85.2 KB
Newer Older
Gregory Ashton's avatar
Gregory Ashton committed
""" Searches using MCMC-based methods """

import sys
Gregory Ashton's avatar
Gregory Ashton committed
import os
import copy
Gregory Ashton's avatar
Gregory Ashton committed
import logging
from collections import OrderedDict

import numpy as np
import matplotlib
import matplotlib.pyplot as plt
import emcee
import corner
import dill as pickle

import core
Gregory Ashton's avatar
Gregory Ashton committed
from core import tqdm, args, earth_ephem, sun_ephem
from optimal_setup_functions import get_V_estimate
Gregory Ashton's avatar
Gregory Ashton committed
from optimal_setup_functions import get_optimal_setup
import helper_functions

class MCMCSearch(core.BaseSearchClass):
Gregory Ashton's avatar
Gregory Ashton committed
    """ MCMC search using ComputeFstat"""

    symbol_dictionary = dict(
        F0='$f$', F1='$\dot{f}$', F2='$\ddot{f}$', alpha=r'$\alpha$',
    unit_dictionary = dict(
        F0='Hz', F1='Hz/s', F2='Hz/s$^2$', alpha=r'rad', delta='rad')
    rescale_dictionary = {}

Gregory Ashton's avatar
Gregory Ashton committed
Gregory Ashton's avatar
Gregory Ashton committed
    def __init__(self, label, outdir, theta_prior, tref, minStartTime,
                 maxStartTime, sftfilepath=None, nsteps=[100, 100],
                 nwalkers=100, ntemps=1, log10temperature_min=-5,
                 theta_initial=None, scatter_val=1e-10,
                 binary=False, BSGL=False, minCoverFreq=None,
                 maxCoverFreq=None, detectors=None, earth_ephem=None,
                 sun_ephem=None, injectSources=None, assumeSqrtSX=None):
        label, outdir: str
            A label and directory to read/write data from/to
        sftfilepath: str
            File patern to match SFTs
        theta_prior: dict
            Dictionary of priors and fixed values for the search parameters.
            For each parameters (key of the dict), if it is to be held fixed
            the value should be the constant float, if it is be searched, the
            value should be a dictionary of the prior.
        theta_initial: dict, array, (None)
            Either a dictionary of distribution about which to distribute the
            initial walkers about, an array (from which the walkers will be
            scattered by scatter_val, or  None in which case the prior is used.
        tref, minStartTime, maxStartTime: int
            GPS seconds of the reference time, start time and end time
        nsteps: list (m,)
            List specifying the number of steps to take, the last two entries
            give the nburn and nprod of the 'production' run, all entries
            before are for iterative initialisation steps (usually just one)
            e.g. [1000, 1000, 500].
        nwalkers, ntemps: int,
            The number of walkers and temperates to use in the parallel
            tempered PTSampler.
        log10temperature_min float < 0
            The  log_10(tmin) value, the set of betas passed to PTSampler are
            generated from np.logspace(0, log10temperature_min, ntemps).
        binary: Bool
            If true, search over binary parameters
        detectors: str
            Two character reference to the data to use, specify None for no
        minCoverFreq, maxCoverFreq: float
            Minimum and maximum instantaneous frequency which will be covered
            over the SFT time span as passed to CreateFstatInput
        earth_ephem, sun_ephem: str
            Paths of the two files containing positions of Earth and Sun,
            respectively at evenly spaced times, as passed to CreateFstatInput
            If None defaults defined in BaseSearchClass will be used


Gregory Ashton's avatar
Gregory Ashton committed
        if os.path.isdir(outdir) is False:
Gregory Ashton's avatar
Gregory Ashton committed
            'Set-up MCMC search for model {} on data {}'.format(
                self.label, self.sftfilepath))
        self.pickle_path = '{}/{}_saved_data.p'.format(self.outdir, self.label)
        self.ndim = len(self.theta_keys)
        if self.log10temperature_min:
            self.betas = np.logspace(0, self.log10temperature_min, self.ntemps)
            self.betas = None

        if earth_ephem is None:
            self.earth_ephem = self.earth_ephem_default
        if sun_ephem is None:
            self.sun_ephem = self.sun_ephem_default

        if args.clean and os.path.isfile(self.pickle_path):
            os.rename(self.pickle_path, self.pickle_path+".old")


    def log_input(self):
110'theta_prior = {}'.format(self.theta_prior))
115'scatter_val = {}'.format(self.scatter_val))'nsteps = {}'.format(self.nsteps))'ntemps = {}'.format(self.ntemps))'log10temperature_min = {}'.format(

Gregory Ashton's avatar
Gregory Ashton committed
    def initiate_search_object(self):
119'Setting up search object')
120 = core.ComputeFstat(
            tref=self.tref, sftfilepath=self.sftfilepath,
            minCoverFreq=self.minCoverFreq, maxCoverFreq=self.maxCoverFreq,
            earth_ephem=self.earth_ephem, sun_ephem=self.sun_ephem,
            detectors=self.detectors, BSGL=self.BSGL, transient=False,
            minStartTime=self.minStartTime, maxStartTime=self.maxStartTime,
            binary=self.binary, injectSources=self.injectSources,

    def logp(self, theta_vals, theta_prior, theta_keys, search):
Gregory Ashton's avatar
Gregory Ashton committed
        H = [self.generic_lnprior(**theta_prior[key])(p) for p, key in
             zip(theta_vals, theta_keys)]
        return np.sum(H)

    def logl(self, theta, search):
        for j, theta_i in enumerate(self.theta_idxs):
            self.fixed_theta[theta_i] = theta[j]
        FS = search.compute_fullycoherent_det_stat_single_point(
        return FS

