74 KB
Newer Older
""" Classes for various types of searches using ComputeFstatistic """
import os
import sys
import itertools
import logging
import argparse
import copy
import glob
import inspect
from functools import wraps
import subprocess
from collections import OrderedDict

import numpy as np
import matplotlib
import matplotlib.pyplot as plt
import emcee
import corner
import dill as pickle
import lal
import lalpulsar

plt.rcParams['text.usetex'] = True
plt.rcParams['axes.formatter.useoffset'] = False

config_file = os.path.expanduser('~')+'/.pyfstat.conf'
if os.path.isfile(config_file):
    d = {}
    with open(config_file, 'r') as f:
        for line in f:
            k, v = line.split('=')
            k = k.replace(' ', '')
            v = v.replace(' ', '').replace("'", "").replace('"', '').replace('\n', '')
            d[k] = v
    earth_ephem = d['earth_ephem']
    sun_ephem = d['sun_ephem']
    logging.warning('No ~/.pyfstat.conf file found please provide the paths '
                    'when initialising searches')
    earth_ephem = None
    sun_ephem = None

parser = argparse.ArgumentParser()
parser.add_argument("-q", "--quite", help="Decrease output verbosity",
parser.add_argument("-c", "--clean", help="Don't use cached data",
parser.add_argument("-u", "--use-old-data", action="store_true")
parser.add_argument('unittest_args', nargs='*')
args, unknown = parser.parse_known_args()
sys.argv[1:] = args.unittest_args

if args.quite:
    log_level = logging.WARNING
    log_level = logging.DEBUG

                    format='%(asctime)s %(levelname)-8s: %(message)s',


def initializer(func):
    """ Automatically assigns the parameters to self """
    names, varargs, keywords, defaults = inspect.getargspec(func)

    def wrapper(self, *args, **kargs):
        for name, arg in list(zip(names[1:], args)) + list(kargs.items()):
            setattr(self, name, arg)

        for name, default in zip(reversed(names), reversed(defaults)):
            if not hasattr(self, name):
                setattr(self, name, default)

        func(self, *args, **kargs)

    return wrapper

def read_par(label, outdir):
    """ Read in a .par file, returns a dictionary of the values """
    filename = '{}/{}.par'.format(outdir, label)
    d = {}
    with open(filename, 'r') as f:
        for line in f:
            if len(line.split('=')) > 1:
                key, val = line.rstrip('\n').split(' = ')
                key = key.strip()
                d[key] = np.float64(eval(val.rstrip('; ')))
    return d

class BaseSearchClass(object):
    """ The base search class, provides ephemeris and general utilities """

    earth_ephem_default = earth_ephem
    sun_ephem_default = sun_ephem

    def add_log_file(self):
        ' Log output to a log-file, requires class to have outdir and label '
        logfilename = '{}/{}.log'.format(self.outdir, self.label)
        fh = logging.FileHandler(logfilename)
            '%(asctime)s %(levelname)-8s: %(message)s',
            datefmt='%y-%m-%d %H:%M'))

    def shift_matrix(self, n, dT):
        """ Generate the shift matrix """
        m = np.zeros((n, n))
        factorial = np.math.factorial
        for i in range(n):
            for j in range(n):
                if i == j:
                    m[i, j] = 1.0
                elif i > j:
                    m[i, j] = 0.0
                    if i == 0:
                        m[i, j] = 2*np.pi*float(dT)**(j-i) / factorial(j-i)
                        m[i, j] = float(dT)**(j-i) / factorial(j-i)

        return m

    def shift_coefficients(self, theta, dT):
        """ Shift a set of coefficients by dT

        theta: array-like, shape (n,)
            vector of the expansion coefficients to transform starting from the
            lowest degree e.g [phi, F0, F1,...].
        dT: float
            difference between the two reference times as tref_new - tref_old.

        theta_new: array-like shape (n,)
            vector of the coefficients as evaluate as the new reference time.
        n = len(theta)
        m = self.shift_matrix(n, dT)
        return, theta)

    def calculate_thetas(self, theta, delta_thetas, tbounds, theta0_idx=0):
        """ Calculates the set of coefficients for the post-glitch signal """
        thetas = [theta]
        for i, dt in enumerate(delta_thetas):
            if i < theta0_idx:
                pre_theta_at_ith_glitch = self.shift_coefficients(
                    thetas[0], tbounds[i+1] - self.tref)
                post_theta_at_ith_glitch = pre_theta_at_ith_glitch - dt
                thetas.insert(0, self.shift_coefficients(
                    post_theta_at_ith_glitch, self.tref - tbounds[i+1]))

            elif i >= theta0_idx:
                pre_theta_at_ith_glitch = self.shift_coefficients(
                    thetas[i], tbounds[i+1] - self.tref)
                post_theta_at_ith_glitch = pre_theta_at_ith_glitch + dt
                    post_theta_at_ith_glitch, self.tref - tbounds[i+1]))
        return thetas

Gregory Ashton's avatar
Gregory Ashton committed
class ComputeFstat(object):
    """ Base class providing interface to lalpulsar.ComputeFstat """

    earth_ephem_default = earth_ephem
    sun_ephem_default = sun_ephem

    def __init__(self, tref, sftfilepath=None,
                 minStartTime=None, maxStartTime=None,
Gregory Ashton's avatar
Gregory Ashton committed
                 minCoverFreq=None, maxCoverFreq=None,
                 detector=None, earth_ephem=None, sun_ephem=None,
                 binary=False, transient=True, BSGL=False):
        tref: int
            GPS seconds of the reference time.
        sftfilepath: str
            File patern to match SFTs
        minCoverFreq, maxCoverFreq: float
            The min and max cover frequency passed to CreateFstatInput, if
            either is None the range of frequencies in the SFT less 1Hz is
        detector: str
            Two character reference to the data to use, specify None for no
        earth_ephem, sun_ephem: str
            Paths of the two files containing positions of Earth and Sun,
            respectively at evenly spaced times, as passed to CreateFstatInput.
            If None defaults defined in BaseSearchClass will be used.
        binary: bool
            If true, search of binary parameters.
        transient: bool
            If true, allow for the Fstat to be computed over a transient range.
        BSGL: bool
            If true, compute the BSGL rather than the twoF value.

