tref)
        theta_post_glitch_at_glitch = theta_at_glitch + delta_theta
        theta_post_glitch = self.shift_coefficients(
            theta_post_glitch_at_glitch, tref - tglitch)

        twoFsegA = self.run_computefstatistic_single_point(
Gregory Ashton's avatar
Gregory Ashton committed
536
            self.tstart, tglitch, theta[0], theta[1], theta[2], Alpha,
537
538
539
540
541
542
            Delta)

        if tglitch == self.tend:
            return twoFsegA

        twoFsegB = self.run_computefstatistic_single_point(
Gregory Ashton's avatar
Gregory Ashton committed
543
            tglitch, self.tend, theta_post_glitch[0],
544
545
546
547
548
549
            theta_post_glitch[1], theta_post_glitch[2], Alpha,
            Delta)

        return twoFsegA + twoFsegB


Gregory Ashton's avatar
Gregory Ashton committed
550
551
class MCMCSearch(BaseSearchClass):
    """ MCMC search using ComputeFstat"""
552
    @initializer
553
    def __init__(self, label, outdir, sftfilepath, theta_prior, tref,
554
                 tstart, tend, nsteps=[100, 100, 100], nwalkers=100, ntemps=1,
555
                 log10temperature_min=-5, theta_initial=None, scatter_val=1e-10,
556
557
                 binary=False, BSGL=False, minCoverFreq=None,
                 maxCoverFreq=None, detector=None, earth_ephem=None,
558
                 sun_ephem=None, theta0_idx=0,
Gregory Ashton's avatar
Gregory Ashton committed
559
                 BSGL_PREFACTOR=1, BSGL_FLOOR=None):
560
561
562
563
        """
        Parameters
        label, outdir: str
            A label and directory to read/write data from/to
564
565
        sftfilepath: str
            File patern to match SFTs
566
        theta_prior: dict
567
568
569
570
            Dictionary of priors and fixed values for the search parameters.
            For each parameters (key of the dict), if it is to be held fixed
            the value should be the constant float, if it is be searched, the
            value should be a dictionary of the prior.
571
572
573
574
        theta_initial: dict, array, (None)
            Either a dictionary of distribution about which to distribute the
            initial walkers about, an array (from which the walkers will be
            scattered by scatter_val, or  None in which case the prior is used.
575
576
577
578
579
580
581
        tref, tstart, tend: int
            GPS seconds of the reference time, start time and end time
        nsteps: list (m,)
            List specifying the number of steps to take, the last two entries
            give the nburn and nprod of the 'production' run, all entries
            before are for iterative initialisation steps (usually just one)
            e.g. [1000, 1000, 500].
582
583
584
585
586
587
588
589
590
591
592
        nwalkers, ntemps: int,
            The number of walkers and temperates to use in the parallel
            tempered PTSampler.
        log10temperature_min float < 0
            The  log_10(tmin) value, the set of betas passed to PTSampler are
            generated from np.logspace(0, log10temperature_min, ntemps).
        binary: Bool
            If true, search over binary parameters
        detector: str
            Two character reference to the data to use, specify None for no
            contraint.
593
594
595
596
597
598
599
600
601
602
        minCoverFreq, maxCoverFreq: float
            Minimum and maximum instantaneous frequency which will be covered
            over the SFT time span as passed to CreateFstatInput
        earth_ephem, sun_ephem: str
            Paths of the two files containing positions of Earth and Sun,
            respectively at evenly spaced times, as passed to CreateFstatInput
            If None defaults defined in BaseSearchClass will be used

        """

603
604
605
        self.minStartTime = tstart
        self.maxStartTime = tend

Gregory Ashton's avatar
Gregory Ashton committed
606
607
        if os.path.isdir(outdir) is False:
            os.mkdir(outdir)
608
        self.add_log_file()
Gregory Ashton's avatar
Gregory Ashton committed
609
610
        logging.info(
            'Set-up MCMC search for model {} on data {}'.format(
611
                self.label, self.sftfilepath))
612
        self.pickle_path = '{}/{}_saved_data.p'.format(self.outdir, self.label)
Gregory Ashton's avatar
Gregory Ashton committed
613
614
        self.theta_prior['tstart'] = self.tstart
        self.theta_prior['tend'] = self.tend
615
616
        self.unpack_input_theta()
        self.ndim = len(self.theta_keys)
617
618
619
620
        if self.log10temperature_min:
            self.betas = np.logspace(0, self.log10temperature_min, self.ntemps)
        else:
            self.betas = None
621