    def unpack_input_theta(self):
        full_theta_keys = ['F0', 'F1', 'F2', 'Alpha', 'Delta']
        if self.binary:
            full_theta_keys += [
                'asini', 'period', 'ecc', 'tp', 'argp']
        full_theta_keys_copy = copy.copy(full_theta_keys)

        full_theta_symbols = ['$f$', '$\dot{f}$', '$\ddot{f}$', r'$\alpha$',
        if self.binary:
            full_theta_symbols += [
                'asini', 'period', 'period', 'ecc', 'tp', 'argp']

        self.theta_keys = []
        fixed_theta_dict = {}
        for key, val in self.theta_prior.iteritems():
            if type(val) is dict:
                fixed_theta_dict[key] = 0
Gregory Ashton's avatar
Gregory Ashton committed
            elif type(val) in [float, int, np.float64]:
                fixed_theta_dict[key] = val
                raise ValueError(
                    'Type {} of {} in theta not recognised'.format(
                        type(val), key))
Gregory Ashton's avatar
Gregory Ashton committed

        if len(full_theta_keys_copy) > 0:
            raise ValueError(('Input dictionary `theta` is missing the'
                              'following keys: {}').format(

        self.fixed_theta = [fixed_theta_dict[key] for key in full_theta_keys]
        self.theta_idxs = [full_theta_keys.index(k) for k in self.theta_keys]
        self.theta_symbols = [full_theta_symbols[i] for i in self.theta_idxs]

        idxs = np.argsort(self.theta_idxs)
        self.theta_idxs = [self.theta_idxs[i] for i in idxs]
        self.theta_symbols = [self.theta_symbols[i] for i in idxs]
        self.theta_keys = [self.theta_keys[i] for i in idxs]

    def check_initial_points(self, p0):
        for nt in range(self.ntemps):
  'Checking temperature {} chains'.format(nt))
            initial_priors = np.array([
                self.logp(p, self.theta_prior, self.theta_keys,
                for p in p0[nt]])
            number_of_initial_out_of_bounds = sum(initial_priors == -np.inf)

            if number_of_initial_out_of_bounds > 0:
                    'Of {} initial values, {} are -np.inf due to the prior'

                p0 = self.generate_new_p0_to_fix_initial_points(
                    p0, nt, initial_priors)

    def generate_new_p0_to_fix_initial_points(self, p0, nt, initial_priors):'Attempting to correct intial values')
        idxs = np.arange(self.nwalkers)[initial_priors == -np.inf]
        count = 0
        while sum(initial_priors == -np.inf) > 0 and count < 100:
            for j in idxs:
                p0[nt][j] = (p0[nt][np.random.randint(0, self.nwalkers)]*(
                             1+np.random.normal(0, 1e-10, self.ndim)))
            initial_priors = np.array([
                self.logp(p, self.theta_prior, self.theta_keys,
                for p in p0[nt]])
            count += 1

        if sum(initial_priors == -np.inf) > 0:
  'Failed to fix initial priors')
  'Suceeded to fix initial priors')

        return p0

    def OLD_run_sampler_with_progress_bar(self, sampler, ns, p0):
        for result in tqdm(sampler.sample(p0, iterations=ns), total=ns):
Gregory Ashton's avatar
Gregory Ashton committed
        return sampler

    def setup_convergence_testing(
            self, convergence_period=10, convergence_length=10,
            convergence_burnin_fraction=0.25, convergence_threshold_number=10,
            convergence_threshold=1.2, convergence_prod_threshold=2,
        If called, convergence testing is used during the MCMC simulation

        This uses the Gelmanr-Rubin statistic based on the ratio of between and
        within walkers variance. The original statistic was developed for
        multiple (independent) MCMC simulations, in this context we simply use
        the walkers

        convergence_period: int
            period (in number of steps) at which to test convergence
        convergence_length: int
            number of steps to use in testing convergence - this should be
            large enough to measure the variance, but if it is too long
            this will result in incorect early convergence tests
        convergence_burnin_fraction: float [0, 1]
            the fraction of the burn-in period after which to start testing
        convergence_threshold_number: int
            the number of consecutive times where the test passes after which
            to break the burn-in and go to production
        convergence_threshold: float
            the threshold to use in diagnosing convergence. Gelman & Rubin
            recomend a value of 1.2, 1.1 for strict convergence
        convergence_prod_threshold: float
            the threshold to test the production values with
        convergence_plot_upper_lim: float
            the upper limit to use in the diagnostic plot

        if convergence_length > convergence_period:
            raise ValueError('convergence_length must be < convergence_period')'Setting up convergence testing')
        self.convergence_length = convergence_length
        self.convergence_period = convergence_period
        self.convergence_burnin_fraction = convergence_burnin_fraction
        self.convergence_prod_threshold = convergence_prod_threshold
        self.convergence_diagnostic = []
        self.convergence_diagnosticx = []
        self.convergence_threshold_number = convergence_threshold_number
        self.convergence_threshold = convergence_threshold
        self.convergence_number = 0
        self.convergence_plot_upper_lim = convergence_plot_upper_lim

    def get_convergence_statistic(self, i, sampler):
        s = sampler.chain[0, :, i-self.convergence_length+1:i+1, :]
        within_std = np.mean(np.var(s, axis=1), axis=0)
        per_walker_mean = np.mean(s, axis=1)
        mean = np.mean(per_walker_mean, axis=0)
        between_std = np.sqrt(np.mean((per_walker_mean-mean)**2, axis=0))
        W = within_std
        B_over_n = between_std**2 / self.convergence_period
        Vhat = ((self.convergence_period-1.)/self.convergence_period * W
                + B_over_n + B_over_n / float(self.nwalkers))
        c = np.sqrt(Vhat/W)
        self.convergence_diagnosticx.append(i - self.convergence_length/2)
        return c