Gregory Ashton's avatar
Gregory Ashton committed

        if earth_ephem is None:
            self.earth_ephem = self.earth_ephem_default
        if sun_ephem is None:
            self.sun_ephem = self.sun_ephem_default


    def init_computefstatistic_single_point(self):
        """ Initilisation step of run_computefstatistic for a single point """'Initialising SFTCatalog')
        constraints = lalpulsar.SFTConstraints()
        if self.detector:
            constraints.detector = self.detector
        if self.minStartTime:
            constraints.minStartTime = lal.LIGOTimeGPS(self.minStartTime)
        if self.maxStartTime:
            constraints.maxStartTime = lal.LIGOTimeGPS(self.maxStartTime)

226'Loading data matching pattern {}'.format(
        SFTCatalog = lalpulsar.SFTdataFind(self.sftfilepath, constraints)
Gregory Ashton's avatar
Gregory Ashton committed
        names = list(set([ for d in]))
        epochs = [d.header.epoch for d in]
            'Loaded {} data files from detectors {} spanning {} to {}'.format(
                len(epochs), names, int(epochs[0]), int(epochs[-1])))
Gregory Ashton's avatar
Gregory Ashton committed
239'Initialising ephems')
        ephems = lalpulsar.InitBarycenter(self.earth_ephem, self.sun_ephem)'Initialising FstatInput')
        dFreq = 0
        if self.transient:
            self.whatToCompute = lalpulsar.FSTATQ_ATOMS_PER_DET
            self.whatToCompute = lalpulsar.FSTATQ_2F

Gregory Ashton's avatar
Gregory Ashton committed
        FstatOptionalArgs = lalpulsar.FstatOptionalArgsDefaults

        if self.minCoverFreq is None or self.maxCoverFreq is None:
            fA =[0].header.f0
            numBins =[0].numBins
            fB = fA + (numBins-1)*[0].header.deltaF
            self.minCoverFreq = fA + 0.5
            self.maxCoverFreq = fB - 0.5
  'Min/max cover freqs not provided, using '
                         '{} and {}, est. from SFTs'.format(
                             self.minCoverFreq, self.maxCoverFreq))
Gregory Ashton's avatar
Gregory Ashton committed

        self.FstatInput = lalpulsar.CreateFstatInput(SFTCatalog,
                                                     )'Initialising PulsarDoplerParams')
        PulsarDopplerParams = lalpulsar.PulsarDopplerParams()
        PulsarDopplerParams.refTime = self.tref
        PulsarDopplerParams.Alpha = 1
        PulsarDopplerParams.Delta = 1
        PulsarDopplerParams.fkdot = np.array([0, 0, 0, 0, 0, 0, 0])
        self.PulsarDopplerParams = PulsarDopplerParams'Initialising FstatResults')
        self.FstatResults = lalpulsar.FstatResults()

        if self.BSGL:
  'Initialising BSGL: this will fail if numDet < 2')
            # Tuning parameters - to be reviewed
            numDetectors = 2
Gregory Ashton's avatar
Gregory Ashton committed
            Fstar0sc = 15.
            oLGX = np.zeros(10)
Gregory Ashton's avatar
Gregory Ashton committed
            oLGX[:numDetectors] = 1./numDetectors
            self.BSGLSetup = lalpulsar.CreateBSGLSetup(numDetectors,
            self.twoFX = np.zeros(10)
Gregory Ashton's avatar
Gregory Ashton committed
            self.whatToCompute = (self.whatToCompute +

        if self.transient:
  'Initialising transient parameters')
            self.windowRange = lalpulsar.transientWindowRange_t()
            self.windowRange.type = lalpulsar.TRANSIENT_RECTANGULAR
            self.windowRange.t0Band = 0
            self.windowRange.dt0 = 1
            self.windowRange.tauBand = 0
            self.windowRange.dtau = 1

Gregory Ashton's avatar
Gregory Ashton committed
    def run_computefstatistic_single_point(self, tstart, tend, F0, F1,
                                           F2, Alpha, Delta, asini=None,
                                           period=None, ecc=None, tp=None,
        """ Returns the twoF fully-coherently at a single point """
Gregory Ashton's avatar
Gregory Ashton committed

        self.PulsarDopplerParams.fkdot = np.array([F0, F1, F2, 0, 0, 0, 0])
        self.PulsarDopplerParams.Alpha = Alpha
        self.PulsarDopplerParams.Delta = Delta
        if self.binary:
            self.PulsarDopplerParams.asini = asini
            self.PulsarDopplerParams.period = period
            self.PulsarDopplerParams.ecc = ecc
   = tp
            self.PulsarDopplerParams.argp = argp
Gregory Ashton's avatar
Gregory Ashton committed

Gregory Ashton's avatar
Gregory Ashton committed

        if self.transient is False:
            if self.BSGL is False:
                return self.FstatResults.twoF[0]

            twoF = np.float(self.FstatResults.twoF[0])
            self.twoFX[0] = self.FstatResults.twoFPerDet(0)
            self.twoFX[1] = self.FstatResults.twoFPerDet(1)
            BSGL = lalpulsar.ComputeBSGL(twoF, self.twoFX,
            return BSGL

        self.windowRange.t0 = int(tstart)  # TYPE UINT4
        self.windowRange.tau = int(tend - tstart)  # TYPE UINT4

Gregory Ashton's avatar
Gregory Ashton committed
        FS = lalpulsar.ComputeTransientFstatMap(
            self.FstatResults.multiFatoms[0], self.windowRange, False)

        if self.BSGL is False:
            return 2*[0][0]

        FstatResults_single = copy.copy(self.FstatResults)
        FstatResults_single.lenth = 1 = self.FstatResults.multiFatoms[0].data[0]
        FS0 = lalpulsar.ComputeTransientFstatMap(
            FstatResults_single.multiFatoms[0], self.windowRange, False) = self.FstatResults.multiFatoms[0].data[1]
        FS1 = lalpulsar.ComputeTransientFstatMap(
            FstatResults_single.multiFatoms[0], self.windowRange, False)

        self.twoFX[0] = 2*[0][0]
        self.twoFX[1] = 2*[0][0]
        BSGL = lalpulsar.ComputeBSGL(2*[0][0], self.twoFX,

        return BSGL
Gregory Ashton's avatar
Gregory Ashton committed

class SemiCoherentGlitchSearch(BaseSearchClass, ComputeFstat):
    """ A semi-coherent glitch search