622
623
624
625
626
627
628
629
630
        if earth_ephem is None:
            self.earth_ephem = self.earth_ephem_default
        if sun_ephem is None:
            self.sun_ephem = self.sun_ephem_default

        if args.clean and os.path.isfile(self.pickle_path):
            os.rename(self.pickle_path, self.pickle_path+".old")

        self.old_data_is_okay_to_use = self.check_old_data_is_okay_to_use()
631
632
633
        self.log_input()

    def log_input(self):
634
        logging.info('theta_prior = {}'.format(self.theta_prior))
635
        logging.info('nwalkers={}'.format(self.nwalkers))
636
637
638
639
        logging.info('scatter_val = {}'.format(self.scatter_val))
        logging.info('nsteps = {}'.format(self.nsteps))
        logging.info('ntemps = {}'.format(self.ntemps))
        logging.info('log10temperature_min = {}'.format(
640
            self.log10temperature_min))
641
642
643

    def inititate_search_object(self):
        logging.info('Setting up search object')
Gregory Ashton's avatar
Gregory Ashton committed
644
        self.search = ComputeFstat(
645
646
647
648
            tref=self.tref, sftfilepath=self.sftfilepath,
            minCoverFreq=self.minCoverFreq, maxCoverFreq=self.maxCoverFreq,
            earth_ephem=self.earth_ephem, sun_ephem=self.sun_ephem,
            detector=self.detector, BSGL=self.BSGL, transient=False,
649
            minStartTime=self.minStartTime, maxStartTime=self.maxStartTime,
Gregory Ashton's avatar
Gregory Ashton committed
650
            BSGL_PREFACTOR=self.BSGL_PREFACTOR, BSGL_FLOOR=self.BSGL_FLOOR)
651
652

    def logp(self, theta_vals, theta_prior, theta_keys, search):
Gregory Ashton's avatar
Gregory Ashton committed
653
        H = [self.generic_lnprior(**theta_prior[key])(p) for p, key in
654
655
656
657
658
659
             zip(theta_vals, theta_keys)]
        return np.sum(H)

    def logl(self, theta, search):
        for j, theta_i in enumerate(self.theta_idxs):
            self.fixed_theta[theta_i] = theta[j]
Gregory Ashton's avatar
Gregory Ashton committed
660
        FS = search.run_computefstatistic_single_point(*self.fixed_theta)
661
662
663
        return FS

    def unpack_input_theta(self):
Gregory Ashton's avatar
Gregory Ashton committed
664
665
        full_theta_keys = ['tstart', 'tend', 'F0', 'F1', 'F2', 'Alpha',
                           'Delta']
666
667
668
        if self.binary:
            full_theta_keys += [
                'asini', 'period', 'ecc', 'tp', 'argp']
669
670
        full_theta_keys_copy = copy.copy(full_theta_keys)

Gregory Ashton's avatar
Gregory Ashton committed
671
672
        full_theta_symbols = ['_', '_', '$f$', '$\dot{f}$', '$\ddot{f}$',
                              r'$\alpha$', r'$\delta$']
673
674
675
676
        if self.binary:
            full_theta_symbols += [
                'asini', 'period', 'period', 'ecc', 'tp', 'argp']

677
678
        self.theta_keys = []
        fixed_theta_dict = {}
679
        for key, val in self.theta_prior.iteritems():
680
681
            if type(val) is dict:
                fixed_theta_dict[key] = 0
Gregory Ashton's avatar
Gregory Ashton committed
682
                self.theta_keys.append(key)
683
684
685
686
687
688
            elif type(val) in [float, int, np.float64]:
                fixed_theta_dict[key] = val
            else:
                raise ValueError(
                    'Type {} of {} in theta not recognised'.format(
                        type(val), key))
Gregory Ashton's avatar
Gregory Ashton committed
689
            full_theta_keys_copy.pop(full_theta_keys_copy.index(key))
690
691
692
693
694
695
696
697
698
699
700
701
702
703
704
705

        if len(full_theta_keys_copy) > 0:
            raise ValueError(('Input dictionary `theta` is missing the'
                              'following keys: {}').format(
                                  full_theta_keys_copy))

        self.fixed_theta = [fixed_theta_dict[key] for key in full_theta_keys]
        self.theta_idxs = [full_theta_keys.index(k) for k in self.theta_keys]
        self.theta_symbols = [full_theta_symbols[i] for i in self.theta_idxs]

        idxs = np.argsort(self.theta_idxs)
        self.theta_idxs = [self.theta_idxs[i] for i in idxs]
        self.theta_symbols = [self.theta_symbols[i] for i in idxs]
        self.theta_keys = [self.theta_keys[i] for i in idxs]

    def check_initial_points(self, p0):
706
707
708
709
710
711
712
713
714
715
716
717
718
719
720
721
722
723
724
725
726
727
728
729
730
731
732
733
734
735
736
737
738
739
740
741
        for nt in range(self.ntemps):
            logging.info('Checking temperature {} chains'.format(nt))
            initial_priors = np.array([
                self.logp(p, self.theta_prior, self.theta_keys, self.search)
                for p in p0[nt]])
            number_of_initial_out_of_bounds = sum(initial_priors == -np.inf)