    def burnin_convergence_test(self, i, sampler, nburn):
        if i < self.convergence_burnin_fraction*nburn:
            return False
        if np.mod(i+1, self.convergence_period) != 0:
            return False
        c = self.get_convergence_statistic(i, sampler)
        if np.all(c < self.convergence_threshold):
            self.convergence_number += 1
            self.convergence_number = 0
        return self.convergence_number > self.convergence_threshold_number

    def prod_convergence_test(self, i, sampler, nburn):
        testA = i > nburn + self.convergence_length
        testB = np.mod(i+1, self.convergence_period) == 0
        if testA and testB:
            self.get_convergence_statistic(i, sampler)

    def check_production_convergence(self, k):
        bools = np.any(
            np.array(self.convergence_diagnostic)[k:, :]
            > self.convergence_prod_threshold, axis=1)
        if np.any(bools):
                '{} convergence tests in the production run of {} failed'
                .format(np.sum(bools), len(bools)))

    def run_sampler(self, sampler, p0, nprod=0, nburn=0):
        if hasattr(self, 'convergence_period'):
  'Running {} burn-in steps with convergence testing'
            iterator = tqdm(sampler.sample(p0, iterations=nburn), total=nburn)
            for i, output in enumerate(iterator):
                if self.burnin_convergence_test(i, sampler, nburn):
                        'Converged at {} before max number {} of steps reached'
                        .format(i, nburn))
                    self.convergence_idx = i
  'Running {} production steps'.format(nprod))
            j = nburn
            k = len(self.convergence_diagnostic)
            for result in tqdm(sampler.sample(output[0], iterations=nprod),
                self.prod_convergence_test(j, sampler, nburn)
                j += 1
            return sampler
            for result in tqdm(sampler.sample(p0, iterations=nburn+nprod),
            return sampler

    def run(self, proposal_scale_factor=2, create_plots=True, **kwargs):

Gregory Ashton's avatar
Gregory Ashton committed
        self.old_data_is_okay_to_use = self.check_old_data_is_okay_to_use()
        if self.old_data_is_okay_to_use is True:
            logging.warning('Using saved data from {}'.format(
            d = self.get_saved_data()
            self.sampler = d['sampler']
            self.samples = d['samples']
            self.lnprobs = d['lnprobs']
            self.lnlikes = d['lnlikes']

Gregory Ashton's avatar
Gregory Ashton committed

        sampler = emcee.PTSampler(
            self.ntemps, self.nwalkers, self.ndim, self.logl, self.logp,
            logpargs=(self.theta_prior, self.theta_keys,,
            loglargs=(,), betas=self.betas, a=proposal_scale_factor)

Gregory Ashton's avatar
Gregory Ashton committed
        p0 = self.generate_initial_p0()
        p0 = self.apply_corrections_to_p0(p0)

        ninit_steps = len(self.nsteps) - 2
        for j, n in enumerate(self.nsteps[:-2]):
  'Running {}/{} initialisation with {} steps'.format(
Gregory Ashton's avatar
Gregory Ashton committed
                j, ninit_steps, n))
            sampler = self.run_sampler(sampler, p0, nburn=n)
  "Mean acceptance fraction: {}"
                         .format(np.mean(sampler.acceptance_fraction, axis=1)))
            if self.ntemps > 1:
      "Tswap acceptance fraction: {}"
            if create_plots:
                fig, axes = self.plot_walkers(sampler,
                    self.outdir, self.label, j), dpi=400)

            p0 = self.get_new_p0(sampler)
Gregory Ashton's avatar
Gregory Ashton committed
            p0 = self.apply_corrections_to_p0(p0)

Gregory Ashton's avatar
Gregory Ashton committed
        if len(self.nsteps) > 1:
            nburn = self.nsteps[-2]
            nburn = 0
        nprod = self.nsteps[-1]'Running final burn and prod with {} steps'.format(
        sampler = self.run_sampler(sampler, p0, nburn=nburn, nprod=nprod)
400"Mean acceptance fraction: {}"
                     .format(np.mean(sampler.acceptance_fraction, axis=1)))
        if self.ntemps > 1:
  "Tswap acceptance fraction: {}"

        if create_plots:
            fig, axes = self.plot_walkers(sampler, symbols=self.theta_symbols,
                                          nprod=nprod, **kwargs)
            fig.savefig('{}/{}_walkers.png'.format(self.outdir, self.label),

        samples = sampler.chain[0, :, nburn:, :].reshape((-1, self.ndim))
        lnprobs = sampler.lnprobability[0, :, nburn:].reshape((-1))
        lnlikes = sampler.lnlikelihood[0, :, nburn:].reshape((-1))
        self.sampler = sampler
        self.samples = samples
        self.lnprobs = lnprobs
        self.lnlikes = lnlikes
        self.save_data(sampler, samples, lnprobs, lnlikes)

    def get_rescale_multiplier_for_key(self, key):
        """ Get the rescale multiplier from the rescale_dictionary

        Can either be a float, a string (in which case it is interpretted as
        a attribute of the MCMCSearch class, e.g. minStartTime, or non-existent
        in which case 0 is returned
        if key not in self.rescale_dictionary:
            return 1

        if 'multiplier' in self.rescale_dictionary[key]:
            val = self.rescale_dictionary[key]['multiplier']
            if type(val) == str:
                if hasattr(self, val):
                    multiplier = getattr(
                        self, self.rescale_dictionary[key]['multiplier'])
                    raise ValueError(
                        "multiplier {} not a class attribute".format(val))
                multiplier = val
            multiplier = 1
        return multiplier

    def get_rescale_subtractor_for_key(self, key):
        """ Get the rescale subtractor from the rescale_dictionary