    This implements a basic `semi-coherent glitch F-stat in which the data
    is divided into two segments either side of the proposed glitch and the
    fully-coherent F-stat in each segment is averaged to give the semi-coherent

Gregory Ashton's avatar
Gregory Ashton committed
    def __init__(self, label, outdir, tref, tstart, tend, nglitch=0,
                 sftfilepath=None, theta0_idx=0, BSGL=False,
                 minCoverFreq=None, maxCoverFreq=None, minStartTime=None,
                 maxStartTime=None, detector=None, earth_ephem=None,
        label, outdir: str
            A label and directory to read/write data from/to.
        tref, tstart, tend: int
            GPS seconds of the reference time, and start and end of the data.
        nglitch: int
            The (fixed) number of glitches; this can zero, but occasionally
            this causes issue (in which case just use ComputeFstat).
        sftfilepath: str
            File patern to match SFTs
        theta0_idx, int
            Index (zero-based) of which segment the theta refers to - uyseful
            if providing a tight prior on theta to allow the signal to jump
            too theta (and not just from)
        minCoverFreq, maxCoverFreq: float
            The min and max cover frequency passed to CreateFstatInput, if
            either is None the range of frequencies in the SFT less 1Hz is
        detector: str
            Two character reference to the data to use, specify None for no
        earth_ephem, sun_ephem: str
            Paths of the two files containing positions of Earth and Sun,
            respectively at evenly spaced times, as passed to CreateFstatInput.
            If None defaults defined in BaseSearchClass will be used.

        self.fs_file_name = "{}/{}_FS.dat".format(self.outdir, self.label)
        if self.earth_ephem is None:
            self.earth_ephem = self.earth_ephem_default
        if self.sun_ephem is None:
            self.sun_ephem = self.sun_ephem_default
        self.transient = True
        self.binary = False

    def compute_nglitch_fstat(self, F0, F1, F2, Alpha, Delta, *args):
        """ Returns the semi-coherent glitch summed twoF """

        args = list(args)
        tboundaries = [self.tstart] + args[-self.nglitch:] + [self.tend]
        delta_F0s = args[-3*self.nglitch:-2*self.nglitch]
        delta_F1s = args[-2*self.nglitch:-self.nglitch]
        delta_F2 = np.zeros(len(delta_F0s))
        delta_phi = np.zeros(len(delta_F0s))
        theta = [0, F0, F1, F2]
        delta_thetas = np.atleast_2d(
                np.array([delta_phi, delta_F0s, delta_F1s, delta_F2]).T)

        thetas = self.calculate_thetas(theta, delta_thetas, tboundaries,

        twoFSum = 0
        for i, theta_i_at_tref in enumerate(thetas):
            ts, te = tboundaries[i], tboundaries[i+1]

            twoFVal = self.run_computefstatistic_single_point(
                ts, te, theta_i_at_tref[1], theta_i_at_tref[2],
                theta_i_at_tref[3], Alpha, Delta)
            twoFSum += twoFVal

        if np.isfinite(twoFSum):
            return twoFSum
            return -np.inf

    def compute_glitch_fstat_single(self, F0, F1, F2, Alpha, Delta, delta_F0,
                                    delta_F1, tglitch):
        """ Returns the semi-coherent glitch summed twoF for nglitch=1

        Note: used for testing

        theta = [F0, F1, F2]
        delta_theta = [delta_F0, delta_F1, 0]
        tref = self.tref

        theta_at_glitch = self.shift_coefficients(theta, tglitch - tref)
        theta_post_glitch_at_glitch = theta_at_glitch + delta_theta
        theta_post_glitch = self.shift_coefficients(
            theta_post_glitch_at_glitch, tref - tglitch)

        twoFsegA = self.run_computefstatistic_single_point(
Gregory Ashton's avatar
Gregory Ashton committed
            self.tstart, tglitch, theta[0], theta[1], theta[2], Alpha,

        if tglitch == self.tend:
            return twoFsegA

        twoFsegB = self.run_computefstatistic_single_point(
Gregory Ashton's avatar
Gregory Ashton committed
            tglitch, self.tend, theta_post_glitch[0],
            theta_post_glitch[1], theta_post_glitch[2], Alpha,

        return twoFsegA + twoFsegB

Gregory Ashton's avatar
Gregory Ashton committed
class MCMCSearch(BaseSearchClass):
    """ MCMC search using ComputeFstat"""
    def __init__(self, label, outdir, sftfilepath, theta_prior, tref,
                 tstart, tend, nsteps=[100, 100, 100], nwalkers=100, ntemps=1,
                 log10temperature_min=-5, theta_initial=None, scatter_val=1e-4,
                 binary=False, BSGL=False, minCoverFreq=None,
                 maxCoverFreq=None, detector=None, earth_ephem=None,
                 sun_ephem=None, theta0_idx=0):
        label, outdir: str
            A label and directory to read/write data from/to
        sftfilepath: str
            File patern to match SFTs
        theta_prior: dict
            Dictionary of priors and fixed values for the search parameters.
            For each parameters (key of the dict), if it is to be held fixed
            the value should be the constant float, if it is be searched, the
            value should be a dictionary of the prior.
        theta_initial: dict, array, (None)
            Either a dictionary of distribution about which to distribute the
            initial walkers about, an array (from which the walkers will be
            scattered by scatter_val, or  None in which case the prior is used.
        tref, tstart, tend: int
            GPS seconds of the reference time, start time and end time
        nsteps: list (m,)
            List specifying the number of steps to take, the last two entries
            give the nburn and nprod of the 'production' run, all entries
            before are for iterative initialisation steps (usually just one)
            e.g. [1000, 1000, 500].
        nwalkers, ntemps: int,
            The number of walkers and temperates to use in the parallel
            tempered PTSampler.
        log10temperature_min float < 0
            The  log_10(tmin) value, the set of betas passed to PTSampler are
            generated from np.logspace(0, log10temperature_min, ntemps).
        binary: Bool
            If true, search over binary parameters
        detector: str
            Two character reference to the data to use, specify None for no
        minCoverFreq, maxCoverFreq: float
            Minimum and maximum instantaneous frequency which will be covered
            over the SFT time span as passed to CreateFstatInput
        earth_ephem, sun_ephem: str
            Paths of the two files containing positions of Earth and Sun,
            respectively at evenly spaced times, as passed to CreateFstatInput
            If None defaults defined in BaseSearchClass will be used


