""" Searches using MCMC-based methods """ from __future__ import division, absolute_import, print_function import sys import os import copy import logging from collections import OrderedDict import subprocess import numpy as np import matplotlib import matplotlib.pyplot as plt import emcee import corner import dill as pickle import pyfstat.core as core from pyfstat.core import tqdm, args, read_par import pyfstat.optimal_setup_functions as optimal_setup_functions import pyfstat.helper_functions as helper_functions class MCMCSearch(core.BaseSearchClass): """MCMC search using ComputeFstat Parameters ---------- label, outdir: str A label and directory to read/write data from/to theta_prior: dict Dictionary of priors and fixed values for the search parameters. For each parameters (key of the dict), if it is to be held fixed the value should be the constant float, if it is be searched, the value should be a dictionary of the prior. tref, minStartTime, maxStartTime: int GPS seconds of the reference time, start time and end time sftfilepattern: str Pattern to match SFTs using wildcards (*?) and ranges [0-9]; mutiple patterns can be given separated by colons. detectors: str Two character reference to the detectors to use, specify None for no contraint and comma separate for multiple references. nsteps: list (m,) List specifying the number of steps to take, the last two entries give the nburn and nprod of the 'production' run, all entries before are for iterative initialisation steps (usually just one) e.g. [1000, 1000, 500]. nwalkers, ntemps: int, The number of walkers and temperates to use in the parallel tempered PTSampler. log10temperature_min float < 0 The log_10(tmin) value, the set of betas passed to PTSampler are generated from `np.logspace(0, log10temperature_min, ntemps)`. theta_initial: dict, array, (None) A dictionary of distribution about which to distribute the initial walkers about rhohatmax: float, Upper bound for the SNR scale parameter (required to normalise the Bayes factor) - this needs to be carefully set when using the evidence. binary: bool If true, search over binary parameters BSGL: bool If true, use the BSGL statistic SSBPrec: int SSBPrec (SSB precision) to use when calling ComputeFstat minCoverFreq, maxCoverFreq: float Minimum and maximum instantaneous frequency which will be covered over the SFT time span as passed to CreateFstatInput injectSources: dict If given, inject these properties into the SFT files before running the search assumeSqrtSX: float Don't estimate noise-floors, but assume (stationary) per-IFO sqrt{SX} Attributes ---------- symbol_dictionary: dict Key, val pairs of the parameters (i.e. `F0`, `F1`), to Latex math symbols for plots unit_dictionary: dict Key, val pairs of the parameters (i.e. `F0`, `F1`), and the units (i.e. `Hz`) transform_dictionary: dict Key, val pairs of the parameters (i.e. `F0`, `F1`), where the key is itself a dictionary which can item `multiplier`, `subtractor`, or `unit` by which to transform by and update the units. """ symbol_dictionary = dict( F0='$f$', F1='$\dot{f}$', F2='$\ddot{f}$', Alpha=r'$\alpha$', Delta='$\delta$', asini='asini', period='P', ecc='ecc', tp='tp', argp='argp') unit_dictionary = dict( F0='Hz', F1='Hz/s', F2='Hz/s$^2$', Alpha=r'rad', Delta='rad', asini='', period='s', ecc='', tp='', argp='') transform_dictionary = {} @helper_functions.initializer def __init__(self, label, outdir, theta_prior, tref, minStartTime, maxStartTime, sftfilepattern=None, detectors=None, nsteps=[100, 100], nwalkers=100, ntemps=1, log10temperature_min=-5, theta_initial=None, scatter_val=1e-10, rhohatmax=1000, binary=False, BSGL=False, SSBprec=None, minCoverFreq=None, maxCoverFreq=None, injectSources=None, assumeSqrtSX=None): if os.path.isdir(outdir) is False: os.mkdir(outdir) self._add_log_file() logging.info('Set-up MCMC search for model {}'.format(self.label)) if sftfilepattern: logging.info('Using data {}'.format(self.sftfilepattern)) else: logging.info('No sftfilepattern given') if injectSources: logging.info('Inject sources: {}'.format(injectSources)) self.pickle_path = '{}/{}_saved_data.p'.format(self.outdir, self.label) self._unpack_input_theta() self.ndim = len(self.theta_keys) if self.log10temperature_min: self.betas = np.logspace(0, self.log10temperature_min, self.ntemps) else: self.betas = None if args.clean and os.path.isfile(self.pickle_path): os.rename(self.pickle_path, self.pickle_path+".old") self._set_likelihoodcoef() self._log_input() def _set_likelihoodcoef(self): self.likelihoodcoef = np.log(70./self.rhohatmax**4) def _log_input(self): logging.info('theta_prior = {}'.format(self.theta_prior)) logging.info('nwalkers={}'.format(self.nwalkers)) logging.info('scatter_val = {}'.format(self.scatter_val)) logging.info('nsteps = {}'.format(self.nsteps)) logging.info('ntemps = {}'.format(self.ntemps)) logging.info('log10temperature_min = {}'.format( self.log10temperature_min)) def _initiate_search_object(self): logging.info('Setting up search object') self.search = core.ComputeFstat( tref=self.tref, sftfilepattern=self.sftfilepattern, minCoverFreq=self.minCoverFreq, maxCoverFreq=self.maxCoverFreq, detectors=self.detectors, BSGL=self.BSGL, transient=False, minStartTime=self.minStartTime, maxStartTime=self.maxStartTime, binary=self.binary, injectSources=self.injectSources, assumeSqrtSX=self.assumeSqrtSX, SSBprec=self.SSBprec) def logp(self, theta_vals, theta_prior, theta_keys, search): H = [self._generic_lnprior(**theta_prior[key])(p) for p, key in zip(theta_vals, theta_keys)] return np.sum(H) def logl(self, theta, search): for j, theta_i in enumerate(self.theta_idxs): self.fixed_theta[theta_i] = theta[j] FS = search.compute_fullycoherent_det_stat_single_point( *self.fixed_theta) return FS + self.likelihoodcoef def _unpack_input_theta(self): full_theta_keys = ['F0', 'F1', 'F2', 'Alpha', 'Delta'] if self.binary: full_theta_keys += [ 'asini', 'period', 'ecc', 'tp', 'argp'] full_theta_keys_copy = copy.copy(full_theta_keys) full_theta_symbols = ['$f$', '$\dot{f}$', '$\ddot{f}$', r'$\alpha$', r'$\delta$'] if self.binary: full_theta_symbols += [ 'asini', 'period', 'ecc', 'tp', 'argp'] self.theta_keys = [] fixed_theta_dict = {} for key, val in self.theta_prior.iteritems(): if type(val) is dict: fixed_theta_dict[key] = 0 self.theta_keys.append(key) elif type(val) in [float, int, np.float64]: fixed_theta_dict[key] = val else: raise ValueError( 'Type {} of {} in theta not recognised'.format( type(val), key)) full_theta_keys_copy.pop(full_theta_keys_copy.index(key)) if len(full_theta_keys_copy) > 0: raise ValueError(('Input dictionary `theta` is missing the' 'following keys: {}').format( full_theta_keys_copy)) self.fixed_theta = [fixed_theta_dict[key] for key in full_theta_keys] self.theta_idxs = [full_theta_keys.index(k) for k in self.theta_keys] self.theta_symbols = [full_theta_symbols[i] for i in self.theta_idxs] idxs = np.argsort(self.theta_idxs) self.theta_idxs = [self.theta_idxs[i] for i in idxs] self.theta_symbols = [self.theta_symbols[i] for i in idxs] self.theta_keys = [self.theta_keys[i] for i in idxs] def _check_initial_points(self, p0): for nt in range(self.ntemps): logging.info('Checking temperature {} chains'.format(nt)) initial_priors = np.array([ self.logp(p, self.theta_prior, self.theta_keys, self.search) for p in p0[nt]]) number_of_initial_out_of_bounds = sum(initial_priors == -np.inf) if number_of_initial_out_of_bounds > 0: logging.warning( 'Of {} initial values, {} are -np.inf due to the prior' .format(len(initial_priors), number_of_initial_out_of_bounds)) p0 = self._generate_new_p0_to_fix_initial_points( p0, nt, initial_priors) def _generate_new_p0_to_fix_initial_points(self, p0, nt, initial_priors): logging.info('Attempting to correct intial values') idxs = np.arange(self.nwalkers)[initial_priors == -np.inf] count = 0 while sum(initial_priors == -np.inf) > 0 and count < 100: for j in idxs: p0[nt][j] = (p0[nt][np.random.randint(0, self.nwalkers)]*( 1+np.random.normal(0, 1e-10, self.ndim))) initial_priors = np.array([ self.logp(p, self.theta_prior, self.theta_keys, self.search) for p in p0[nt]]) count += 1 if sum(initial_priors == -np.inf) > 0: logging.info('Failed to fix initial priors') else: logging.info('Suceeded to fix initial priors') return p0 def setup_burnin_convergence_testing( self, n=10, test_type='autocorr', windowed=False, **kwargs): """ Set up convergence testing during the MCMC simulation Parameters ---------- n: int Number of steps after which to test convergence test_type: str ['autocorr', 'GR'] If 'autocorr' use the exponential autocorrelation time (kwargs passed to `get_autocorr_convergence`). If 'GR' use the Gelman-Rubin statistic (kwargs passed to `get_GR_convergence`) windowed: bool If True, only calculate the convergence test in a window of length `n` **kwargs: Passed to either `_test_autocorr_convergence()` or `_test_GR_convergence()` depending on `test_type`. """ logging.info('Setting up convergence testing') self.convergence_n = n self.convergence_windowed = windowed self.convergence_test_type = test_type self.convergence_kwargs = kwargs self.convergence_diagnostic = [] self.convergence_diagnosticx = [] if test_type in ['autocorr']: self._get_convergence_test = self._test_autocorr_convergence elif test_type in ['GR']: self._get_convergence_test = self._test_GR_convergence else: raise ValueError('test_type {} not understood'.format(test_type)) def _test_autocorr_convergence(self, i, sampler, test=True, n_cut=5): try: acors = np.zeros((self.ntemps, self.ndim)) for temp in range(self.ntemps): if self.convergence_windowed: j = i-self.convergence_n else: j = 0 x = np.mean(sampler.chain[temp, :, j:i, :], axis=0) acors[temp, :] = emcee.autocorr.exponential_time(x) c = np.max(acors, axis=0) except emcee.autocorr.AutocorrError: logging.info('Failed to calculate exponential autocorrelation') c = np.zeros(self.ndim) + np.nan except AttributeError: logging.info('Unable to calculate exponential autocorrelation') c = np.zeros(self.ndim) + np.nan self.convergence_diagnosticx.append(i - self.convergence_n/2.) self.convergence_diagnostic.append(list(c)) if test: return i > n_cut * np.max(c) def _test_GR_convergence(self, i, sampler, test=True, R=1.1): if self.convergence_windowed: s = sampler.chain[0, :, i-self.convergence_n+1:i+1, :] else: s = sampler.chain[0, :, :i+1, :] N = float(self.convergence_n) M = float(self.nwalkers) W = np.mean(np.var(s, axis=1), axis=0) per_walker_mean = np.mean(s, axis=1) mean = np.mean(per_walker_mean, axis=0) B = N / (M-1.) * np.sum((per_walker_mean-mean)**2, axis=0) Vhat = (N-1)/N * W + (M+1)/(M*N) * B c = np.sqrt(Vhat/W) self.convergence_diagnostic.append(c) self.convergence_diagnosticx.append(i - self.convergence_n/2.) if test and np.max(c) < R: return True else: return False def _test_convergence(self, i, sampler, **kwargs): if np.mod(i+1, self.convergence_n) == 0: return self._get_convergence_test(i, sampler, **kwargs) else: return False def _run_sampler_with_conv_test(self, sampler, p0, nprod=0, nburn=0): logging.info('Running {} burn-in steps with convergence testing' .format(nburn)) iterator = tqdm(sampler.sample(p0, iterations=nburn), total=nburn) for i, output in enumerate(iterator): if self._test_convergence(i, sampler, test=True, **self.convergence_kwargs): logging.info( 'Converged at {} before max number {} of steps reached' .format(i, nburn)) self.convergence_idx = i break iterator.close() logging.info('Running {} production steps'.format(nprod)) j = nburn iterator = tqdm(sampler.sample(output[0], iterations=nprod), total=nprod) for result in iterator: self._test_convergence(j, sampler, test=False, **self.convergence_kwargs) j += 1 return sampler def _run_sampler(self, sampler, p0, nprod=0, nburn=0): if hasattr(self, 'convergence_n'): self._run_sampler_with_conv_test(sampler, p0, nprod, nburn) else: for result in tqdm(sampler.sample(p0, iterations=nburn+nprod), total=nburn+nprod): pass self.mean_acceptance_fraction = np.mean( sampler.acceptance_fraction, axis=1) logging.info("Mean acceptance fraction: {}" .format(self.mean_acceptance_fraction)) if self.ntemps > 1: self.tswap_acceptance_fraction = sampler.tswap_acceptance_fraction logging.info("Tswap acceptance fraction: {}" .format(sampler.tswap_acceptance_fraction)) try: self.autocorr_time = sampler.get_autocorr_time(c=4) logging.info("Autocorrelation length: {}".format( self.autocorr_time)) except emcee.autocorr.AutocorrError as e: self.autocorr_time = np.nan logging.warning( 'Autocorrelation calculation failed with message {}'.format(e)) return sampler def _estimate_run_time(self): """ Print the estimated run time Uses timing coefficients based on a Lenovo T460p Intel(R) Core(TM) i5-6300HQ CPU @ 2.30GHz. """ # Todo: add option to time on a machine, and move coefficients to # ~/.pyfstat.conf if (type(self.theta_prior['Alpha']) == dict or type(self.theta_prior['Delta']) == dict): tau0S = 7.3e-5 tau0LD = 4.2e-7 else: tau0S = 5.0e-5 tau0LD = 6.2e-8 Nsfts = (self.maxStartTime - self.minStartTime) / 1800. numb_evals = np.sum(self.nsteps)*self.nwalkers*self.ntemps a = tau0S * numb_evals b = tau0LD * Nsfts * numb_evals logging.info('Estimated run-time = {} s = {:1.0f}:{:1.0f} m'.format( a+b, *divmod(a+b, 60))) def run(self, proposal_scale_factor=2, create_plots=True, c=5, **kwargs): """ Run the MCMC simulatation Parameters ---------- proposal_scale_factor: float The proposal scale factor used by the sampler, see Goodman & Weare (2010). If the acceptance fraction is too low, you can raise it by decreasing the a parameter; and if it is too high, you can reduce it by increasing the a parameter [Foreman-Mackay (2013)]. create_plots: bool If true, save trace plots of the walkers c: int The minimum number of autocorrelation times needed to trust the result when estimating the autocorrelation time (see emcee.autocorr.integrated_time for further