            if number_of_initial_out_of_bounds > 0:
                logging.warning(
                    'Of {} initial values, {} are -np.inf due to the prior'
                    .format(len(initial_priors),
                            number_of_initial_out_of_bounds))

                p0 = self.generate_new_p0_to_fix_initial_points(
                    p0, nt, initial_priors)

    def generate_new_p0_to_fix_initial_points(self, p0, nt, initial_priors):
        logging.info('Attempting to correct intial values')
        idxs = np.arange(self.nwalkers)[initial_priors == -np.inf]
        count = 0
        while sum(initial_priors == -np.inf) > 0 and count < 100:
            for j in idxs:
                p0[nt][j] = (p0[nt][np.random.randint(0, self.nwalkers)]*(
                             1+np.random.normal(0, 1e-10, self.ndim)))
            initial_priors = np.array([
                self.logp(p, self.theta_prior, self.theta_keys,
                          self.search)
                for p in p0[nt]])
            count += 1

        if sum(initial_priors == -np.inf) > 0:
            logging.info('Failed to fix initial priors')
        else:
            logging.info('Suceeded to fix initial priors')

        return p0
742

Gregory Ashton's avatar
Gregory Ashton committed
743
    def run_sampler_with_progress_bar(self, sampler, ns, p0):
744
745
        for result in tqdm(sampler.sample(p0, iterations=ns), total=ns):
            pass
Gregory Ashton's avatar
Gregory Ashton committed
746
747
748
        return sampler

    def run(self, proposal_scale_factor=2):
749
750
751
752
753
754
755
756
757
758
759
760
761
762
763
764

        if self.old_data_is_okay_to_use is True:
            logging.warning('Using saved data from {}'.format(
                self.pickle_path))
            d = self.get_saved_data()
            self.sampler = d['sampler']
            self.samples = d['samples']
            self.lnprobs = d['lnprobs']
            self.lnlikes = d['lnlikes']
            return

        self.inititate_search_object()

        sampler = emcee.PTSampler(
            self.ntemps, self.nwalkers, self.ndim, self.logl, self.logp,
            logpargs=(self.theta_prior, self.theta_keys, self.search),
765
            loglargs=(self.search,), betas=self.betas, a=proposal_scale_factor)
766

Gregory Ashton's avatar
Gregory Ashton committed
767
768
        p0 = self.generate_initial_p0()
        p0 = self.apply_corrections_to_p0(p0)
769
770
771
772
773
        self.check_initial_points(p0)

        ninit_steps = len(self.nsteps) - 2
        for j, n in enumerate(self.nsteps[:-2]):
            logging.info('Running {}/{} initialisation with {} steps'.format(
774
                j+1, ninit_steps, n))
Gregory Ashton's avatar
Gregory Ashton committed
775
            sampler = self.run_sampler_with_progress_bar(sampler, n, p0)
776
777
            logging.info("Mean acceptance fraction: {}"
                         .format(np.mean(sampler.acceptance_fraction, axis=1)))
778
779
780
            if self.ntemps > 1:
                logging.info("Tswap acceptance fraction: {}"
                             .format(sampler.tswap_acceptance_fraction))
Gregory Ashton's avatar
Gregory Ashton committed
781
            fig, axes = self.plot_walkers(sampler, symbols=self.theta_symbols)
782
783
784
            fig.savefig('{}/{}_init_{}_walkers.png'.format(
                self.outdir, self.label, j))

785
            p0 = self.get_new_p0(sampler)
Gregory Ashton's avatar
Gregory Ashton committed
786
            p0 = self.apply_corrections_to_p0(p0)
787
788
789
            self.check_initial_points(p0)
            sampler.reset()

Gregory Ashton's avatar
Gregory Ashton committed
790
791
792
793
        if len(self.nsteps) > 1:
            nburn = self.nsteps[-2]
        else:
            nburn = 0
794
795
796
        nprod = self.nsteps[-1]
        logging.info('Running final burn and prod with {} steps'.format(
            nburn+nprod))
Gregory Ashton's avatar
Gregory Ashton committed
797
        sampler = self.run_sampler_with_progress_bar(sampler, nburn+nprod, p0)
798
799
        logging.info("Mean acceptance fraction: {}"
                     .format(np.mean(sampler.acceptance_fraction, axis=1)))
800
801
802
        if self.ntemps > 1:
            logging.info("Tswap acceptance fraction: {}"
                         .format(sampler.tswap_acceptance_fraction))
803