        self.minStartTime = tstart
        self.maxStartTime = tend

Gregory Ashton's avatar
Gregory Ashton committed
        if os.path.isdir(outdir) is False:
Gregory Ashton's avatar
Gregory Ashton committed
            'Set-up MCMC search for model {} on data {}'.format(
                self.label, self.sftfilepath))
        self.pickle_path = '{}/{}_saved_data.p'.format(self.outdir, self.label)
Gregory Ashton's avatar
Gregory Ashton committed
        self.theta_prior['tstart'] = self.tstart
        self.theta_prior['tend'] = self.tend
        self.ndim = len(self.theta_keys)
        if self.log10temperature_min:
            self.betas = np.logspace(0, self.log10temperature_min, self.ntemps)
            self.betas = None

        if earth_ephem is None:
            self.earth_ephem = self.earth_ephem_default
        if sun_ephem is None:
            self.sun_ephem = self.sun_ephem_default

        if args.clean and os.path.isfile(self.pickle_path):
            os.rename(self.pickle_path, self.pickle_path+".old")

        self.old_data_is_okay_to_use = self.check_old_data_is_okay_to_use()

    def log_input(self):
558'theta_prior = {}'.format(self.theta_prior))
563'scatter_val = {}'.format(self.scatter_val))'nsteps = {}'.format(self.nsteps))'ntemps = {}'.format(self.ntemps))'log10temperature_min = {}'.format(

    def inititate_search_object(self):'Setting up search object')
Gregory Ashton's avatar
Gregory Ashton committed
568 = ComputeFstat(
            tref=self.tref, sftfilepath=self.sftfilepath,
            minCoverFreq=self.minCoverFreq, maxCoverFreq=self.maxCoverFreq,
            earth_ephem=self.earth_ephem, sun_ephem=self.sun_ephem,
            detector=self.detector, BSGL=self.BSGL, transient=False,
            minStartTime=self.minStartTime, maxStartTime=self.maxStartTime)

    def logp(self, theta_vals, theta_prior, theta_keys, search):
Gregory Ashton's avatar
Gregory Ashton committed
        H = [self.generic_lnprior(**theta_prior[key])(p) for p, key in
             zip(theta_vals, theta_keys)]
        return np.sum(H)

    def logl(self, theta, search):
        for j, theta_i in enumerate(self.theta_idxs):
            self.fixed_theta[theta_i] = theta[j]
Gregory Ashton's avatar
Gregory Ashton committed
        FS = search.run_computefstatistic_single_point(*self.fixed_theta)
        return FS

    def unpack_input_theta(self):
Gregory Ashton's avatar
Gregory Ashton committed
        full_theta_keys = ['tstart', 'tend', 'F0', 'F1', 'F2', 'Alpha',
        if self.binary:
            full_theta_keys += [
                'asini', 'period', 'ecc', 'tp', 'argp']
        full_theta_keys_copy = copy.copy(full_theta_keys)

Gregory Ashton's avatar
Gregory Ashton committed
        full_theta_symbols = ['_', '_', '$f$', '$\dot{f}$', '$\ddot{f}$',
                              r'$\alpha$', r'$\delta$']
        if self.binary:
            full_theta_symbols += [
                'asini', 'period', 'period', 'ecc', 'tp', 'argp']

        self.theta_keys = []
        fixed_theta_dict = {}
        for key, val in self.theta_prior.iteritems():
            if type(val) is dict:
                fixed_theta_dict[key] = 0
Gregory Ashton's avatar
Gregory Ashton committed
            elif type(val) in [float, int, np.float64]:
                fixed_theta_dict[key] = val
                raise ValueError(
                    'Type {} of {} in theta not recognised'.format(
                        type(val), key))
Gregory Ashton's avatar
Gregory Ashton committed

        if len(full_theta_keys_copy) > 0:
            raise ValueError(('Input dictionary `theta` is missing the'
                              'following keys: {}').format(

        self.fixed_theta = [fixed_theta_dict[key] for key in full_theta_keys]
        self.theta_idxs = [full_theta_keys.index(k) for k in self.theta_keys]
        self.theta_symbols = [full_theta_symbols[i] for i in self.theta_idxs]

        idxs = np.argsort(self.theta_idxs)
        self.theta_idxs = [self.theta_idxs[i] for i in idxs]
        self.theta_symbols = [self.theta_symbols[i] for i in idxs]
        self.theta_keys = [self.theta_keys[i] for i in idxs]

    def check_initial_points(self, p0):
        for nt in range(self.ntemps):
  'Checking temperature {} chains'.format(nt))
            initial_priors = np.array([
                self.logp(p, self.theta_prior, self.theta_keys,
                for p in p0[nt]])
            number_of_initial_out_of_bounds = sum(initial_priors == -np.inf)

            if number_of_initial_out_of_bounds > 0:
                    'Of {} initial values, {} are -np.inf due to the prior'

                p0 = self.generate_new_p0_to_fix_initial_points(
                    p0, nt, initial_priors)

    def generate_new_p0_to_fix_initial_points(self, p0, nt, initial_priors):'Attempting to correct intial values')
        idxs = np.arange(self.nwalkers)[initial_priors == -np.inf]
        count = 0
        while sum(initial_priors == -np.inf) > 0 and count < 100:
            for j in idxs:
                p0[nt][j] = (p0[nt][np.random.randint(0, self.nwalkers)]*(
                             1+np.random.normal(0, 1e-10, self.ndim)))
            initial_priors = np.array([
                self.logp(p, self.theta_prior, self.theta_keys,
                for p in p0[nt]])
            count += 1

        if sum(initial_priors == -np.inf) > 0:
  'Failed to fix initial priors')
  'Suceeded to fix initial priors')

        return p0

Gregory Ashton's avatar
Gregory Ashton committed
    def run_sampler_with_progress_bar(self, sampler, ns, p0):
            from tqdm import tqdm
            for result in tqdm(sampler.sample(p0, iterations=ns), total=ns):
        except ImportError:
            sampler.run_mcmc(p0, ns)
        return sampler

    def run(self, proposal_scale_factor=2):

        if self.old_data_is_okay_to_use is True:
            logging.warning('Using saved data from {}'.format(
            d = self.get_saved_data()
            self.sampler = d['sampler']
            self.samples = d['samples']
            self.lnprobs = d['lnprobs']
            self.lnlikes = d['lnlikes']


        sampler = emcee.PTSampler(
            self.ntemps, self.nwalkers, self.ndim, self.logl, self.logp,
            logpargs=(self.theta_prior, self.theta_keys,,
            loglargs=(,), betas=self.betas, a=proposal_scale_factor)