        Can either be a float, a string (in which case it is interpretted as
        a attribute of the MCMCSearch class, e.g. minStartTime, or non-existent
        in which case 0 is returned
        if key not in self.rescale_dictionary:
            return 0

        if 'subtractor' in self.rescale_dictionary[key]:
            val = self.rescale_dictionary[key]['subtractor']
            if type(val) == str:
                if hasattr(self, val):
                    subtractor = getattr(
                        self, self.rescale_dictionary[key]['subtractor'])
                    raise ValueError(
                        "subtractor {} not a class attribute".format(val))
                subtractor = val
            subtractor = 0
        return subtractor

    def scale_samples(self, samples, theta_keys):
        """ Scale the samples using the rescale_dictionary """
        for key in theta_keys:
            if key in self.rescale_dictionary:
                idx = theta_keys.index(key)
                s = samples[:, idx]
                subtractor = self.get_rescale_subtractor_for_key(key)
                s = s - subtractor
                multiplier = self.get_rescale_multiplier_for_key(key)
                s *= multiplier
                samples[:, idx] = s

        return samples

    def get_labels(self):
        """ Combine the units, symbols and rescaling to give labels """

        labels = []
        for key in self.theta_keys:
            label = None
            s = self.symbol_dictionary[key]
            s.replace('_{glitch}', r'_\textrm{glitch}')
            u = self.unit_dictionary[key]
            if key in self.rescale_dictionary:
                if 'symbol' in self.rescale_dictionary[key]:
                    s = self.rescale_dictionary[key]['symbol']
                if 'label' in self.rescale_dictionary[key]:
                    label = self.rescale_dictionary[key]['label']
                if 'unit' in self.rescale_dictionary[key]:
                    u = self.rescale_dictionary[key]['unit']
            if label is None:
                label = '{} \n [{}]'.format(s, u)
        return labels

    def plot_corner(self, figsize=(7, 7),  tglitch_ratio=False,
                    add_prior=False, nstds=None, label_offset=0.4,
                    dpi=300, rc_context={}, **kwargs):

Gregory Ashton's avatar
Gregory Ashton committed
        if self.ndim < 2:
            with plt.rc_context(rc_context):
                fig, ax = plt.subplots(figsize=figsize)
                ax.hist(self.samples, bins=50, histtype='stepfilled')

                self.outdir, self.label), dpi=dpi)

        with plt.rc_context(rc_context):
            fig, axes = plt.subplots(self.ndim, self.ndim,

            samples_plt = copy.copy(self.samples)
            labels = self.get_labels()

            samples_plt = self.scale_samples(samples_plt, self.theta_keys)

            if tglitch_ratio:
                for j, k in enumerate(self.theta_keys):
                    if k == 'tglitch':
                        s = samples_plt[:, j]
                        samples_plt[:, j] = (
                            s - self.minStartTime)/(
                                self.maxStartTime - self.minStartTime)
                        labels[j] = r'$R_{\textrm{glitch}}$'

            if type(nstds) is int and 'range' not in kwargs:
                _range = []
                for j, s in enumerate(samples_plt.T):
                    median = np.median(s)
                    std = np.std(s)
                    _range.append((median - nstds*std, median + nstds*std))
                _range = None

            fig_triangle = corner.corner(samples_plt,
                                         label_kwargs={'fontsize': 8},
                                         data_kwargs={'alpha': 0.1,
                                                      'ms': 0.5},

            axes_list = fig_triangle.get_axes()
            axes = np.array(axes_list).reshape(self.ndim, self.ndim)
            for ax in axes[:, 0]:
                ax.yaxis.set_label_coords(-label_offset, 0.5)
            for ax in axes[-1, :]:
                ax.xaxis.set_label_coords(0.5, -label_offset)
            for ax in axes_list:
            plt.tight_layout(h_pad=0.0, w_pad=0.0)
            fig.subplots_adjust(hspace=0.05, wspace=0.05)

            if add_prior:
                self.add_prior_to_corner(axes, self.samples)

                self.outdir, self.label), dpi=dpi)

    def add_prior_to_corner(self, axes, samples):
        for i, key in enumerate(self.theta_keys):
            ax = axes[i][i]
            xlim = ax.get_xlim()
            s = samples[:, i]
Gregory Ashton's avatar
Gregory Ashton committed
            prior = self.generic_lnprior(**self.theta_prior[key])
            x = np.linspace(s.min(), s.max(), 100)
            multiplier = self.get_rescale_multiplier_for_key(key)
            subtractor = self.get_rescale_subtractor_for_key(key)
            ax2 = ax.twinx()
            ax2.plot((x-subtractor)*multiplier, [prior(xi) for xi in x], '-r')

    def plot_prior_posterior(self, normal_stds=2):
        """ Plot the posterior in the context of the prior """
        fig, axes = plt.subplots(nrows=self.ndim, figsize=(8, 4*self.ndim))
        N = 1000
        from scipy.stats import gaussian_kde

        for i, (ax, key) in enumerate(zip(axes, self.theta_keys)):
            prior_dict = self.theta_prior[key]
            prior_func = self.generic_lnprior(**prior_dict)
            if prior_dict['type'] == 'unif':
                x = np.linspace(prior_dict['lower'], prior_dict['upper'], N)
                prior = prior_func(x)
                prior[0] = 0
                prior[-1] = 0
            elif prior_dict['type'] == 'norm':
                lower = prior_dict['loc'] - normal_stds * prior_dict['scale']
                upper = prior_dict['loc'] + normal_stds * prior_dict['scale']
                x = np.linspace(lower, upper, N)
                prior = prior_func(x)
            elif prior_dict['type'] == 'halfnorm':
                lower = prior_dict['loc']
                upper = prior_dict['loc'] + normal_stds * prior_dict['scale']
                x = np.linspace(lower, upper, N)
                prior = [prior_func(xi) for xi in x]
Gregory Ashton's avatar
Gregory Ashton committed
            elif prior_dict['type'] == 'neghalfnorm':
                upper = prior_dict['loc']
                lower = prior_dict['loc'] - normal_stds * prior_dict['scale']
                x = np.linspace(lower, upper, N)
                prior = [prior_func(xi) for xi in x]
                raise ValueError('Not implemented for prior type {}'.format(
            priorln = ax.plot(x, prior, 'r', label='prior')