Gregory Ashton's avatar
Gregory Ashton committed
804
805
        fig, axes = self.plot_walkers(sampler, symbols=self.theta_symbols,
                                      burnin_idx=nburn)
806
807
808
809
810
811
812
813
814
815
816
        fig.savefig('{}/{}_walkers.png'.format(self.outdir, self.label))

        samples = sampler.chain[0, :, nburn:, :].reshape((-1, self.ndim))
        lnprobs = sampler.lnprobability[0, :, nburn:].reshape((-1))
        lnlikes = sampler.lnlikelihood[0, :, nburn:].reshape((-1))
        self.sampler = sampler
        self.samples = samples
        self.lnprobs = lnprobs
        self.lnlikes = lnlikes
        self.save_data(sampler, samples, lnprobs, lnlikes)

817
    def plot_corner(self, figsize=(7, 7),  tglitch_ratio=False,
818
819
820
                    add_prior=False, nstds=None, label_offset=0.4,
                    dpi=300, rc_context={}, **kwargs):

Gregory Ashton's avatar
Gregory Ashton committed
821
822
823
824
825
826
827
828
829
830
        if self.ndim < 2:
            with plt.rc_context(rc_context):
                fig, ax = plt.subplots(figsize=figsize)
                ax.hist(self.samples, bins=50, histtype='stepfilled')
                ax.set_xlabel(self.theta_symbols[0])

            fig.savefig('{}/{}_corner.png'.format(
                self.outdir, self.label), dpi=dpi)
            return

831
832
833
834
835
836
        with plt.rc_context(rc_context):
            fig, axes = plt.subplots(self.ndim, self.ndim,
                                     figsize=figsize)

            samples_plt = copy.copy(self.samples)
            theta_symbols_plt = copy.copy(self.theta_symbols)
837
838
            theta_symbols_plt = [s.replace('_{glitch}', r'_\textrm{glitch}')
                                 for s in theta_symbols_plt]
839
840
841
842
843
844
845
846
847
848
849
850
851
852
853
854
855
856
857
858
859
860
861
862
863
864
865
866
867
868
869
870
871
872
873
874
875
876
877
878
879
880
881
882
883
884
885
886
887

            if tglitch_ratio:
                for j, k in enumerate(self.theta_keys):
                    if k == 'tglitch':
                        s = samples_plt[:, j]
                        samples_plt[:, j] = (s - self.tstart)/(
                                             self.tend - self.tstart)
                        theta_symbols_plt[j] = r'$R_{\textrm{glitch}}$'

            if type(nstds) is int and 'range' not in kwargs:
                _range = []
                for j, s in enumerate(samples_plt.T):
                    median = np.median(s)
                    std = np.std(s)
                    _range.append((median - nstds*std, median + nstds*std))
            else:
                _range = None

            fig_triangle = corner.corner(samples_plt,
                                         labels=theta_symbols_plt,
                                         fig=fig,
                                         bins=50,
                                         max_n_ticks=4,
                                         plot_contours=True,
                                         plot_datapoints=True,
                                         label_kwargs={'fontsize': 8},
                                         data_kwargs={'alpha': 0.1,
                                                      'ms': 0.5},
                                         range=_range,
                                         **kwargs)

            axes_list = fig_triangle.get_axes()
            axes = np.array(axes_list).reshape(self.ndim, self.ndim)
            plt.draw()
            for ax in axes[:, 0]:
                ax.yaxis.set_label_coords(-label_offset, 0.5)
            for ax in axes[-1, :]:
                ax.xaxis.set_label_coords(0.5, -label_offset)
            for ax in axes_list:
                ax.set_rasterized(True)
                ax.set_rasterization_zorder(-10)
            plt.tight_layout(h_pad=0.0, w_pad=0.0)
            fig.subplots_adjust(hspace=0.05, wspace=0.05)

            if add_prior:
                self.add_prior_to_corner(axes, samples_plt)

            fig_triangle.savefig('{}/{}_corner.png'.format(
                self.outdir, self.label), dpi=dpi)
888
889
890
891
892
893

    def add_prior_to_corner(self, axes, samples):
        for i, key in enumerate(self.theta_keys):
            ax = axes[i][i]
            xlim = ax.get_xlim()
            s = samples[:, i]
Gregory Ashton's avatar
Gregory Ashton committed
894
            prior = self.generic_lnprior(**self.theta_prior[key])
895
896
897
898
899
900
            x = np.linspace(s.min(), s.max(), 100)
            ax2 = ax.twinx()
            ax2.get_yaxis().set_visible(False)
            ax2.plot(x, [prior(xi) for xi in x], '-r')
            ax.set_xlim(xlim)