Gregory Ashton's avatar
Gregory Ashton committed
        p0 = self.generate_initial_p0()
        p0 = self.apply_corrections_to_p0(p0)

        ninit_steps = len(self.nsteps) - 2
        for j, n in enumerate(self.nsteps[:-2]):
  'Running {}/{} initialisation with {} steps'.format(
                j+1, ninit_steps, n))
Gregory Ashton's avatar
Gregory Ashton committed
            sampler = self.run_sampler_with_progress_bar(sampler, n, p0)
  "Mean acceptance fraction: {}"
                         .format(np.mean(sampler.acceptance_fraction, axis=1)))
            if self.ntemps > 1:
      "Tswap acceptance fraction: {}"
Gregory Ashton's avatar
Gregory Ashton committed
            fig, axes = self.plot_walkers(sampler, symbols=self.theta_symbols)
                self.outdir, self.label, j))

            p0 = self.get_new_p0(sampler)
Gregory Ashton's avatar
Gregory Ashton committed
            p0 = self.apply_corrections_to_p0(p0)

Gregory Ashton's avatar
Gregory Ashton committed
        if len(self.nsteps) > 1:
            nburn = self.nsteps[-2]
            nburn = 0
        nprod = self.nsteps[-1]'Running final burn and prod with {} steps'.format(
Gregory Ashton's avatar
Gregory Ashton committed
        sampler = self.run_sampler_with_progress_bar(sampler, nburn+nprod, p0)
726"Mean acceptance fraction: {}"
                     .format(np.mean(sampler.acceptance_fraction, axis=1)))
        if self.ntemps > 1:
  "Tswap acceptance fraction: {}"

Gregory Ashton's avatar
Gregory Ashton committed
        fig, axes = self.plot_walkers(sampler, symbols=self.theta_symbols,
        fig.savefig('{}/{}_walkers.png'.format(self.outdir, self.label))

        samples = sampler.chain[0, :, nburn:, :].reshape((-1, self.ndim))
        lnprobs = sampler.lnprobability[0, :, nburn:].reshape((-1))
        lnlikes = sampler.lnlikelihood[0, :, nburn:].reshape((-1))
        self.sampler = sampler
        self.samples = samples
        self.lnprobs = lnprobs
        self.lnlikes = lnlikes
        self.save_data(sampler, samples, lnprobs, lnlikes)

    def plot_corner(self, figsize=(7, 7),  tglitch_ratio=False,
                    add_prior=False, nstds=None, label_offset=0.4,
                    dpi=300, rc_context={}, **kwargs):

        with plt.rc_context(rc_context):
            fig, axes = plt.subplots(self.ndim, self.ndim,

            samples_plt = copy.copy(self.samples)
            theta_symbols_plt = copy.copy(self.theta_symbols)
            theta_symbols_plt = [s.replace('_{glitch}', r'_\textrm{glitch}')
                                 for s in theta_symbols_plt]

            if tglitch_ratio:
                for j, k in enumerate(self.theta_keys):
                    if k == 'tglitch':
                        s = samples_plt[:, j]
                        samples_plt[:, j] = (s - self.tstart)/(
                                             self.tend - self.tstart)
                        theta_symbols_plt[j] = r'$R_{\textrm{glitch}}$'

            if type(nstds) is int and 'range' not in kwargs:
                _range = []
                for j, s in enumerate(samples_plt.T):
                    median = np.median(s)
                    std = np.std(s)
                    _range.append((median - nstds*std, median + nstds*std))
                _range = None

            fig_triangle = corner.corner(samples_plt,
                                         label_kwargs={'fontsize': 8},
                                         data_kwargs={'alpha': 0.1,
                                                      'ms': 0.5},

            axes_list = fig_triangle.get_axes()
            axes = np.array(axes_list).reshape(self.ndim, self.ndim)
            for ax in axes[:, 0]:
                ax.yaxis.set_label_coords(-label_offset, 0.5)
            for ax in axes[-1, :]:
                ax.xaxis.set_label_coords(0.5, -label_offset)
            for ax in axes_list:
            plt.tight_layout(h_pad=0.0, w_pad=0.0)
            fig.subplots_adjust(hspace=0.05, wspace=0.05)

            if add_prior:
                self.add_prior_to_corner(axes, samples_plt)

                self.outdir, self.label), dpi=dpi)

    def add_prior_to_corner(self, axes, samples):
        for i, key in enumerate(self.theta_keys):
            ax = axes[i][i]
            xlim = ax.get_xlim()
            s = samples[:, i]
Gregory Ashton's avatar
Gregory Ashton committed
            prior = self.generic_lnprior(**self.theta_prior[key])
            x = np.linspace(s.min(), s.max(), 100)
            ax2 = ax.twinx()
            ax2.plot(x, [prior(xi) for xi in x], '-r')

Gregory Ashton's avatar
Gregory Ashton committed
    def generic_lnprior(self, **kwargs):
        """ Return a lambda function of the pdf

        kwargs: dict
            A dictionary containing 'type' of pdf and shape parameters


        def logunif(x, a, b):
            above = x < b
            below = x > a
            if type(above) is not np.ndarray:
                if above and below:
                    return -np.log(b-a)
                    return -np.inf
                idxs = np.array([all(tup) for tup in zip(above, below)])
                p = np.zeros(len(x)) - np.inf
                p[idxs] = -np.log(b-a)
                return p

        def halfnorm(x, loc, scale):
            if x < 0:
                return -np.inf
                return -0.5*((x-loc)**2/scale**2+np.log(0.5*np.pi*scale**2))

        def cauchy(x, x0, gamma):
            return 1.0/(np.pi*gamma*(1+((x-x0)/gamma)**2))

        def exp(x, x0, gamma):
            if x > x0:
                return np.log(gamma) - gamma*(x - x0)
                return -np.inf

        if kwargs['type'] == 'unif':
            return lambda x: logunif(x, kwargs['lower'], kwargs['upper'])
        elif kwargs['type'] == 'halfnorm':
            return lambda x: halfnorm(x, kwargs['loc'], kwargs['scale'])
        elif kwargs['type'] == 'neghalfnorm':
            return lambda x: halfnorm(-x, kwargs['loc'], kwargs['scale'])
        elif kwargs['type'] == 'norm':
            return lambda x: -0.5*((x - kwargs['loc'])**2/kwargs['scale']**2
                                   + np.log(2*np.pi*kwargs['scale']**2))
  "kwargs:", kwargs)
            raise ValueError("Print unrecognise distribution")