            s = self.samples[:, i]
            while len(s) > 10**4:
                # random downsample to avoid slow calculation of kde
                s = np.random.choice(s, size=int(len(s)/2.))
            kde = gaussian_kde(s)
            ax2 = ax.twinx()
            postln = ax2.plot(x, kde.pdf(x), 'k', label='posterior')

        lns = priorln + postln
        labs = [l.get_label() for l in lns]
        axes[0].legend(lns, labs, loc=1, framealpha=0.8)

            self.outdir, self.label))

    def plot_cumulative_max(self, **kwargs):
Gregory Ashton's avatar
Gregory Ashton committed
        d, maxtwoF = self.get_max_twoF()
        for key, val in self.theta_prior.iteritems():
            if key not in d:
                d[key] = val

        if hasattr(self, 'search') is False:
Gregory Ashton's avatar
Gregory Ashton committed
        if self.binary is False:
                self.label, self.outdir, F0=d['F0'], F1=d['F1'], F2=d['F2'],
                Alpha=d['Alpha'], Delta=d['Delta'],
                tstart=self.minStartTime, tend=self.maxStartTime,
                self.label, self.outdir, F0=d['F0'], F1=d['F1'], F2=d['F2'],
                Alpha=d['Alpha'], Delta=d['Delta'], asini=d['asini'],
                period=d['period'], ecc=d['ecc'], argp=d['argp'], tp=d['argp'],
                tstart=self.minStartTime, tend=self.maxStartTime, **kwargs)
Gregory Ashton's avatar
Gregory Ashton committed

Gregory Ashton's avatar
Gregory Ashton committed
    def generic_lnprior(self, **kwargs):
        """ Return a lambda function of the pdf

        kwargs: dict
            A dictionary containing 'type' of pdf and shape parameters


        def logunif(x, a, b):
            above = x < b
            below = x > a
            if type(above) is not np.ndarray:
                if above and below:
                    return -np.log(b-a)
                    return -np.inf
                idxs = np.array([all(tup) for tup in zip(above, below)])
                p = np.zeros(len(x)) - np.inf
                p[idxs] = -np.log(b-a)
                return p

        def halfnorm(x, loc, scale):
            if x < loc:
                return -np.inf
                return -0.5*((x-loc)**2/scale**2+np.log(0.5*np.pi*scale**2))

        def cauchy(x, x0, gamma):
            return 1.0/(np.pi*gamma*(1+((x-x0)/gamma)**2))

        def exp(x, x0, gamma):
            if x > x0:
                return np.log(gamma) - gamma*(x - x0)
                return -np.inf

        if kwargs['type'] == 'unif':
            return lambda x: logunif(x, kwargs['lower'], kwargs['upper'])
        elif kwargs['type'] == 'halfnorm':
            return lambda x: halfnorm(x, kwargs['loc'], kwargs['scale'])
        elif kwargs['type'] == 'neghalfnorm':
            return lambda x: halfnorm(-x, kwargs['loc'], kwargs['scale'])
        elif kwargs['type'] == 'norm':
            return lambda x: -0.5*((x - kwargs['loc'])**2/kwargs['scale']**2
                                   + np.log(2*np.pi*kwargs['scale']**2))
  "kwargs:", kwargs)
            raise ValueError("Print unrecognise distribution")

Gregory Ashton's avatar
Gregory Ashton committed
    def generate_rv(self, **kwargs):
        dist_type = kwargs.pop('type')
        if dist_type == "unif":
            return np.random.uniform(low=kwargs['lower'], high=kwargs['upper'])
        if dist_type == "norm":
            return np.random.normal(loc=kwargs['loc'], scale=kwargs['scale'])
        if dist_type == "halfnorm":
            return np.abs(np.random.normal(loc=kwargs['loc'],
        if dist_type == "neghalfnorm":
            return -1 * np.abs(np.random.normal(loc=kwargs['loc'],
        if dist_type == "lognorm":
            return np.random.lognormal(
                mean=kwargs['loc'], sigma=kwargs['scale'])
            raise ValueError("dist_type {} unknown".format(dist_type))

Gregory Ashton's avatar
Gregory Ashton committed
    def plot_walkers(self, sampler, symbols=None, alpha=0.4, color="k", temp=0,
                     lw=0.1, nprod=0, add_det_stat_burnin=False,
                     fig=None, axes=None, xoffset=0, plot_det_stat=False,
                     context='classic', subtractions=None, labelpad=0.05):
        """ Plot all the chains from a sampler """

        if np.ndim(axes) > 1:
            axes = axes.flatten()

        shape = sampler.chain.shape
        if len(shape) == 3:
            nwalkers, nsteps, ndim = shape
            chain = sampler.chain[:, :, :]
        if len(shape) == 4:
            ntemps, nwalkers, nsteps, ndim = shape
            if temp < ntemps:
      "Plotting temperature {} chains".format(temp))
                raise ValueError(("Requested temperature {} outside of"
                                  "available range").format(temp))
            chain = sampler.chain[temp, :, :, :]

        if subtractions is None:
            subtractions = [0 for i in range(ndim)]
            if len(subtractions) != self.ndim:
                raise ValueError('subtractions must be of length ndim')

        if plot_det_stat:
            extra_subplots = 1
            extra_subplots = 0
Gregory Ashton's avatar
Gregory Ashton committed
            plt.rcParams['text.usetex'] = True
Gregory Ashton's avatar
Gregory Ashton committed
            if fig is None and axes is None:
                fig = plt.figure(figsize=(4, 3.0*ndim))
                ax = fig.add_subplot(ndim+extra_subplots, 1, 1)
                axes = [ax] + [fig.add_subplot(ndim+extra_subplots, 1, i)
Gregory Ashton's avatar
Gregory Ashton committed
                               for i in range(2, ndim+1)]