901
902
903
904
905
906
907
908
909
910
911
912
913
914
915
916
917
918
919
    def plot_prior_posterior(self, normal_stds=2):
        """ Plot the posterior in the context of the prior """
        fig, axes = plt.subplots(nrows=self.ndim, figsize=(8, 4*self.ndim))
        N = 1000
        from scipy.stats import gaussian_kde

        for i, (ax, key) in enumerate(zip(axes, self.theta_keys)):
            prior_dict = self.theta_prior[key]
            prior_func = self.generic_lnprior(**prior_dict)
            if prior_dict['type'] == 'unif':
                x = np.linspace(prior_dict['lower'], prior_dict['upper'], N)
                prior = prior_func(x)
                prior[0] = 0
                prior[-1] = 0
            elif prior_dict['type'] == 'norm':
                lower = prior_dict['loc'] - normal_stds * prior_dict['scale']
                upper = prior_dict['loc'] + normal_stds * prior_dict['scale']
                x = np.linspace(lower, upper, N)
                prior = prior_func(x)
920
921
922
923
924
            elif prior_dict['type'] == 'halfnorm':
                lower = prior_dict['loc']
                upper = prior_dict['loc'] + normal_stds * prior_dict['scale']
                x = np.linspace(lower, upper, N)
                prior = [prior_func(xi) for xi in x]
925
926
927
928
929
930
931
932
933
934
935
936
937
938
939
940
941
942
943
944
945
946
947
            else:
                raise ValueError('Not implemented for prior type {}'.format(
                    prior_dict['type']))
            priorln = ax.plot(x, prior, 'r', label='prior')
            ax.set_xlabel(self.theta_symbols[i])

            s = self.samples[:, i]
            while len(s) > 10**4:
                # random downsample to avoid slow calculation of kde
                s = np.random.choice(s, size=int(len(s)/2.))
            kde = gaussian_kde(s)
            ax2 = ax.twinx()
            postln = ax2.plot(x, kde.pdf(x), 'k', label='posterior')
            ax2.set_yticklabels([])
            ax.set_yticklabels([])

        lns = priorln + postln
        labs = [l.get_label() for l in lns]
        axes[0].legend(lns, labs, loc=1, framealpha=0.8)

        fig.savefig('{}/{}_prior_posterior.png'.format(
            self.outdir, self.label))

Gregory Ashton's avatar
Gregory Ashton committed
948
    def generic_lnprior(self, **kwargs):
949
950
951
952
953
954
955
956
957
958
959
960
961
962
963
964
965
966
967
968
969
970
971
972
973
974
975
976
977
978
979
980
981
982
983
984
985
986
987
988
989
990
        """ Return a lambda function of the pdf

        Parameters
        ----------
        kwargs: dict
            A dictionary containing 'type' of pdf and shape parameters

        """

        def logunif(x, a, b):
            above = x < b
            below = x > a
            if type(above) is not np.ndarray:
                if above and below:
                    return -np.log(b-a)
                else:
                    return -np.inf
            else:
                idxs = np.array([all(tup) for tup in zip(above, below)])
                p = np.zeros(len(x)) - np.inf
                p[idxs] = -np.log(b-a)
                return p

        def halfnorm(x, loc, scale):
            if x < 0:
                return -np.inf
            else:
                return -0.5*((x-loc)**2/scale**2+np.log(0.5*np.pi*scale**2))

        def cauchy(x, x0, gamma):
            return 1.0/(np.pi*gamma*(1+((x-x0)/gamma)**2))

        def exp(x, x0, gamma):
            if x > x0:
                return np.log(gamma) - gamma*(x - x0)
            else:
                return -np.inf

        if kwargs['type'] == 'unif':
            return lambda x: logunif(x, kwargs['lower'], kwargs['upper'])
        elif kwargs['type'] == 'halfnorm':
            return lambda x: halfnorm(x, kwargs['loc'], kwargs['scale'])
991
992
        elif kwargs['type'] == 'neghalfnorm':
            return lambda x: halfnorm(-x, kwargs['loc'], kwargs['scale'])
993
994
995
996
997
998
999
        elif kwargs['type'] == 'norm':
            return lambda x: -0.5*((x - kwargs['loc'])**2/kwargs['scale']**2
                                   + np.log(2*np.pi*kwargs['scale']**2))
        else:
            logging.info("kwargs:", kwargs)
            raise ValueError("Print unrecognise distribution")

Gregory Ashton's avatar
Gregory Ashton committed
1000
    def generate_rv(self, **kwargs):
1001
1002
1003
1004
1005
1006
1007
1008
        dist_type = kwargs.pop('type')
        if dist_type == "unif":
            return np.random.uniform(low=kwargs['lower'], high=kwargs['upper'])
        if dist_type == "norm":
            return np.random.normal(loc=kwargs['loc'], scale=kwargs['scale'])
        if dist_type == "halfnorm":
            return np.abs(np.random.normal(loc=kwargs['loc'],
                                           scale=kwargs['scale']))
1009
1010
1011
        if dist_type == "neghalfnorm":
            return -1 * np.abs(np.random.normal(loc=kwargs['loc'],
                                                scale=kwargs['scale']))
1012
1013
1014
1015
1016
1017
        if dist_type == "lognorm":
            return np.random.lognormal(
                mean=kwargs['loc'], sigma=kwargs['scale'])
        else:
            raise ValueError("dist_type {} unknown".format(dist_type))