Gregory Ashton's avatar
Gregory Ashton committed
    def generate_rv(self, **kwargs):
        dist_type = kwargs.pop('type')
        if dist_type == "unif":
            return np.random.uniform(low=kwargs['lower'], high=kwargs['upper'])
        if dist_type == "norm":
            return np.random.normal(loc=kwargs['loc'], scale=kwargs['scale'])
        if dist_type == "halfnorm":
            return np.abs(np.random.normal(loc=kwargs['loc'],
        if dist_type == "neghalfnorm":
            return -1 * np.abs(np.random.normal(loc=kwargs['loc'],
        if dist_type == "lognorm":
            return np.random.lognormal(
                mean=kwargs['loc'], sigma=kwargs['scale'])
            raise ValueError("dist_type {} unknown".format(dist_type))

Gregory Ashton's avatar
Gregory Ashton committed
    def plot_walkers(self, sampler, symbols=None, alpha=0.4, color="k", temp=0,
Gregory Ashton's avatar
Gregory Ashton committed
        """ Plot all the chains from a sampler """

        shape = sampler.chain.shape
        if len(shape) == 3:
            nwalkers, nsteps, ndim = shape
            chain = sampler.chain[:, :, :]
        if len(shape) == 4:
            ntemps, nwalkers, nsteps, ndim = shape
            if temp < ntemps:
      "Plotting temperature {} chains".format(temp))
                raise ValueError(("Requested temperature {} outside of"
                                  "available range").format(temp))
            chain = sampler.chain[temp, :, :, :]

Gregory Ashton's avatar
Gregory Ashton committed
            fig = plt.figure(figsize=(8, 4*ndim))
            ax = fig.add_subplot(ndim+1, 1, 1)
            axes = [ax] + [fig.add_subplot(ndim+1, 1, i, sharex=ax)
                           for i in range(2, ndim+1)]

Gregory Ashton's avatar
Gregory Ashton committed
            idxs = np.arange(chain.shape[1])
            if ndim > 1:
                for i in range(ndim):
                    axes[i].ticklabel_format(useOffset=False, axis='y')
Gregory Ashton's avatar
Gregory Ashton committed
                    cs = chain[:, :, i].T
                    if burnin_idx:
                        axes[i].plot(idxs[:burnin_idx], cs[:burnin_idx],
                                     color="r", alpha=alpha)
                    axes[i].plot(idxs[burnin_idx:], cs[burnin_idx:], color="k",
                    if symbols:
Gregory Ashton's avatar
Gregory Ashton committed
                cs = chain[:, :, temp].T
                axes.plot(cs, color='k', alpha=alpha)
                axes.ticklabel_format(useOffset=False, axis='y')

Gregory Ashton's avatar
Gregory Ashton committed
        axes.append(fig.add_subplot(ndim+1, 1, ndim+1))
        lnl = sampler.lnlikelihood[temp, :, :]
        if burnin_idx:
            axes[-1].hist(lnl[:, :burnin_idx].flatten(), bins=50, histtype='step',
        axes[-1].hist(lnl[:, burnin_idx:].flatten(), bins=50, histtype='step',

        return fig, axes

Gregory Ashton's avatar
Gregory Ashton committed
    def apply_corrections_to_p0(self, p0):
        """ Apply any correction to the initial p0 values """
        return p0

    def generate_scattered_p0(self, p):
        """ Generate a set of p0s scattered about p """
Gregory Ashton's avatar
Gregory Ashton committed
        p0 = [[p + self.scatter_val * p * np.random.randn(self.ndim)
               for i in xrange(self.nwalkers)]
              for j in xrange(self.ntemps)]
        return p0

Gregory Ashton's avatar
Gregory Ashton committed
    def generate_initial_p0(self):
        """ Generate a set of init vals for the walkers """

        if type(self.theta_initial) == dict:
  'Generate initial values from initial dictionary')
            if self.nglitch > 1:
                raise ValueError('Initial dict not implemented for nglitch>1')
Gregory Ashton's avatar
Gregory Ashton committed
            p0 = [[[self.generate_rv(**self.theta_initial[key])
                    for key in self.theta_keys]
                   for i in range(self.nwalkers)]
                  for j in range(self.ntemps)]
        elif type(self.theta_initial) == list:
  'Generate initial values from list of theta_initial')
            p0 = [[[self.generate_rv(**val)
                    for val in self.theta_initial]
                   for i in range(self.nwalkers)]
                  for j in range(self.ntemps)]
        elif self.theta_initial is None:
  'Generate initial values from prior dictionary')
Gregory Ashton's avatar
Gregory Ashton committed
            p0 = [[[self.generate_rv(**self.theta_prior[key])
                    for key in self.theta_keys]
                   for i in range(self.nwalkers)]
                  for j in range(self.ntemps)]
        elif len(self.theta_initial) == self.ndim:
Gregory Ashton's avatar
Gregory Ashton committed
            p0 = self.generate_scattered_p0(self.theta_initial)
            raise ValueError('theta_initial not understood')

        return p0

    def get_new_p0(self, sampler):
        """ Returns new initial positions for walkers are burn0 stage

        This returns new positions for all walkers by scattering points about
        the maximum posterior with scale `scatter_val`.