Gregory Ashton's avatar
Gregory Ashton committed
            idxs = np.arange(chain.shape[1])
            burnin_idx = chain.shape[1] - nprod
            if hasattr(self, 'convergence_idx'):
                convergence_idx = self.convergence_idx
                convergence_idx = burnin_idx
            if ndim > 1:
                for i in range(ndim):
                    axes[i].ticklabel_format(useOffset=False, axis='y')
Gregory Ashton's avatar
Gregory Ashton committed
                    cs = chain[:, :, i].T
                    if burnin_idx > 0:
                                     color="r", alpha=alpha,
Gregory Ashton's avatar
Gregory Ashton committed
                                        color='k', ls='--', lw=0.25)
Gregory Ashton's avatar
Gregory Ashton committed
                                 color="k", alpha=alpha, lw=lw)
                    if symbols:
                        if subtractions[i] == 0:
                            axes[i].set_ylabel(symbols[i], labelpad=labelpad)

                    if hasattr(self, 'convergence_diagnostic'):
                        ax = axes[i].twinx()
                        c_x = np.array(self.convergence_diagnosticx)
                        c_y = np.array(self.convergence_diagnostic)
                        break_idx = np.argmin(np.abs(c_x - burnin_idx))
                        ax.plot(c_x[:break_idx], c_y[:break_idx, i], '-b')
                        ax.plot(c_x[break_idx:], c_y[break_idx:, i], '-b')
                        ax.set_ylim(1, self.convergence_plot_upper_lim)
Gregory Ashton's avatar
Gregory Ashton committed
                axes[0].ticklabel_format(useOffset=False, axis='y')
Gregory Ashton's avatar
Gregory Ashton committed
                cs = chain[:, :, temp].T
Gregory Ashton's avatar
Gregory Ashton committed
                if burnin_idx:
                    axes[0].plot(idxs[:burnin_idx], cs[:burnin_idx],
                                 color="r", alpha=alpha, lw=lw)
                axes[0].plot(idxs[burnin_idx:], cs[burnin_idx:], color="k",
                             alpha=alpha, lw=lw)
                if symbols:
                    axes[0].set_ylabel(symbols[0], labelpad=labelpad)

            if plot_det_stat:
                if len(axes) == ndim:
                    axes.append(fig.add_subplot(ndim+1, 1, ndim+1))

                lnl = sampler.lnlikelihood[temp, :, :]
                if burnin_idx and add_det_stat_burnin:
                    burn_in_vals = lnl[:, :burnin_idx].flatten()
                                      bins=50, histtype='step', color='r')
                    except ValueError:
              'Det. Stat. hist failed, most likely all '
                                     'values where the same')
                    burn_in_vals = []
                prod_vals = lnl[:, burnin_idx:].flatten()
                    axes[-1].hist(prod_vals[~np.isnan(prod_vals)], bins=50,
                                  histtype='step', color='k')
                except ValueError:
          'Det. Stat. hist failed, most likely all '
                                 'values where the same')
                if self.BSGL:
                combined_vals = np.append(burn_in_vals, prod_vals)
                if len(combined_vals) > 0:
                    minv = np.min(combined_vals)
                    maxv = np.max(combined_vals)
                    Range = abs(maxv-minv)
                    axes[-1].set_xlim(minv-0.1*Range, maxv+0.1*Range)

                xfmt = matplotlib.ticker.ScalarFormatter()
                xfmt.set_powerlimits((-4, 4))

            axes[-2].set_xlabel(r'$\textrm{Number of steps}$', labelpad=0.2)
        return fig, axes

Gregory Ashton's avatar
Gregory Ashton committed
    def apply_corrections_to_p0(self, p0):
        """ Apply any correction to the initial p0 values """
        return p0

    def generate_scattered_p0(self, p):
        """ Generate a set of p0s scattered about p """
Gregory Ashton's avatar
Gregory Ashton committed
        p0 = [[p + self.scatter_val * p * np.random.randn(self.ndim)
               for i in xrange(self.nwalkers)]
              for j in xrange(self.ntemps)]
        return p0

Gregory Ashton's avatar
Gregory Ashton committed
    def generate_initial_p0(self):
        """ Generate a set of init vals for the walkers """

        if type(self.theta_initial) == dict:
  'Generate initial values from initial dictionary')
            if hasattr(self, 'nglitch') and self.nglitch > 1:
                raise ValueError('Initial dict not implemented for nglitch>1')
Gregory Ashton's avatar
Gregory Ashton committed
            p0 = [[[self.generate_rv(**self.theta_initial[key])
                    for key in self.theta_keys]
                   for i in range(self.nwalkers)]
                  for j in range(self.ntemps)]
        elif type(self.theta_initial) == list:
  'Generate initial values from list of theta_initial')
            p0 = [[[self.generate_rv(**val)
                    for val in self.theta_initial]
                   for i in range(self.nwalkers)]
                  for j in range(self.ntemps)]
        elif self.theta_initial is None:
  'Generate initial values from prior dictionary')
Gregory Ashton's avatar
Gregory Ashton committed
            p0 = [[[self.generate_rv(**self.theta_prior[key])
                    for key in self.theta_keys]
                   for i in range(self.nwalkers)]
                  for j in range(self.ntemps)]
        elif len(self.theta_initial) == self.ndim:
Gregory Ashton's avatar
Gregory Ashton committed
            p0 = self.generate_scattered_p0(self.theta_initial)
            raise ValueError('theta_initial not understood')

        return p0

    def get_new_p0(self, sampler):
        """ Returns new initial positions for walkers are burn0 stage

        This returns new positions for all walkers by scattering points about
        the maximum posterior with scale `scatter_val`.