details. Default is 5 **kwargs: Passed to _plot_walkers to control the figures Returns ------- sampler: emcee.ptsampler.PTSampler The emcee ptsampler object """ self.old_data_is_okay_to_use = self._check_old_data_is_okay_to_use() if self.old_data_is_okay_to_use is True: logging.warning('Using saved data from {}'.format( self.pickle_path)) d = self.get_saved_data_dictionary() self.samples = d['samples'] self.lnprobs = d['lnprobs'] self.lnlikes = d['lnlikes'] self.all_lnlikelihood = d['all_lnlikelihood'] return self._initiate_search_object() self._estimate_run_time() sampler = emcee.PTSampler( self.ntemps, self.nwalkers, self.ndim, self.logl, self.logp, logpargs=(self.theta_prior, self.theta_keys, self.search), loglargs=(self.search,), betas=self.betas, a=proposal_scale_factor) p0 = self._generate_initial_p0() p0 = self._apply_corrections_to_p0(p0) self._check_initial_points(p0) ninit_steps = len(self.nsteps) - 2 for j, n in enumerate(self.nsteps[:-2]): logging.info('Running {}/{} initialisation with {} steps'.format( j, ninit_steps, n)) sampler = self._run_sampler(sampler, p0, nburn=n) if create_plots: fig, axes = self._plot_walkers(sampler, symbols=self.theta_symbols, **kwargs) fig.tight_layout() fig.savefig('{}/{}_init_{}_walkers.png'.format( self.outdir, self.label, j)) p0 = self._get_new_p0(sampler) p0 = self._apply_corrections_to_p0(p0) self._check_initial_points(p0) sampler.reset() if len(self.nsteps) > 1: nburn = self.nsteps[-2] else: nburn = 0 nprod = self.nsteps[-1] logging.info('Running final burn and prod with {} steps'.format( nburn+nprod)) sampler = self._run_sampler(sampler, p0, nburn=nburn, nprod=nprod) if create_plots: fig, axes = self._plot_walkers(sampler, symbols=self.theta_symbols, nprod=nprod, **kwargs) fig.tight_layout() fig.savefig('{}/{}_walkers.png'.format(self.outdir, self.label), ) samples = sampler.chain[0, :, nburn:, :].reshape((-1, self.ndim)) lnprobs = sampler.lnprobability[0, :, nburn:].reshape((-1)) lnlikes = sampler.lnlikelihood[0, :, nburn:].reshape((-1)) all_lnlikelihood = sampler.lnlikelihood[:, :, nburn:] self.samples = samples self.lnprobs = lnprobs self.lnlikes = lnlikes self.all_lnlikelihood = all_lnlikelihood self._save_data(sampler, samples, lnprobs, lnlikes, all_lnlikelihood) return sampler def _get_rescale_multiplier_for_key(self, key): """ Get the rescale multiplier from the transform_dictionary Can either be a float, a string (in which case it is interpretted as a attribute of the MCMCSearch class, e.g. minStartTime, or non-existent in which case 0 is returned """ if key not in self.transform_dictionary: return 1 if 'multiplier' in self.transform_dictionary[key]: val = self.transform_dictionary[key]['multiplier'] if type(val) == str: if hasattr(self, val): multiplier = getattr( self, self.transform_dictionary[key]['multiplier']) else: raise ValueError( "multiplier {} not a class attribute".format(val)) else: multiplier = val else: multiplier = 1 return multiplier def _get_rescale_subtractor_for_key(self, key): """ Get the rescale subtractor from the transform_dictionary Can either be a float, a string (in which case it is interpretted as a attribute of the MCMCSearch class, e.g. minStartTime, or non-existent in which case 0 is returned """ if key not in self.transform_dictionary: return 0 if 'subtractor' in self.transform_dictionary[key]: val = self.transform_dictionary[key]['subtractor'] if type(val) == str: if hasattr(self, val): subtractor = getattr( self, self.transform_dictionary[key]['subtractor']) else: raise ValueError( "subtractor {} not a class attribute".format(val)) else: subtractor = val else: subtractor = 0 return subtractor def _scale_samples(self, samples, theta_keys): """ Scale the samples using the transform_dictionary """ for key in theta_keys: if key in self.transform_dictionary: idx = theta_keys.index(key) s = samples[:, idx] subtractor = self._get_rescale_subtractor_for_key(key) s = s - subtractor multiplier = self._get_rescale_multiplier_for_key(key) s *= multiplier samples[:, idx] = s return samples def _get_labels(self): """ Combine the units, symbols and rescaling to give labels """ labels = [] for key in self.theta_keys: label = None s = self.symbol_dictionary[key] s.replace('_{glitch}', r'_\textrm{glitch}') u = self.unit_dictionary[key] if key in self.transform_dictionary: if 'symbol' in self.transform_dictionary[key]: s = self.transform_dictionary[key]['symbol'] if 'label' in self.transform_dictionary[key]: label = self.transform_dictionary[key]['label'] if 'unit' in self.transform_dictionary[key]: u = self.transform_dictionary[key]['unit'] if label is None: label = '{} \n [{}]'.format(s, u) labels.append(label) return labels def plot_corner(self, figsize=(7, 7), add_prior=False, nstds=None, label_offset=0.4, dpi=300, rc_context={}, tglitch_ratio=False, fig_and_axes=None, save_fig=True, **kwargs): """ Generate a corner plot of the posterior Using the `corner` package (https://pypi.python.org/pypi/corner/), generate estimates of the posterior from the production samples. Parameters ---------- figsize: tuple (7, 7) Figure size in inches (passed to plt.subplots) add_prior: bool, str If true, plot the prior as a red line. If 'full' then for uniform priors plot the full extent of the prior. nstds: float The number of standard deviations to plot centered on the mean label_offset: float Offset the labels from the plot: useful to precent overlapping the tick labels with the axis labels dpi: int Passed to plt.savefig rc_context: dict Dictionary of rc values to set while generating the figure (see matplotlib rc for more details) tglitch_ratio: bool If true, and tglitch is a parameter, plot posteriors as the fractional time at which the glitch occurs instead of the actual time fig_and_axes: tuple fig and axes to plot on, the axes must be of the right shape, namely (ndim, ndim) save_fig: bool If true, save the figure, else return the fig, axes **kwargs: Passed to corner.corner Returns ------- fig, axes: The matplotlib figure and axes, only returned if save_fig = False """ if 'truths' in kwargs and len(kwargs['truths']) != self.ndim: logging.warning('len(Truths) != ndim, Truths will be ignored') kwargs['truths'] = None if self.ndim < 2: with plt.rc_context(rc_context): if fig_and_axes is None: fig, ax = plt.subplots(figsize=figsize) else: fig, ax = fig_and_axes ax.hist(self.samples, bins=50, histtype='stepfilled') ax.set_xlabel(self.theta_symbols[0]) fig.savefig('{}/{}_corner.png'.format( self.outdir, self.label), dpi=dpi) return with plt.rc_context(rc_context): if fig_and_axes is None: fig, axes = plt.subplots(self.ndim, self.ndim, figsize=figsize) else: fig, axes = fig_and_axes samples_plt = copy.copy(self.samples) labels = self._get_labels() samples_plt = self._scale_samples(samples_plt, self.theta_keys) if tglitch_ratio: for j, k in enumerate(self.theta_keys): if k == 'tglitch': s = samples_plt[:, j] samples_plt[:, j] = ( s - self.minStartTime)/( self.maxStartTime - self.minStartTime) labels[j] = r'$R_{\textrm{glitch}}$' if type(nstds) is int and 'range' not in kwargs: _range = [] for j, s in enumerate(samples_plt.T): median = np.median(s) std = np.std(s) _range.append((median - nstds*std, median + nstds*std)) elif 'range' in kwargs: _range = kwargs.pop('range') else: _range = None hist_kwargs = kwargs.pop('hist_kwargs', dict()) if 'normed' not in hist_kwargs: hist_kwargs['normed'] = True fig_triangle = corner.corner(samples_plt, labels=labels, fig=fig, bins=50, max_n_ticks=4, plot_contours=True, plot_datapoints=True, label_kwargs={'fontsize': 8}, data_kwargs={'alpha': 0.1, 'ms': 0.5}, range=_range, hist_kwargs=hist_kwargs, **kwargs) axes_list = fig_triangle.get_axes() axes = np.array(axes_list).reshape(self.ndim, self.ndim) plt.draw() for ax in axes[:, 0]: ax.yaxis.set_label_coords(-label_offset, 0.5) for ax in axes[-1, :]: ax.xaxis.set_label_coords(0.5, -label_offset) for ax in axes_list: ax.set_rasterized(True) ax.set_rasterization_zorder(-10) plt.tight_layout(h_pad=0.0, w_pad=0.0) fig.subplots_adjust(hspace=0.05, wspace=0.05) if add_prior: self._add_prior_to_corner(axes, self.samples, add_prior) if save_fig: fig_triangle.savefig('{}/{}_corner.png'.format( self.outdir, self.label), dpi=dpi) else: return fig, axes def _add_prior_to_corner(self, axes, samples, add_prior): for i, key in enumerate(self.theta_keys): ax = axes[i][i] s = samples[:, i] lnprior = self._generic_lnprior(**self.theta_prior[key]) if add_prior == 'full' and self.theta_prior[key]['type'] == 'unif': lower = self.theta_prior[key]['lower'] upper = self.theta_prior[key]['upper'] r = upper-lower xlim = [lower-0.05*r, upper+0.05*r] x = np.linspace(xlim[0], xlim[1], 1000) else: xlim = ax.get_xlim() x = np.linspace(s.min(), s.max(), 1000) multiplier = self._get_rescale_multiplier_for_key(key) subtractor = self._get_rescale_subtractor_for_key(key) ax.plot((x-subtractor)*multiplier, [np.exp(lnprior(xi)) for xi in x], '-C3', label='prior') for j in range(i, self.ndim): axes[j][i].set_xlim(xlim[0], xlim[1]) for k in range(0, i): axes[i][k].set_ylim(xlim[0], xlim[1]) def plot_prior_posterior(self, normal_stds=2): """ Plot the posterior in the context of the prior """ fig, axes = plt.subplots(nrows=self.ndim, figsize=(8, 4*self.ndim)) N = 1000 from scipy.stats import gaussian_kde for i, (ax, key) in enumerate(zip(axes, self.theta_keys)): prior_dict = self.theta_prior[key] prior_func = self._generic_lnprior(**prior_dict) if prior_dict['type'] == 'unif': x = np.linspace(prior_dict['lower'], prior_dict['upper'], N) prior = prior_func(x) prior[0] = 0 prior[-1] = 0 elif prior_dict['type'] == 'log10unif': upper = prior_dict['log10upper'] lower = prior_dict['log10lower'] x = np.linspace(lower, upper, N) prior = [prior_func(xi) for xi in x] elif prior_dict['type'] == 'norm': lower = prior_dict['loc'] - normal_stds * prior_dict['scale'] upper = prior_dict['loc'] + normal_stds * prior_dict['scale'] x = np.linspace(lower, upper, N) prior = prior_func(x) elif prior_dict['type'] == 'halfnorm': lower = prior_dict['loc'] upper = prior_dict['loc'] + normal_stds * prior_dict['scale'] x = np.linspace(lower, upper, N) prior = [prior_func(xi) for xi in x] elif prior_dict['type'] == 'neghalfnorm': upper = prior_dict['loc'] lower = prior_dict['loc'] - normal_stds * prior_dict['scale'] x = np.linspace(lower, upper, N) prior = [prior_func(xi) for xi in x] else: raise ValueError('Not implemented for prior type {}'.format( prior_dict['type'])) priorln = ax.plot(x, prior, 'C3', label='prior') ax.set_xlabel(self.theta_symbols[i]) s = self.samples[:, i] while len(s) > 10**4: # random downsample to avoid slow calculation of kde s = np.random.choice(s, size=int(len(s)/2.)) kde = gaussian_kde(s) ax2 = ax.twinx() postln = ax2.plot(x, kde.pdf(x), 'k', label='posterior') ax2.set_yticklabels([]) ax.set_yticklabels([]) lns = priorln + postln labs = [l.get_label() for l in lns] axes[0].legend(lns, labs, loc=1, framealpha=0.8) fig.savefig('{}/{}_prior_posterior.png'.format( self.outdir, self.label)) def plot_cumulative_max(self, **kwargs): """ Plot the cumulative twoF for the maximum posterior estimate See the pyfstat.core.plot_twoF_cumulative function for further details """ d, maxtwoF = self.get_max_twoF() for key, val in self.theta_prior.iteritems(): if key not in d: d[key] = val if hasattr(self, 'search') is False: self._initiate_search_object() if self.binary is False: self.search.plot_twoF_cumulative( self.label, self.outdir, F0=d['F0'], F1=d['F1'], F2=d['F2'], Alpha=d['Alpha'], Delta=d['Delta'], tstart=self.minStartTime, tend=self.maxStartTime, **kwargs) else: self.search.plot_twoF_cumulative( self.label, self.outdir, F0=d['F0'], F1=d['F1'], F2=d['F2'], Alpha=d['Alpha'], Delta=d['Delta'], asini=d['asini'], period=d['period'], ecc=d['ecc'], argp=d['argp'], tp=d['argp'], tstart=self.minStartTime, tend=self.maxStartTime, **kwargs) def _generic_lnprior(self, **kwargs): """ Return a lambda function of the pdf Parameters ---------- **kwargs: A dictionary containing 'type' of pdf and shape parameters """ def log_of_unif(x, a, b): above = x < b below = x > a if type(above) is not np.ndarray: if above and below: return -np.log(b-a) else: return -np.inf else: idxs = np.array([all(tup) for tup in zip(above, below)]) p = np.zeros(len(x)) - np.inf p[idxs] = -np.log(b-a) return p def log_of_log10unif(x, log10lower, log10upper): log10x = np.log10(x) above = log10x < log10upper below = log10x > log10lower if type(above) is not np.ndarray: if above and below: return -np.log(x*np.log(10)*(log10upper-log10lower)) else: return -np.inf else: idxs = np.array([all(tup) for tup in zip(above, below)]) p = np.zeros(len(x)) - np.inf p[idxs] = -np.log(x*np.log(10)*(log10upper-log10lower)) return p def log_of_halfnorm(x, loc, scale): if x < loc: return -np.inf else: return -0.5*((x-loc)**2/scale**2+np.log(0.5*np.pi*scale**2)) def cauchy(x, x0, gamma): return 1.0/(np.pi*gamma*(1+((x-x0)/gamma)**2)) def exp(x, x0, gamma): if x > x0: return np.log(gamma) - gamma*(x - x0) else: return -np.inf if kwargs['type'] == 'unif': return lambda x: log_of_unif(x, kwargs['lower'], kwargs['upper']) if kwargs['type'] == 'log10unif': return lambda x: log_of_log10unif( x, kwargs['log10lower'], kwargs['log10upper']) elif kwargs['type'] == 'halfnorm': return lambda x: log_of_halfnorm(x, kwargs['loc'], kwargs['scale']) elif kwargs['type'] == 'neghalfnorm': return lambda x: log_of_halfnorm( -x, kwargs['loc'], kwargs['scale']) elif kwargs['type'] == 'norm': return lambda x: -0.5*((x - kwargs['loc'])**2/kwargs['scale']**2 + np.log(2*np.pi*kwargs['scale']**2)) else: logging.info("kwargs:", kwargs) raise ValueError("Print unrecognise distribution") def _generate_rv(self, **kwargs): dist_type = kwargs.pop('type') if dist_type == "unif": return np.random.uniform(low=kwargs['lower'], high=kwargs['upper']) if dist_type == "log10unif": return 10**(np.random.uniform(low=kwargs['log10lower'], high=kwargs['log10upper'])) if