Gregory Ashton's avatar
Gregory Ashton committed
        temp_idx = 0
        pF = sampler.chain[temp_idx, :, :, :]
        lnl = sampler.lnlikelihood[temp_idx, :, :]
        lnp = sampler.lnprobability[temp_idx, :, :]

        # General warnings about the state of lnp
Gregory Ashton's avatar
Gregory Ashton committed
        if np.any(np.isnan(lnp)):
                "Of {} lnprobs {} are nan".format(
Gregory Ashton's avatar
Gregory Ashton committed
                    np.shape(lnp), np.sum(np.isnan(lnp))))
        if np.any(np.isposinf(lnp)):
                "Of {} lnprobs {} are +np.inf".format(
Gregory Ashton's avatar
Gregory Ashton committed
                    np.shape(lnp), np.sum(np.isposinf(lnp))))
        if np.any(np.isneginf(lnp)):
                "Of {} lnprobs {} are -np.inf".format(
Gregory Ashton's avatar
Gregory Ashton committed
                    np.shape(lnp), np.sum(np.isneginf(lnp))))

        lnp_finite = copy.copy(lnp)
        lnp_finite[np.isinf(lnp)] = np.nan
Gregory Ashton's avatar
Gregory Ashton committed
        idx = np.unravel_index(np.nanargmax(lnp_finite), lnp_finite.shape)'Gen. new p0 from max lnp (walker {}, pos {})'
                      ' which had twoF={} ')
                     .format(idx[0], idx[1], lnl[idx]))
        p = pF[idx]
        p0 = self.generate_scattered_p0(p)

        return p0

    def get_save_data_dictionary(self):
        d = dict(nsteps=self.nsteps, nwalkers=self.nwalkers,
                 ntemps=self.ntemps, theta_keys=self.theta_keys,
Gregory Ashton's avatar
Gregory Ashton committed
                 theta_prior=self.theta_prior, scatter_val=self.scatter_val,
        return d

    def save_data(self, sampler, samples, lnprobs, lnlikes):
        d = self.get_save_data_dictionary()
        d['sampler'] = sampler
        d['samples'] = samples
        d['lnprobs'] = lnprobs
        d['lnlikes'] = lnlikes

        if os.path.isfile(self.pickle_path):
  'Saving backup of {} as {}.old'.format(
                self.pickle_path, self.pickle_path))
            os.rename(self.pickle_path, self.pickle_path+".old")
        with open(self.pickle_path, "wb") as File:
            pickle.dump(d, File)

    def get_list_of_matching_sfts(self):
        matches = glob.glob(self.sftfilepath)
        if len(matches) > 0:
            return matches
            raise IOError('No sfts found matching {}'.format(

    def get_saved_data(self):
        with open(self.pickle_path, "r") as File:
            d = pickle.load(File)
        return d

    def check_old_data_is_okay_to_use(self):
        if args.use_old_data:
  "Forcing use of old data")
            return True

        if os.path.isfile(self.pickle_path) is False:
  'No pickled data found')
            return False

        oldest_sft = min([os.path.getmtime(f) for f in
        if os.path.getmtime(self.pickle_path) < oldest_sft:
  'Pickled data outdates sft files')
            return False

        old_d = self.get_saved_data().copy()
        new_d = self.get_save_data_dictionary().copy()


        mod_keys = []
        for key in new_d.keys():
            if key in old_d:
                if new_d[key] != old_d[key]:
                    mod_keys.append((key, old_d[key], new_d[key]))
                raise ValueError('Keys {} not in old dictionary'.format(key))

        if len(mod_keys) == 0:
            return True
            logging.warning("Saved data differs from requested")
  "Differences found in following keys:")
            for key in mod_keys:
                if len(key) == 3:
                    if np.isscalar(key[1]) or key[0] == 'nsteps':
              "    {} : {} -> {}".format(*key))
              "    " + key[0])
            return False

    def get_max_twoF(self, threshold=0.05):
        """ Returns the max 2F sample and the corresponding 2F value

        Note: the sample is returned as a dictionary along with an estimate of
        the standard deviation calculated from the std of all samples with a
        twoF within `threshold` (relative) to the max twoF

        if any(np.isposinf(self.lnlikes)):
  'twoF values contain positive infinite values')
        if any(np.isneginf(self.lnlikes)):
  'twoF values contain negative infinite values')
        if any(np.isnan(self.lnlikes)):
  'twoF values contain nan')
        idxs = np.isfinite(self.lnlikes)
        jmax = np.nanargmax(self.lnlikes[idxs])
        maxtwoF = self.lnlikes[jmax]
        d = OrderedDict()

Gregory Ashton's avatar
Gregory Ashton committed
        repeats = []
        for i, k in enumerate(self.theta_keys):
Gregory Ashton's avatar
Gregory Ashton committed
            if k in d and k not in repeats:
                d[k+'_0'] = d[k]  # relabel the old key
            if k in repeats:
                k = k + '_0'
                count = 1
                while k in d:
                    k = k.replace('_{}'.format(count-1), '_{}'.format(count))
                    count += 1
            d[k] = self.samples[jmax][i]
        return d, maxtwoF

    def get_median_stds(self):
        """ Returns a dict of the median and std of all production samples """
        d = OrderedDict()
Gregory Ashton's avatar
Gregory Ashton committed
        repeats = []
        for s, k in zip(self.samples.T, self.theta_keys):
Gregory Ashton's avatar
Gregory Ashton committed
            if k in d and k not in repeats:
                d[k+'_0'] = d[k]  # relabel the old key
                d[k+'_0_std'] = d[k+'_std']
            if k in repeats:
                k = k + '_0'
                count = 1
                while k in d:
                    k = k.replace('_{}'.format(count-1), '_{}'.format(count))
                    count += 1

            d[k] = np.median(s)
            d[k+'_std'] = np.std(s)
        return d

    def write_par(self, method='med'):
        """ Writes a .par of the best-fit params with an estimated std """'Writing {}/{}.par using the {} method'.format(
            self.outdir, self.label, method))

        median_std_d = self.get_median_stds()
        max_twoF_d, max_twoF = self.get_max_twoF()