Gregory Ashton's avatar
Gregory Ashton committed
        temp_idx = 0
        pF = sampler.chain[temp_idx, :, :, :]
        lnl = sampler.lnlikelihood[temp_idx, :, :]
        lnp = sampler.lnprobability[temp_idx, :, :]

        # General warnings about the state of lnp
Gregory Ashton's avatar
Gregory Ashton committed
        if np.any(np.isnan(lnp)):
                "Of {} lnprobs {} are nan".format(
Gregory Ashton's avatar
Gregory Ashton committed
                    np.shape(lnp), np.sum(np.isnan(lnp))))
        if np.any(np.isposinf(lnp)):
                "Of {} lnprobs {} are +np.inf".format(
Gregory Ashton's avatar
Gregory Ashton committed
                    np.shape(lnp), np.sum(np.isposinf(lnp))))
        if np.any(np.isneginf(lnp)):
                "Of {} lnprobs {} are -np.inf".format(
Gregory Ashton's avatar
Gregory Ashton committed
                    np.shape(lnp), np.sum(np.isneginf(lnp))))

        lnp_finite = copy.copy(lnp)
        lnp_finite[np.isinf(lnp)] = np.nan
Gregory Ashton's avatar
Gregory Ashton committed
        idx = np.unravel_index(np.nanargmax(lnp_finite), lnp_finite.shape)
        p = pF[idx]
        p0 = self.generate_scattered_p0(p)

948 = False
        twoF = self.logl(p, = self.BSGL'Gen. new p0 from pos {} which had det. stat.={:2.1f},'
                      ' twoF={:2.1f} and lnp={:2.1f}')
                     .format(idx[1], lnl[idx], twoF, lnp_finite[idx]))

        return p0

    def get_save_data_dictionary(self):
        d = dict(nsteps=self.nsteps, nwalkers=self.nwalkers,
                 ntemps=self.ntemps, theta_keys=self.theta_keys,
Gregory Ashton's avatar
Gregory Ashton committed
                 theta_prior=self.theta_prior, scatter_val=self.scatter_val,
        return d

    def save_data(self, sampler, samples, lnprobs, lnlikes):
        d = self.get_save_data_dictionary()
        d['sampler'] = sampler
        d['samples'] = samples
        d['lnprobs'] = lnprobs
        d['lnlikes'] = lnlikes

        if os.path.isfile(self.pickle_path):
  'Saving backup of {} as {}.old'.format(
                self.pickle_path, self.pickle_path))
            os.rename(self.pickle_path, self.pickle_path+".old")
        with open(self.pickle_path, "wb") as File:
            pickle.dump(d, File)

    def get_saved_data(self):
        with open(self.pickle_path, "r") as File:
            d = pickle.load(File)
        return d

    def check_old_data_is_okay_to_use(self):
        if args.use_old_data:
  "Forcing use of old data")
            return True

        if os.path.isfile(self.pickle_path) is False:
  'No pickled data found')
            return False

Gregory Ashton's avatar
Gregory Ashton committed
        if self.sftfilepath is not None:
            oldest_sft = min([os.path.getmtime(f) for f in
            if os.path.getmtime(self.pickle_path) < oldest_sft:
      'Pickled data outdates sft files')
                return False

        old_d = self.get_saved_data().copy()
        new_d = self.get_save_data_dictionary().copy()


        mod_keys = []
        for key in new_d.keys():
            if key in old_d:
                if new_d[key] != old_d[key]:
                    mod_keys.append((key, old_d[key], new_d[key]))
                raise ValueError('Keys {} not in old dictionary'.format(key))

        if len(mod_keys) == 0:
            return True
            logging.warning("Saved data differs from requested")
  "Differences found in following keys:")
            for key in mod_keys:
                if len(key) == 3:
                    if np.isscalar(key[1]) or key[0] == 'nsteps':
              "    {} : {} -> {}".format(*key))
              "    " + key[0])
            return False

    def get_max_twoF(self, threshold=0.05):
        """ Returns the max likelihood sample and the corresponding 2F value

        Note: the sample is returned as a dictionary along with an estimate of
        the standard deviation calculated from the std of all samples with a
        twoF within `threshold` (relative) to the max twoF

        if any(np.isposinf(self.lnlikes)):
  'twoF values contain positive infinite values')
        if any(np.isneginf(self.lnlikes)):
  'twoF values contain negative infinite values')
        if any(np.isnan(self.lnlikes)):
  'twoF values contain nan')
        idxs = np.isfinite(self.lnlikes)
        jmax = np.nanargmax(self.lnlikes[idxs])
        maxlogl = self.lnlikes[jmax]
        d = OrderedDict()

        if self.BSGL:
            if hasattr(self, 'search') is False:
Gregory Ashton's avatar
Gregory Ashton committed
            p = self.samples[jmax]
   = False
            maxtwoF = self.logl(p,
   = self.BSGL
            maxtwoF = maxlogl