Gregory Ashton's avatar
Gregory Ashton committed
1018
    def plot_walkers(self, sampler, symbols=None, alpha=0.4, color="k", temp=0,
1019
                     lw=0.1, burnin_idx=None, add_det_stat_burnin=False):
1020
1021
1022
1023
1024
1025
1026
1027
1028
1029
1030
1031
1032
1033
1034
1035
        """ Plot all the chains from a sampler """

        shape = sampler.chain.shape
        if len(shape) == 3:
            nwalkers, nsteps, ndim = shape
            chain = sampler.chain[:, :, :]
        if len(shape) == 4:
            ntemps, nwalkers, nsteps, ndim = shape
            if temp < ntemps:
                logging.info("Plotting temperature {} chains".format(temp))
            else:
                raise ValueError(("Requested temperature {} outside of"
                                  "available range").format(temp))
            chain = sampler.chain[temp, :, :, :]

        with plt.style.context(('classic')):
Gregory Ashton's avatar
Gregory Ashton committed
1036
1037
1038
1039
            fig = plt.figure(figsize=(8, 4*ndim))
            ax = fig.add_subplot(ndim+1, 1, 1)
            axes = [ax] + [fig.add_subplot(ndim+1, 1, i, sharex=ax)
                           for i in range(2, ndim+1)]
1040

Gregory Ashton's avatar
Gregory Ashton committed
1041
            idxs = np.arange(chain.shape[1])
1042
1043
            if ndim > 1:
                for i in range(ndim):
1044
                    axes[i].ticklabel_format(useOffset=False, axis='y')
Gregory Ashton's avatar
Gregory Ashton committed
1045
1046
1047
                    cs = chain[:, :, i].T
                    if burnin_idx:
                        axes[i].plot(idxs[:burnin_idx], cs[:burnin_idx],
Gregory Ashton's avatar
Gregory Ashton committed
1048
                                     color="r", alpha=alpha, lw=lw)
Gregory Ashton's avatar
Gregory Ashton committed
1049
                    axes[i].plot(idxs[burnin_idx:], cs[burnin_idx:], color="k",
Gregory Ashton's avatar
Gregory Ashton committed
1050
                                 alpha=alpha, lw=lw)
1051
1052
                    if symbols:
                        axes[i].set_ylabel(symbols[i])
1053
            else:
Gregory Ashton's avatar
Gregory Ashton committed
1054
                axes[0].ticklabel_format(useOffset=False, axis='y')
Gregory Ashton's avatar
Gregory Ashton committed
1055
                cs = chain[:, :, temp].T
Gregory Ashton's avatar
Gregory Ashton committed
1056
1057
1058
1059
1060
1061
1062
                if burnin_idx:
                    axes[0].plot(idxs[:burnin_idx], cs[:burnin_idx],
                                 color="r", alpha=alpha, lw=lw)
                axes[0].plot(idxs[burnin_idx:], cs[burnin_idx:], color="k",
                             alpha=alpha, lw=lw)
                if symbols:
                    axes[0].set_ylabel(symbols[0])
1063

Gregory Ashton's avatar
Gregory Ashton committed
1064
1065
        axes.append(fig.add_subplot(ndim+1, 1, ndim+1))
        lnl = sampler.lnlikelihood[temp, :, :]
1066
        if burnin_idx and add_det_stat_burnin:
Gregory Ashton's avatar
Gregory Ashton committed
1067
1068
            axes[-1].hist(lnl[:, :burnin_idx].flatten(), bins=50,
                          histtype='step', color='r')
Gregory Ashton's avatar
Gregory Ashton committed
1069
1070
        axes[-1].hist(lnl[:, burnin_idx:].flatten(), bins=50, histtype='step',
                      color='k')
Gregory Ashton's avatar
Gregory Ashton committed
1071
1072
1073
1074
        if self.BSGL:
            axes[-1].set_xlabel(r'$\mathcal{B}_\mathrm{S/GL}$')
        else:
            axes[-1].set_xlabel(r'$2\mathcal{F}$')
Gregory Ashton's avatar
Gregory Ashton committed
1075

1076
1077
        return fig, axes

Gregory Ashton's avatar
Gregory Ashton committed
1078
1079
1080
1081
1082
    def apply_corrections_to_p0(self, p0):
        """ Apply any correction to the initial p0 values """
        return p0

    def generate_scattered_p0(self, p):
1083
        """ Generate a set of p0s scattered about p """
Gregory Ashton's avatar
Gregory Ashton committed
1084
        p0 = [[p + self.scatter_val * p * np.random.randn(self.ndim)
1085
1086
1087
1088
               for i in xrange(self.nwalkers)]
              for j in xrange(self.ntemps)]
        return p0