Gregory Ashton's avatar
Gregory Ashton committed
1162'Writing par file with max twoF = {}'.format(max_twoF))
        filename = '{}/{}.par'.format(self.outdir, self.label)
        with open(filename, 'w+') as f:
            f.write('MaxtwoF = {}\n'.format(max_twoF))
            f.write('theta0_index = {}\n'.format(self.theta0_idx))
            if method == 'med':
                for key, val in median_std_d.iteritems():
                    f.write('{} = {:1.16e}\n'.format(key, val))
            if method == 'twoFmax':
                for key, val in max_twoF_d.iteritems():
                    f.write('{} = {:1.16e}\n'.format(key, val))

    def print_summary(self):
Gregory Ashton's avatar
Gregory Ashton committed
        max_twoFd, max_twoF = self.get_max_twoF()
        median_std_d = self.get_median_stds()
Gregory Ashton's avatar
Gregory Ashton committed
        print('theta0 index: {}'.format(self.theta0_idx))
Gregory Ashton's avatar
Gregory Ashton committed
        print('Max twoF: {} with parameters:'.format(max_twoF))
        for k in np.sort(max_twoFd.keys()):
            print('  {:10s} = {:1.9e}'.format(k, max_twoFd[k]))
        print('\nMedian +/- std for production values')
        for k in np.sort(median_std_d.keys()):
            if 'std' not in k:
Gregory Ashton's avatar
Gregory Ashton committed
                print('  {:10s} = {:1.9e} +/- {:1.9e}'.format(
                    k, median_std_d[k], median_std_d[k+'_std']))

Gregory Ashton's avatar
Gregory Ashton committed
class MCMCGlitchSearch(MCMCSearch):
    """ MCMC search using the SemiCoherentGlitchSearch """
    def __init__(self, label, outdir, sftfilepath, theta_prior, tref,
                 tstart, tend, nglitch=1, nsteps=[100, 100, 100], nwalkers=100,
                 ntemps=1, log10temperature_min=-5, theta_initial=None,
                 scatter_val=1e-4, dtglitchmin=1*86400, theta0_idx=0,
                 detector=None, BSGL=False,
                 minCoverFreq=None, maxCoverFreq=None, earth_ephem=None,
Gregory Ashton's avatar
Gregory Ashton committed
        label, outdir: str
            A label and directory to read/write data from/to
_        sftfilepath: str
            File patern to match SFTs
Gregory Ashton's avatar
Gregory Ashton committed
        theta_prior: dict
            Dictionary of priors and fixed values for the search parameters.
            For each parameters (key of the dict), if it is to be held fixed
            the value should be the constant float, if it is be searched, the
            value should be a dictionary of the prior.
        theta_initial: dict, array, (None)
            Either a dictionary of distribution about which to distribute the
            initial walkers about, an array (from which the walkers will be
            scattered by scatter_val, or  None in which case the prior is used.
        scatter_val, float or ndim array
            Size of scatter to use about the initialisation step, if given as
            an array it must be of length ndim and the order is given by
Gregory Ashton's avatar
Gregory Ashton committed
        nglitch: int
            The number of glitches to allow
        tref, tstart, tend: int
            GPS seconds of the reference time, start time and end time
        nsteps: list (m,)
            List specifying the number of steps to take, the last two entries
            give the nburn and nprod of the 'production' run, all entries
            before are for iterative initialisation steps (usually just one)
            e.g. [1000, 1000, 500].
        dtglitchmin: int
            The minimum duration (in seconds) of a segment between two glitches
            or a glitch and the start/end of the data
        nwalkers, ntemps: int,
            The number of walkers and temperates to use in the parallel
            tempered PTSampler.
        log10temperature_min float < 0
            The  log_10(tmin) value, the set of betas passed to PTSampler are
            generated from np.logspace(0, log10temperature_min, ntemps).
        theta0_idx, int
            Index (zero-based) of which segment the theta refers to - uyseful
            if providing a tight prior on theta to allow the signal to jump
            too theta (and not just from)
        detector: str
            Two character reference to the data to use, specify None for no
Gregory Ashton's avatar
Gregory Ashton committed
        minCoverFreq, maxCoverFreq: float
            Minimum and maximum instantaneous frequency which will be covered
            over the SFT time span as passed to CreateFstatInput
        earth_ephem, sun_ephem: str
            Paths of the two files containing positions of Earth and Sun,
            respectively at evenly spaced times, as passed to CreateFstatInput
            If None defaults defined in BaseSearchClass will be used


Gregory Ashton's avatar
Gregory Ashton committed
        if os.path.isdir(outdir) is False:
Gregory Ashton's avatar
Gregory Ashton committed
1257'Set-up MCMC glitch search with {} glitches for model {}'
                      ' on data {}').format(self.nglitch, self.label,
        self.minStartTime = tstart
        self.maxStartTime = tend
Gregory Ashton's avatar
Gregory Ashton committed
        self.pickle_path = '{}/{}_saved_data.p'.format(self.outdir, self.label)
        self.ndim = len(self.theta_keys)
        if self.log10temperature_min:
            self.betas = np.logspace(0, self.log10temperature_min, self.ntemps)
            self.betas = None
Gregory Ashton's avatar
Gregory Ashton committed
        if earth_ephem is None:
            self.earth_ephem = self.earth_ephem_default
        if sun_ephem is None:
            self.sun_ephem = self.sun_ephem_default

        if args.clean and os.path.isfile(self.pickle_path):
            os.rename(self.pickle_path, self.pickle_path+".old")

        self.old_data_is_okay_to_use = self.check_old_data_is_okay_to_use()
Gregory Ashton's avatar
Gregory Ashton committed

    def inititate_search_object(self):'Setting up search object') = SemiCoherentGlitchSearch(
            label=self.label, outdir=self.outdir, sftfilepath=self.sftfilepath,
            tref=self.tref, tstart=self.tstart,
Gregory Ashton's avatar
Gregory Ashton committed
            tend=self.tend, minCoverFreq=self.minCoverFreq,
            maxCoverFreq=self.maxCoverFreq, earth_ephem=self.earth_ephem,
            sun_ephem=self.sun_ephem, detector=self.detector, BSGL=self.BSGL,
            nglitch=self.nglitch, theta0_idx=self.theta0_idx,
            minStartTime=self.minStartTime, maxStartTime=self.maxStartTime)
Gregory Ashton's avatar
Gregory Ashton committed

    def logp(self, theta_vals, theta_prior, theta_keys, search):
        if self.nglitch > 1:
Gregory Ashton's avatar
Gregory Ashton committed
            ts = [self.tstart] + list(theta_vals[-self.nglitch:]) + [self.tend]
Gregory Ashton's avatar
Gregory Ashton committed
            if np.array_equal(ts, np.sort(ts)) is False:
                return -np.inf
            if any(np.diff(ts) < self.dtglitchmin):
                return -np.inf