dist_type == "norm": return np.random.normal(loc=kwargs['loc'], scale=kwargs['scale']) if dist_type == "halfnorm": return np.abs(np.random.normal(loc=kwargs['loc'], scale=kwargs['scale'])) if dist_type == "neghalfnorm": return -1 * np.abs(np.random.normal(loc=kwargs['loc'], scale=kwargs['scale'])) if dist_type == "lognorm": return np.random.lognormal( mean=kwargs['loc'], sigma=kwargs['scale']) else: raise ValueError("dist_type {} unknown".format(dist_type)) def _plot_walkers(self, sampler, symbols=None, alpha=0.8, color="k", temp=0, lw=0.1, nprod=0, add_det_stat_burnin=False, fig=None, axes=None, xoffset=0, plot_det_stat=False, context='ggplot', subtractions=None, labelpad=0.05): """ Plot all the chains from a sampler """ if context not in plt.style.available: raise ValueError(( 'The requested context {} is not available; please select a' ' context from `plt.style.available`').format(context)) if np.ndim(axes) > 1: axes = axes.flatten() shape = sampler.chain.shape if len(shape) == 3: nwalkers, nsteps, ndim = shape chain = sampler.chain[:, :, :] if len(shape) == 4: ntemps, nwalkers, nsteps, ndim = shape if temp < ntemps: logging.info("Plotting temperature {} chains".format(temp)) else: raise ValueError(("Requested temperature {} outside of" "available range").format(temp)) chain = sampler.chain[temp, :, :, :] if subtractions is None: subtractions = [0 for i in range(ndim)] else: if len(subtractions) != self.ndim: raise ValueError('subtractions must be of length ndim') if plot_det_stat: extra_subplots = 1 else: extra_subplots = 0 with plt.style.context((context)): plt.rcParams['text.usetex'] = True if fig is None and axes is None: fig = plt.figure(figsize=(4, 3.0*ndim)) ax = fig.add_subplot(ndim+extra_subplots, 1, 1) axes = [ax] + [fig.add_subplot(ndim+extra_subplots, 1, i) for i in range(2, ndim+1)] idxs = np.arange(chain.shape[1]) burnin_idx = chain.shape[1] - nprod if hasattr(self, 'convergence_idx'): convergence_idx = self.convergence_idx else: convergence_idx = burnin_idx if ndim > 1: for i in range(ndim): axes[i].ticklabel_format(useOffset=False, axis='y') cs = chain[:, :, i].T if burnin_idx > 0: axes[i].plot(xoffset+idxs[:convergence_idx+1], cs[:convergence_idx+1]-subtractions[i], color="C3", alpha=alpha, lw=lw) axes[i].axvline(xoffset+convergence_idx, color='k', ls='--', lw=0.25) axes[i].plot(xoffset+idxs[burnin_idx:], cs[burnin_idx:]-subtractions[i], color="k", alpha=alpha, lw=lw) axes[i].set_xlim(0, xoffset+idxs[-1]) if symbols: if subtractions[i] == 0: axes[i].set_ylabel(symbols[i], labelpad=labelpad) else: axes[i].set_ylabel( symbols[i]+'$-$'+symbols[i]+'$_0$', labelpad=labelpad) if hasattr(self, 'convergence_diagnostic'): ax = axes[i].twinx() axes[i].set_zorder(ax.get_zorder()+1) axes[i].patch.set_visible(False) c_x = np.array(self.convergence_diagnosticx) c_y = np.array(self.convergence_diagnostic) break_idx = np.argmin(np.abs(c_x - burnin_idx)) ax.plot(c_x[:break_idx], c_y[:break_idx, i], '-C0', zorder=-10) ax.plot(c_x[break_idx:], c_y[break_idx:, i], '-C0', zorder=-10) if self.convergence_test_type == 'autocorr': ax.set_ylabel(r'$\tau_\mathrm{exp}$') elif self.convergence_test_type == 'GR': ax.set_ylabel('PSRF') ax.ticklabel_format(useOffset=False) else: axes[0].ticklabel_format(useOffset=False, axis='y') cs = chain[:, :, temp].T if burnin_idx: axes[0].plot(idxs[:burnin_idx], cs[:burnin_idx], color="C3", alpha=alpha, lw=lw) axes[0].plot(idxs[burnin_idx:], cs[burnin_idx:], color="k", alpha=alpha, lw=lw) if symbols: axes[0].set_ylabel(symbols[0], labelpad=labelpad) axes[-1].set_xlabel(r'$\textrm{Number of steps}$', labelpad=0.2) if plot_det_stat: if len(axes) == ndim: axes.append(fig.add_subplot(ndim+1, 1, ndim+1)) lnl = sampler.lnlikelihood[temp, :, :] if burnin_idx and add_det_stat_burnin: burn_in_vals = lnl[:, :burnin_idx].flatten() try: twoF_burnin = (burn_in_vals[~np.isnan(burn_in_vals)] - self.likelihoodcoef) axes[-1].hist(twoF_burnin, bins=50, histtype='step', color='C3') except ValueError: logging.info('Det. Stat. hist failed, most likely all ' 'values where the same') pass else: twoF_burnin = [] prod_vals = lnl[:, burnin_idx:].flatten() try: twoF = prod_vals[~np.isnan(prod_vals)]-self.likelihoodcoef axes[-1].hist(twoF, bins=50, histtype='step', color='k') except ValueError: logging.info('Det. Stat. hist failed, most likely all ' 'values where the same') pass if self.BSGL: axes[-1].set_xlabel(r'$\mathcal{B}_\mathrm{S/GL}$') else: axes[-1].set_xlabel(r'$\widetilde{2\mathcal{F}}$') axes[-1].set_ylabel(r'$\textrm{Counts}$') combined_vals = np.append(twoF_burnin, twoF) if len(combined_vals) > 0: minv = np.min(combined_vals) maxv = np.max(combined_vals) Range = abs(maxv-minv) axes[-1].set_xlim(minv-0.1*Range, maxv+0.1*Range) xfmt = matplotlib.ticker.ScalarFormatter() xfmt.set_powerlimits((-4, 4)) axes[-1].xaxis.set_major_formatter(xfmt) return fig, axes def _apply_corrections_to_p0(self, p0): """ Apply any correction to the initial p0 values """ return p0 def _generate_scattered_p0(self, p): """ Generate a set of p0s scattered about p """ p0 = [[p + self.scatter_val * p * np.random.randn(self.ndim) for i in xrange(self.nwalkers)] for j in xrange(self.ntemps)] return p0 def _generate_initial_p0(self): """ Generate a set of init vals for the walkers """ if type(self.theta_initial) == dict: logging.info('Generate initial values from initial dictionary') if hasattr(self, 'nglitch') and self.nglitch > 1: raise ValueError('Initial dict not implemented for nglitch>1') p0 = [[[self._generate_rv(**self.theta_initial[key]) for key in self.theta_keys] for i in range(self.nwalkers)] for j in range(self.ntemps)] elif self.theta_initial is None: logging.info('Generate initial values from prior dictionary') p0 = [[[self._generate_rv(**self.theta_prior[key]) for key in self.theta_keys] for i in range(self.nwalkers)] for j in range(self.ntemps)] else: raise ValueError('theta_initial not understood') return p0 def _get_new_p0(self, sampler): """ Returns new initial positions for walkers are burn0 stage This returns new positions for all walkers by scattering points about the maximum posterior with scale `scatter_val`. """ temp_idx = 0 pF = sampler.chain[temp_idx, :, :, :] lnl = sampler.lnlikelihood[temp_idx, :, :] lnp = sampler.lnprobability[temp_idx, :, :] # General warnings about the state of lnp if np.any(np.isnan(lnp)): logging.warning( "Of {} lnprobs {} are nan".format( np.shape(lnp), np.sum(np.isnan(lnp)))) if np.any(np.isposinf(lnp)): logging.warning( "Of {} lnprobs {} are +np.inf".format( np.shape(lnp), np.sum(np.isposinf(lnp)))) if np.any(np.isneginf(lnp)): logging.warning( "Of {} lnprobs {} are -np.inf".format( np.shape(lnp), np.sum(np.isneginf(lnp)))) lnp_finite = copy.copy(lnp) lnp_finite[np.isinf(lnp)] = np.nan idx = np.unravel_index(np.nanargmax(lnp_finite), lnp_finite.shape) p = pF[idx] p0 = self._generate_scattered_p0(p) self.search.BSGL = False twoF = self.logl(p, self.search) self.search.BSGL = self.BSGL logging.info(('Gen. new p0 from pos {} which had det. stat.