Gregory Ashton's avatar
Gregory Ashton committed
1089
    def generate_initial_p0(self):
1090
1091
1092
        """ Generate a set of init vals for the walkers """

        if type(self.theta_initial) == dict:
1093
            logging.info('Generate initial values from initial dictionary')
1094
            if hasattr(self, 'nglitch') and self.nglitch > 1:
1095
                raise ValueError('Initial dict not implemented for nglitch>1')
Gregory Ashton's avatar
Gregory Ashton committed
1096
            p0 = [[[self.generate_rv(**self.theta_initial[key])
1097
1098
1099
                    for key in self.theta_keys]
                   for i in range(self.nwalkers)]
                  for j in range(self.ntemps)]
1100
1101
1102
1103
1104
1105
        elif type(self.theta_initial) == list:
            logging.info('Generate initial values from list of theta_initial')
            p0 = [[[self.generate_rv(**val)
                    for val in self.theta_initial]
                   for i in range(self.nwalkers)]
                  for j in range(self.ntemps)]
1106
        elif self.theta_initial is None:
1107
            logging.info('Generate initial values from prior dictionary')
Gregory Ashton's avatar
Gregory Ashton committed
1108
            p0 = [[[self.generate_rv(**self.theta_prior[key])
1109
1110
1111
1112
                    for key in self.theta_keys]
                   for i in range(self.nwalkers)]
                  for j in range(self.ntemps)]
        elif len(self.theta_initial) == self.ndim:
Gregory Ashton's avatar
Gregory Ashton committed
1113
            p0 = self.generate_scattered_p0(self.theta_initial)
1114
1115
1116
1117
1118
        else:
            raise ValueError('theta_initial not understood')

        return p0

1119
    def get_new_p0(self, sampler):
1120
1121
1122
1123
1124
1125
        """ Returns new initial positions for walkers are burn0 stage

        This returns new positions for all walkers by scattering points about
        the maximum posterior with scale `scatter_val`.

        """
Gregory Ashton's avatar
Gregory Ashton committed
1126
1127
1128
1129
        temp_idx = 0
        pF = sampler.chain[temp_idx, :, :, :]
        lnl = sampler.lnlikelihood[temp_idx, :, :]
        lnp = sampler.lnprobability[temp_idx, :, :]
1130
1131

        # General warnings about the state of lnp
Gregory Ashton's avatar
Gregory Ashton committed
1132
        if np.any(np.isnan(lnp)):
1133
1134
            logging.warning(
                "Of {} lnprobs {} are nan".format(
Gregory Ashton's avatar
Gregory Ashton committed
1135
1136
                    np.shape(lnp), np.sum(np.isnan(lnp))))
        if np.any(np.isposinf(lnp)):
1137
1138
            logging.warning(
                "Of {} lnprobs {} are +np.inf".format(
Gregory Ashton's avatar
Gregory Ashton committed
1139
1140
                    np.shape(lnp), np.sum(np.isposinf(lnp))))
        if np.any(np.isneginf(lnp)):
1141
1142
            logging.warning(
                "Of {} lnprobs {} are -np.inf".format(
Gregory Ashton's avatar
Gregory Ashton committed
1143
                    np.shape(lnp), np.sum(np.isneginf(lnp))))
1144

1145
1146
        lnp_finite = copy.copy(lnp)
        lnp_finite[np.isinf(lnp)] = np.nan
Gregory Ashton's avatar
Gregory Ashton committed
1147
1148
        idx = np.unravel_index(np.nanargmax(lnp_finite), lnp_finite.shape)
        p = pF[idx]
1149
        p0 = self.generate_scattered_p0(p)
1150

1151
1152
1153
1154
1155
1156
1157
1158
        self.search.BSGL = False
        twoF = self.logl(p, self.search)
        self.search.BSGL = self.BSGL

        logging.info(('Gen. new p0 from pos {} which had det. stat.={:2.1f},'
                      ' twoF={:2.1f} and lnp={:2.1f}')
                     .format(idx[1], lnl[idx], twoF, lnp_finite[idx]))

1159
1160
1161
1162
1163
        return p0

    def get_save_data_dictionary(self):
        d = dict(nsteps=self.nsteps, nwalkers=self.nwalkers,
                 ntemps=self.ntemps, theta_keys=self.theta_keys,
Gregory Ashton's avatar
Gregory Ashton committed
1164
                 theta_prior=self.theta_prior, scatter_val=self.scatter_val,
1165
                 log10temperature_min=self.log10temperature_min,
1166
                 theta0_idx=self.theta0_idx, BSGL=self.BSGL,
Gregory Ashton's avatar
Gregory Ashton committed
1167
1168
                 BSGL_PREFACTOR=self.BSGL_PREFACTOR,
                 BSGL_FLOOR=self.BSGL_FLOOR)
1169
1170
1171
1172
1173
1174
1175
1176
1177
1178
1179
1180
1181
1182
1183
1184
1185
        return d