Gregory Ashton's avatar
Gregory Ashton committed
        repeats = []
        for i, k in enumerate(self.theta_keys):
Gregory Ashton's avatar
Gregory Ashton committed
            if k in d and k not in repeats:
                d[k+'_0'] = d[k]  # relabel the old key
            if k in repeats:
                k = k + '_0'
                count = 1
                while k in d:
                    k = k.replace('_{}'.format(count-1), '_{}'.format(count))
                    count += 1
            d[k] = self.samples[jmax][i]
        return d, maxtwoF

    def get_median_stds(self):
        """ Returns a dict of the median and std of all production samples """
        d = OrderedDict()
Gregory Ashton's avatar
Gregory Ashton committed
        repeats = []
        for s, k in zip(self.samples.T, self.theta_keys):
Gregory Ashton's avatar
Gregory Ashton committed
            if k in d and k not in repeats:
                d[k+'_0'] = d[k]  # relabel the old key
                d[k+'_0_std'] = d[k+'_std']
            if k in repeats:
                k = k + '_0'
                count = 1
                while k in d:
                    k = k.replace('_{}'.format(count-1), '_{}'.format(count))
                    count += 1

            d[k] = np.median(s)
            d[k+'_std'] = np.std(s)
        return d

    def check_if_samples_are_railing(self, threshold=0.01):
        return_flag = False
        for s, k in zip(self.samples.T, self.theta_keys):
            prior = self.theta_prior[k]
            if prior['type'] == 'unif':
                prior_range = prior['upper'] - prior['lower']
                edges = []
                fracs = []
                for l in ['lower', 'upper']:
                    bools = np.abs(s - prior[l])/prior_range < threshold
                    if np.any(bools):
                if len(edges) > 0:
                        '{}% of the {} posterior is railing on the {} edges'
                        .format('% & '.join(fracs), k, ' & '.join(edges)))
                    return_flag = True
        return return_flag

    def write_par(self, method='med'):
        """ Writes a .par of the best-fit params with an estimated std """'Writing {}/{}.par using the {} method'.format(
            self.outdir, self.label, method))

        median_std_d = self.get_median_stds()
        max_twoF_d, max_twoF = self.get_max_twoF()

Gregory Ashton's avatar
Gregory Ashton committed
1119'Writing par file with max twoF = {}'.format(max_twoF))
        filename = '{}/{}.par'.format(self.outdir, self.label)
        with open(filename, 'w+') as f:
            f.write('MaxtwoF = {}\n'.format(max_twoF))
Gregory Ashton's avatar
Gregory Ashton committed
            f.write('tref = {}\n'.format(self.tref))
            if hasattr(self, 'theta0_index'):
                f.write('theta0_index = {}\n'.format(self.theta0_idx))
            if method == 'med':
                for key, val in median_std_d.iteritems():
                    f.write('{} = {:1.16e}\n'.format(key, val))
            if method == 'twoFmax':
                for key, val in max_twoF_d.iteritems():
                    f.write('{} = {:1.16e}\n'.format(key, val))

Gregory Ashton's avatar
Gregory Ashton committed
    def write_prior_table(self):
        with open('{}/{}_prior.tex'.format(self.outdir, self.label), 'w') as f:
            f.write(r"\begin{tabular}{c l c} \hline" + '\n'
                    r"Parameter & & &  \\ \hhline{====}")

            for key, prior in self.theta_prior.iteritems():
                if type(prior) is dict:
                    Type = prior['type']
                    if Type == "unif":
                        a = prior['lower']
                        b = prior['upper']
                        line = r"{} & $\mathrm{{Unif}}$({}, {}) & {}\\"
                    elif Type == "norm":
                        a = prior['loc']
                        b = prior['scale']
                        line = r"{} & $\mathcal{{N}}$({}, {}) & {}\\"
                    elif Type == "halfnorm":
                        a = prior['loc']
                        b = prior['scale']
                        line = r"{} & $|\mathcal{{N}}$({}, {})| & {}\\"

                    u = self.unit_dictionary[key]
                    s = self.symbol_dictionary[key]
                    a = helper_functions.texify_float(a)
                    b = helper_functions.texify_float(b)
                    f.write(" " + line.format(s, a, b, u) + r" \\")

    def print_summary(self):
Gregory Ashton's avatar
Gregory Ashton committed
        max_twoFd, max_twoF = self.get_max_twoF()
        median_std_d = self.get_median_stds()
Gregory Ashton's avatar
Gregory Ashton committed
        if hasattr(self, 'theta0_idx'):
Gregory Ashton's avatar
Gregory Ashton committed
  'theta0 index: {}'.format(self.theta0_idx))'Max twoF: {} with parameters:'.format(max_twoF))
Gregory Ashton's avatar
Gregory Ashton committed
        for k in np.sort(max_twoFd.keys()):
            print('  {:10s} = {:1.9e}'.format(k, max_twoFd[k]))
Gregory Ashton's avatar
Gregory Ashton committed
1171'Median +/- std for production values')
        for k in np.sort(median_std_d.keys()):
            if 'std' not in k:
Gregory Ashton's avatar
Gregory Ashton committed
      '  {:10s} = {:1.9e} +/- {:1.9e}'.format(
                    k, median_std_d[k], median_std_d[k+'_std']))
Gregory Ashton's avatar
Gregory Ashton committed

    def CF_twoFmax(self, theta, twoFmax, ntrials):
        Fmax = twoFmax/2.0
        return (np.exp(1j*theta*twoFmax)*ntrials/2.0
                * Fmax*np.exp(-Fmax)*(1-(1+Fmax)*np.exp(-Fmax))**(ntrials-1))

    def pdf_twoFhat(self, twoFhat, nglitch, ntrials, twoFmax=100, dtwoF=0.1):
        if np.ndim(ntrials) == 0:
            ntrials = np.zeros(nglitch+1) + ntrials
        twoFmax_int = np.arange(0, twoFmax, dtwoF)
        theta_int = np.arange(-1/dtwoF, 1./dtwoF, 1./twoFmax)
        CF_twoFmax_theta = np.array(
            [[np.trapz(self.CF_twoFmax(t, twoFmax_int, ntrial), twoFmax_int)
              for t in theta_int]
             for ntrial in ntrials])
        CF_twoFhat_theta =, axis=0)
        pdf = (1/(2*np.pi)) * np.array(
             * CF_twoFhat_theta, theta_int) for twoFhat_val in twoFhat])
        return pdf.real

    def p_val_twoFhat(self, twoFhat, ntrials, twoFhatmax=500, Npoints=1000):