    def save_data(self, sampler, samples, lnprobs, lnlikes):
        d = self.get_save_data_dictionary()
        d['sampler'] = sampler
        d['samples'] = samples
        d['lnprobs'] = lnprobs
        d['lnlikes'] = lnlikes

        if os.path.isfile(self.pickle_path):
            logging.info('Saving backup of {} as {}.old'.format(
                self.pickle_path, self.pickle_path))
            os.rename(self.pickle_path, self.pickle_path+".old")
        with open(self.pickle_path, "wb") as File:
            pickle.dump(d, File)

    def get_list_of_matching_sfts(self):
1186
        matches = glob.glob(self.sftfilepath)
1187
1188
1189
1190
        if len(matches) > 0:
            return matches
        else:
            raise IOError('No sfts found matching {}'.format(
1191
                self.sftfilepath))
1192
1193
1194
1195
1196
1197
1198

    def get_saved_data(self):
        with open(self.pickle_path, "r") as File:
            d = pickle.load(File)
        return d

    def check_old_data_is_okay_to_use(self):
1199
1200
1201
1202
        if args.use_old_data:
            logging.info("Forcing use of old data")
            return True

1203
1204
1205
1206
1207
1208
1209
1210
1211
1212
1213
1214
1215
1216
1217
1218
1219
1220
1221
1222
1223
1224
1225
1226
        if os.path.isfile(self.pickle_path) is False:
            logging.info('No pickled data found')
            return False

        oldest_sft = min([os.path.getmtime(f) for f in
                          self.get_list_of_matching_sfts()])
        if os.path.getmtime(self.pickle_path) < oldest_sft:
            logging.info('Pickled data outdates sft files')
            return False

        old_d = self.get_saved_data().copy()
        new_d = self.get_save_data_dictionary().copy()

        old_d.pop('samples')
        old_d.pop('sampler')
        old_d.pop('lnprobs')
        old_d.pop('lnlikes')

        mod_keys = []
        for key in new_d.keys():
            if key in old_d:
                if new_d[key] != old_d[key]:
                    mod_keys.append((key, old_d[key], new_d[key]))
            else:
1227
                raise ValueError('Keys {} not in old dictionary'.format(key))
1228
1229
1230
1231
1232
1233
1234
1235
1236

        if len(mod_keys) == 0:
            return True
        else:
            logging.warning("Saved data differs from requested")
            logging.info("Differences found in following keys:")
            for key in mod_keys:
                if len(key) == 3:
                    if np.isscalar(key[1]) or key[0] == 'nsteps':
1237
                        logging.info("    {} : {} -> {}".format(*key))
1238
                    else:
1239
                        logging.info("    " + key[0])
1240
1241
1242
1243
1244
                else:
                    logging.info(key)
            return False

    def get_max_twoF(self, threshold=0.05):
1245
        """ Returns the max likelihood sample and the corresponding 2F value
1246
1247
1248
1249
1250
1251
1252
1253
1254
1255
1256
1257
1258
1259

        Note: the sample is returned as a dictionary along with an estimate of
        the standard deviation calculated from the std of all samples with a
        twoF within `threshold` (relative) to the max twoF

        """
        if any(np.isposinf(self.lnlikes)):
            logging.info('twoF values contain positive infinite values')
        if any(np.isneginf(self.lnlikes)):
            logging.info('twoF values contain negative infinite values')
        if any(np.isnan(self.lnlikes)):
            logging.info('twoF values contain nan')
        idxs = np.isfinite(self.lnlikes)
        jmax = np.nanargmax(self.lnlikes[idxs])
1260
        maxlogl = self.lnlikes[jmax]
1261
        d = OrderedDict()
1262

1263
1264
1265
1266
1267
1268
1269
1270
1271
1272
        if self.BSGL:
            if hasattr(self, 'search') is False:
                self.inititate_search_object()
            p = self.samples[jmax]
            self.search.BSGL = False
            maxtwoF = self.logl(p, self.search)
            self.search.BSGL = self.BSGL
        else:
            maxtwoF = maxlogl

Gregory Ashton's avatar
Gregory Ashton committed
1273
        repeats = []
1274
        for i, k in enumerate(self.theta_keys):
Gregory Ashton's avatar
Gregory Ashton committed
1275
1276
1277
1278
1279
1280
1281
1282
1283
1284
            if k in d and k not in repeats:
                d[k+'_0'] = d[k]  # relabel the old key
                d.pop(k)
                repeats.append(k)
            if k in repeats:
                k = k + '_0'
                count = 1
                while k in d:
                    k = k.replace('_{}'.format(count-1), '_{}'.format(count))
                    count += 1
1285
1286
1287
1288
1289
            d[k] = self.samples[jmax][i]
        return d, maxtwoF

    def get_median_stds(self):
        """ Returns a dict of the median and std of all production samples """