={:2.1f},' ' twoF={:2.1f} and lnp={:2.1f}') .format(idx[1], lnl[idx], twoF, lnp_finite[idx])) return p0 def _get_data_dictionary_to_save(self): d = dict(nsteps=self.nsteps, nwalkers=self.nwalkers, ntemps=self.ntemps, theta_keys=self.theta_keys, theta_prior=self.theta_prior, scatter_val=self.scatter_val, log10temperature_min=self.log10temperature_min, BSGL=self.BSGL) return d def _save_data(self, sampler, samples, lnprobs, lnlikes, all_lnlikelihood): d = self._get_data_dictionary_to_save() d['samples'] = samples d['lnprobs'] = lnprobs d['lnlikes'] = lnlikes d['all_lnlikelihood'] = all_lnlikelihood if os.path.isfile(self.pickle_path): logging.info('Saving backup of {} as {}.old'.format( self.pickle_path, self.pickle_path)) os.rename(self.pickle_path, self.pickle_path+".old") with open(self.pickle_path, "wb") as File: pickle.dump(d, File) def get_saved_data_dictionary(self): """ Returns dictionary of the data saved in the pickle """ with open(self.pickle_path, "r") as File: d = pickle.load(File) return d def _check_old_data_is_okay_to_use(self): if args.use_old_data: logging.info("Forcing use of old data") return True if os.path.isfile(self.pickle_path) is False: logging.info('No pickled data found') return False if self.sftfilepattern is not None: oldest_sft = min([os.path.getmtime(f) for f in self._get_list_of_matching_sfts()]) if os.path.getmtime(self.pickle_path) < oldest_sft: logging.info('Pickled data outdates sft files') return False old_d = self.get_saved_data_dictionary().copy() new_d = self._get_data_dictionary_to_save().copy() old_d.pop('samples') old_d.pop('lnprobs') old_d.pop('lnlikes') old_d.pop('all_lnlikelihood') mod_keys = [] for key in new_d.keys(): if key in old_d: if new_d[key] != old_d[key]: mod_keys.append((key, old_d[key], new_d[key])) else: raise ValueError('Keys {} not in old dictionary'.format(key)) if len(mod_keys) == 0: return True else: logging.warning("Saved data differs from requested") logging.info("Differences found in following keys:") for key in mod_keys: if len(key) == 3: if np.isscalar(key[1]) or key[0] == 'nsteps': logging.info(" {} : {} -> {}".format(*key)) else: logging.info(" " + key[0]) else: logging.info(key) return False def get_max_twoF(self, threshold=0.05): """ Returns the max likelihood sample and the corresponding 2F value Note: the sample is returned as a dictionary along with an estimate of the standard deviation calculated from the std of all samples with a twoF within `threshold` (relative) to the max twoF """ if any(np.isposinf(self.lnlikes)): logging.info('twoF values contain positive infinite values') if any(np.isneginf(self.lnlikes)): logging.info('twoF values contain negative infinite values') if any(np.isnan(self.lnlikes)): logging.info('twoF values contain nan') idxs = np.isfinite(self.lnlikes) jmax = np.nanargmax(self.lnlikes[idxs]) maxlogl = self.lnlikes[jmax] d = OrderedDict() if self.BSGL: if hasattr(self, 'search') is False: self._initiate_search_object() p = self.samples[jmax] self.search.BSGL = False maxtwoF = self.logl(p, self.search) self.search.BSGL = self.BSGL else: maxtwoF = maxlogl - self.likelihoodcoef repeats = [] for i, k in enumerate(self.theta_keys): if k in d and k not in repeats: d[k+'_0'] = d[k] # relabel the old key d.pop(k) repeats.append(k) if k in repeats: k = k + '_0' count = 1 while k in d: k = k.replace('_{}'.format(count-1), '_{}'.format(count)) count += 1 d[k] = self.samples[jmax][i] return d, maxtwoF def get_median_stds(self): """ Returns a dict of the median and std of all production samples """ d = OrderedDict() repeats = [] for s, k in zip(self.samples.T, self.theta_keys): if k in d and k not in repeats: d[k+'_0'] = d[k] # relabel the old key d[k+'_0_std'] = d[k+'_std'] d.pop(k) d.pop(k+'_std') repeats.append(k) if k in repeats: k = k + '_0' count = 1 while k in d: k = k.replace('_{}'.format(count-1), '_{}'.format(count)) count += 1 d[k] = np.median(s) d[k+'_std'] = np.std(s) return d def check_if_samples_are_railing(self, threshold=0.01): """ Returns a boolean estimate of if the samples are railing Parameters ---------- threshold: float [0, 1] Fraction of the uniform prior to test (at upper and lower bound) Returns ------- return_flag: bool IF true, the samples are railing """ return_flag = False for s, k in zip(self.samples.T, self.theta_keys): prior = self.theta_prior[k] if prior['type'] == 'unif': prior_range = prior['upper'] - prior['lower'] edges = [] fracs = [] for l in ['lower', 'upper']: bools = np.abs(s - prior[l])/prior_range < threshold if np.any(bools): edges.append(l) fracs.append(str(100*float(np.sum(bools))/len(bools))) if len(edges) > 0: logging.warning( '{}% of the {} posterior is railing on the {} edges' .format('% & '.join(fracs), k, ' & '.join(edges))) return_flag = True return return_flag def write_par(self, method='med'): """ Writes a .par of the best-fit params with an estimated std """ logging.info('Writing {}/{}.par using the {} method'.format( self.outdir, self.label, method)) median_std_d = self.get_median_stds() max_twoF_d, max_twoF = self.get_max_twoF() logging.info('Writing par file with max twoF = {}'.format(max_twoF)) filename = '{}/{}.par'.format(self.outdir, self.label) with open(filename, 'w+') as f: f.write('MaxtwoF = {}\n'.format(max_twoF)) f.write('tref = {}\n'.format(self.tref)) if hasattr(self, 'theta0_index'): f.write('theta0_index = {}\n'.format(self.theta0_idx)) if method == 'med': for key, val in median_std_d.iteritems(): f.write('{} = {:1.16e}\n'.format(key, val)) if method == 'twoFmax': for key, val in max_twoF_d.iteritems(): f.write('{} = {:1.16e}\n'.format(key, val)) def generate_loudest(self): """ Use lalapps_ComputeFstatistic_v2 to produce a .loudest file """ self.write_par() params = read_par(label=self.label, outdir=self.outdir) for key in ['Alpha', 'Delta', 'F0', 'F1']: if key not in params: params[key] = self.theta_prior[key] cmd = ('lalapps_ComputeFstatistic_v2 -a {} -d {} -f {} -s {} -D "{}"' ' --refTime={} --outputLoudest="{}/{}.loudest" ' '--minStartTime={} --maxStartTime={}').format( params['Alpha'], params['Delta'], params['F0'], params['F1'], self.sftfilepattern, params['tref'], self.outdir, self.label, self.minStartTime, self.maxStartTime) subprocess.call([cmd], shell=True) def write_prior_table(self): """ Generate a .tex file of the prior """ with open('{}/{}_prior.tex'.format(self.outdir, self.label), 'w') as f: f.write(r"\begin{tabular}{c l c} \hline" + '\n' r"Parameter & & & \\ \hhline{====}") for key, prior in self.theta_prior.iteritems(): if type(prior) is dict: Type = prior['type'] if Type == "unif": a = prior['lower'] b = prior['upper'] line = r"{} & $\mathrm{{Unif}}$({}, {}) & {}\\" elif Type == "norm": a = prior['loc'] b = prior['scale'] line = r"{} & $\mathcal{{N}}$({}, {}) & {}\\" elif Type == "halfnorm": a = prior['loc'] b = prior['scale'] line = r"{} & $|\mathcal{{N}}$({}, {})| & {}\\" u = self.unit_dictionary[key] s = self.symbol_dictionary[key] f.write("\n") a = helper_functions.texify_float(a) b = helper_functions.texify_float(b) f.write(" " + line.format(s, a, b, u) + r" \\") f.write("\n\end{tabular}\n") def print_summary(self): """ Prints a summary of the max twoF found to the terminal """ max_twoFd, max_twoF = self.get_max_twoF() median_std_d = self.get_median_stds() logging.info('Summary:') if hasattr(self, 'theta0_idx'): logging.info('theta0 index: {}'.format(self.theta0_idx)) logging.info('Max twoF: {} with parameters:'.format(max_twoF)) for k in np.sort(max_twoFd.keys()): print(' {:10s} = {:1.9e}'.format(k, max_twoFd[k])) logging.info('Median +/- std for production values') for k in np.sort(median_std_d.keys()): if 'std' not in k: logging.info(' {:10s} = {:1.9e} +/- {:1.9e}'.format( k, median_std_d[k], median_std_d[k+'_std'])) logging.info('\n') def _CF_twoFmax(self, theta, twoFmax, ntrials): Fmax = twoFmax/2.0 return (np.exp(1j*theta*twoFmax)*ntrials/2.0 * Fmax*np.exp(-Fmax)*(1-(1+Fmax)*np.exp(-Fmax))**(ntrials-1)) def _pdf_twoFhat(self, twoFhat, nglitch, ntrials, twoFmax=100, dtwoF=0.1): if np.ndim(ntrials) == 0: ntrials = np.zeros(nglitch+1) + ntrials twoFmax_int = np.arange(0, twoFmax, dtwoF) theta_int = np.arange(-1/dtwoF, 1./dtwoF, 1./twoFmax) CF_twoFmax_theta = np.array( [[np.trapz(self._CF_twoFmax(t, twoFmax_int, ntrial), twoFmax_int) for t in theta_int] for ntrial in ntrials]) CF_twoFhat_theta = np.prod(CF_twoFmax_theta, axis=0) pdf = (1/(2*np.pi)) * np.array( [np.trapz(np.exp(-1j*theta_int*twoFhat_val) * CF_twoFhat_theta, theta_int) for twoFhat_val in twoFhat]) return pdf.real def _p_val_twoFhat(self, twoFhat, ntrials, twoFhatmax=500, Npoints=1000): """ Caluculate the p-value for the given twoFhat in Gaussian noise Parameters ---------- twoFhat: float The observed twoFhat value ntrials: int, array of len Nglitch+1 The number of trials for each glitch+1 """ twoFhats = np.linspace(twoFhat, twoFhatmax, Npoints) pdf = self._pdf_twoFhat(twoFhats, self.nglitch, ntrials) return np.trapz(pdf, twoFhats) def get_p_value(self, delta_F0, time_trials=0): """ Get's the p-value for the maximum twoFhat value """ d, max_twoF = self.get_max_twoF() if self.nglitch == 1: tglitches = [d['tglitch']] else: tglitches = [d['tglitch_{}'.format(i)] for i in range(self.nglitch)] tboundaries = [self.minStartTime] + tglitches + [self.maxStartTime] deltaTs = np.diff(tboundaries) ntrials = [time_trials + delta_F0 * dT for dT in deltaTs] p_val = self._p_val_twoFhat(max_twoF, ntrials) print('p-value = {}'.format(p_val)) return p_val def compute_evidence(self, write_to_file='Evidences.txt'): """ Computes the evidence/marginal likelihood for the model """ betas = self.betas mean_lnlikes = np.mean(np.mean(self.all_lnlikelihood, axis=1), axis=1) mean_lnlikes = mean_lnlikes[::-1] betas = betas[::-1] fig, (ax1, ax2) = plt.subplots(nrows=2, figsize=(6, 8)) if any(np.isinf(mean_lnlikes)): print("WARNING mean_lnlikes contains inf: recalculating without" " the {} infs".format(len(betas[np.isinf(mean_lnlikes)]))) idxs = np.isinf(mean_lnlikes) mean_lnlikes = mean_lnlikes[~idxs] betas = betas[~idxs] log10evidence = np.trapz(mean_lnlikes, betas)/np.log(10) z1 = np.trapz(mean_lnlikes, betas) z2 = np.trapz(mean_lnlikes[::-1][::2][::-1], betas[::-1][::2][::-1]) log10evidence_err = np.abs(z1 - z2) / np.log(10) logging.info("log10 evidence for {} = {} +/- {}".format( self.label, log10evidence, log10evidence_err)) if write_to_file: EvidenceDict = self.read_evidence_file_to_dict(write_to_file) EvidenceDict[self.label] = [log10evidence, log10evidence_err] self.write_evidence_file_from_dict(EvidenceDict, write_to_file) ax1.semilogx(betas, mean_lnlikes, "-o") ax1.set_xlabel(r"$\beta$") ax1.set_ylabel(r"$\langle \log(\mathcal{L}) \rangle$") min_betas = [] evidence = [] for i in range(len(betas)/2): min_betas.append(betas[i]) lnZ = np.trapz(mean_lnlikes[i:], betas[i:]) evidence.append(lnZ/np.log(10)) ax2.semilogx(min_betas, evidence, "-o") ax2.set_ylabel(r"$\int_{\beta_{\textrm{Min}}}^{\beta=1}" + r"\langle \log(\mathcal{L})\rangle d\beta$", size=16) ax2.set_xlabel(r"$\beta_{\textrm{min}}$") plt.tight_layout() fig.savefig("{}/{}_beta_lnl.png".format(self.outdir, self.label)) @staticmethod def read_evidence_file_to_dict(evidence_file_name='Evidences.txt'): EvidenceDict = OrderedDict() if os.path.isfile(evidence_file_name): with open(evidence_file_name, 'r') as f: for line in f: key, log10evidence, log10evidence_err = line.split(' ') EvidenceDict[key] = [ float(log10evidence), float(log10evidence_err)] return EvidenceDict def write_evidence_file_from_dict(self, EvidenceDict, evidence_file_name): with open(evidence_file_name, 'w+') as f: for key, val in EvidenceDict.iteritems(): f.write('{} {} {}\n'.format(key, val[0], val[1])) class MCMCGlitchSearch(MCMCSearch): """MCMC search using the SemiCoherentGlitchSearch See parent MCMCSearch for a list of all additional parameters, here we list only the additional init parameters of this class. Parameters ---------- nglitch: int The number of glitches to allow dtglitchmin: int The minimum duration (in seconds) of a segment between two glitches or a glitch and the start/end of the data theta0_idx, int Index (zero-based) of which segment the theta refers to - useful if providing a tight prior on theta to allow the signal to jump too theta (and not just from) """ symbol_dictionary = dict( F0='$f$', F1='$\dot{f}$', F2='$\ddot{f}$', Alpha=r'$\alpha$', Delta='$\delta$', delta_F0='$\delta f$', delta_F1='$\delta \dot{f}$', tglitch='$t_\mathrm{glitch}$') unit_dictionary = dict( F0='Hz', F1='Hz/s', F2='Hz/s$^2$', Alpha=r'rad', Delta='rad', delta_F0='Hz', delta_F1='Hz/s', tglitch='s') transform_dictionary = dict( tglitch={ 'multiplier': 1/86400., 'subtractor': 'minStartTime', 'unit': 'day', 'label': 'Glitch time \n days after minStartTime'} ) @helper_functions.initializer def __init__(self, label, outdir, theta_prior, tref, minStartTime, maxStartTime, sftfilepattern=None, detectors=None, nsteps=[100, 100], nwalkers=100, ntemps=1, log10temperature_min=-5, theta_initial=None, scatter_val=1e-10, rhohatmax=1000, binary=False, BSGL=False, SSBprec=None, minCoverFreq=None, maxCoverFreq=None, injectSources=None, assumeSqrtSX=None, dtglitchmin=1*86400, theta0_idx=0, nglitch=1): if os.path.isdir(outdir) is False: os.mkdir(outdir) self._add_log_file() logging.info(('Set-up MCMC glitch search with {} glitches for model {}' ' on data {}').format(self.nglitch, self.label, self.sftfilepattern)) self.pickle_path = '{}/{}_saved_data.p'.format(self.outdir, self.label) self._unpack_input_theta() self.ndim = len(self.theta_keys) if self.log10temperature_min: self.betas = np.logspace(0, self.log10temperature_min, self.ntemps) else: self.betas = None if args.clean and os.path.isfile(self.pickle_path): os.rename(self.pickle_path, self.pickle_path+".old") self.old_data_is_okay_to_use = self._check_old_data_is_okay_to_use() self._log_input() self._set_likelihoodcoef() def _set_likelihoodcoef(self): self.likelihoodcoef = (self.nglitch+1)*np.log(70./self.rhohatmax**4) def _initiate_search_object(self): logging.info('Setting up search object') self.search = core.SemiCoherentGlitchSearch( label=self.label, outdir=self.outdir, sftfilepattern=self.sftfilepattern, tref=self.tref, minStartTime=self.minStartTime, maxStartTime=self.maxStartTime, minCoverFreq=self.minCoverFreq, maxCoverFreq=self.maxCoverFreq, detectors=self.detectors, BSGL=self.BSGL, nglitch=self.nglitch, theta0_idx=self.theta0_idx, injectSources=self.injectSources) def logp(self, theta_vals, theta_prior, theta_keys, search): if self.nglitch > 1: ts = ([self.minStartTime] + list(theta_vals[-self.nglitch:]) + [self.maxStartTime]) if np.array_equal(ts, np.sort(ts)) is False: return -np.inf if any(np.diff(ts) < self.dtglitchmin): return -np.inf H = [self._generic_lnprior(**theta_prior[key])(p) for p, key in zip(theta_vals, theta_keys)] return np.sum(H) def logl(self, theta, search): if self.nglitch > 1: ts = ([self.minStartTime] + list(theta[-self.nglitch:]) + [self.maxStartTime]) if np.array_equal(ts, np.sort(ts)) is False: return -np.inf for j, theta_i in enumerate(self.theta_idxs): self.fixed_theta[theta_i] = theta[j] FS = search.compute_nglitch_fstat(*self.fixed_theta) return FS + self.likelihoodcoef def _unpack_input_theta(self): glitch_keys = ['delta_F0', 'delta_F1', 'tglitch'] full_glitch_keys = list(np.array( [[gk]*self.nglitch for gk in glitch_keys]).flatten()) if 'tglitch_0' in self.theta_prior: full_glitch_keys[-self.nglitch:] = [ 'tglitch_{}'.format(i) for i in range(self.nglitch)] full_glitch_keys[-2*self.nglitch:-1*self.nglitch] = [ 'delta_F1_{}'.format(i) for i in range(self.nglitch)] full_glitch_keys[-4*self.nglitch:-2*self.nglitch] = [ 'delta_F0_{}'.format(i) for i in range(self.nglitch)] full_theta_keys = ['F0', 'F1', 'F2', 'Alpha', 'Delta']+full_glitch_keys full_theta_keys_copy = copy.copy(full_theta_keys) glitch_symbols = ['$\delta f$', '$\delta \dot{f}$', r'$t_{glitch}$'] full_glitch_symbols = list(np.array( [[gs]*self.nglitch for gs in glitch_symbols]).flatten()) full_theta_symbols = (['$f$', '$\dot{f}$', '$\ddot{f}$', r'$\alpha$', r'$\delta$'] + full_glitch_symbols) self.theta_keys = [] fixed_theta_dict = {} for key, val in self.theta_prior.iteritems(): if type(val) is dict: fixed_theta_dict[key] = 0 if key in glitch_keys: for i in range(self.nglitch): self.theta_keys.append(key) else: self.theta_keys.append(key) elif type(val) in [float, int, np.float64]: fixed_theta_dict[key] = val else: raise ValueError( 'Type {} of {} in theta not recognised'.format( type(val), key)) if key in glitch_keys: for i in range(self.nglitch): full_theta_keys_copy.pop(full_theta_keys_copy.index(key)) else: full_theta_keys_copy.pop(full_theta_keys_copy.index(key)) if len(full_theta_keys_copy) > 0: raise ValueError(('Input dictionary `theta` is missing the' 'following keys: {}').format( full_theta_keys_copy)) self.fixed_theta = [fixed_theta_dict[key] for key in full_theta_keys] self.theta_idxs = [full_theta_keys.index(k) for k in self.theta_keys] self.theta_symbols = [full_theta_symbols[i] for i in self.theta_idxs] idxs = np.argsort(self.theta_idxs) self.theta_idxs = [self.theta_idxs[i] for i in idxs] self.theta_symbols = [self.theta_symbols[i] for i in idxs] self.theta_keys = [self.theta_keys[i] for i in idxs] # Correct for number of glitches in the idxs self.theta_idxs = np.array(self.theta_idxs) while np.sum(self.theta_idxs[:-1] == self.theta_idxs[1:]) > 0: for i, idx in enumerate(self.theta_idxs): if idx in self.theta_idxs[:i]: self.theta_idxs[i] += 1 def _get_data_dictionary_to_save(self): d = dict(nsteps=self.nsteps, nwalkers=self.nwalkers, ntemps=self.ntemps, theta_keys=self.theta_keys, theta_prior=self.theta_prior, scatter_val=self.scatter_val, log10temperature_min=self.log10temperature_min, theta0_idx=self.theta0_idx, BSGL=self.BSGL) return d def _apply_corrections_to_p0(self, p0): p0 = np.array(p0) if self.nglitch > 1: p0[:, :, -self.nglitch:] = np.sort(p0[:, :, -self.nglitch:], axis=2) return p0 def plot_cumulative_max(self): fig, ax = plt.subplots() d, maxtwoF = self.get_max_twoF() for key, val in self.theta_prior.iteritems(): if key not in d: d[key] = val if self.nglitch > 1: delta_F0s = [d['delta_F0_{}'.format(i)] for i in range(self.nglitch)] delta_F0s.insert(self.theta0_idx, 0) delta_F0s = np.array(delta_F0s) delta_F0s[:self.theta0_idx] *= -1 tglitches = [d['tglitch_{}'.format(i)] for i in range(self.nglitch)] elif self.nglitch == 1: delta_F0s = [d['delta_F0']] delta_F0s.insert(self.theta0_idx, 0) delta_F0s = np.array(delta_F0s) delta_F0s[:self.theta0_idx] *= -1 tglitches = [d['tglitch']] tboundaries = [self.minStartTime] + tglitches + [self.maxStartTime] for j in range(self.nglitch+1): ts = tboundaries[j] te = tboundaries[j+1] if (te - ts)/86400 < 5: logging.info('Period too short to perform cumulative search') continue if j < self.theta0_idx: summed_deltaF0 = np.sum(delta_F0s[j:self.theta0_idx]) F0_j = d['F0'] - summed_deltaF0 taus, twoFs = self.search.calculate_twoF_cumulative( F0_j, F1=d['F1'], F2=d['F2'], Alpha=d['Alpha'], Delta=d['Delta'], tstart=ts, tend=te) elif j >= self.theta0_idx: summed_deltaF0 = np.sum(delta_F0s[self.theta0_idx:j+1]) F0_j = d['F0'] + summed_deltaF0 taus, twoFs = self.search.calculate_twoF_cumulative( F0_j, F1=d['F1'], F2=d['F2'], Alpha=d['Alpha'], Delta=d['Delta'], tstart=ts, tend=te) ax.plot(ts+taus, twoFs) ax.set_xlabel('GPS time') fig.savefig('{}/{}_twoFcumulative.png'.format(self.outdir, self.label)) class MCMCSemiCoherentSearch(MCMCSearch): """ MCMC search for a signal using the semi-coherent ComputeFstat See parent MCMCSearch for a list of all additional parameters, here we list only the additional init parameters of this class. Parameters ---------- nsegs: int The number of segments """ @helper_functions.initializer def __init__(self, label, outdir, theta_prior, tref, minStartTime, maxStartTime, sftfilepattern=None, detectors=None, nsteps=[100, 100], nwalkers=100, ntemps=1, log10temperature_min=-5, theta_initial=None, scatter_val=1e-10, rhohatmax=1000, binary=False, BSGL=False, SSBprec=None, minCoverFreq=None, maxCoverFreq=None, injectSources=None, assumeSqrtSX=None, nsegs=None): if os.path.isdir(outdir) is False: os.mkdir(outdir) self._add_log_file() logging.info(('Set-up MCMC semi-coherent search for model {} on data' '{}').format( self.label, self.sftfilepattern)) self.pickle_path = '{}/{}_saved_data.p'.format(self.outdir, self.label) self._unpack_input_theta() self.ndim = len(self.theta_keys) if self.log10temperature_min: self.betas = np.logspace(0, self.log10temperature_min, self.ntemps) else: self.betas = None if args.clean and os.path.isfile(self.pickle_path): os.rename(self.pickle_path, self.pickle_path+".old") self._log_input() if self.nsegs: self._set_likelihoodcoef() else: logging.info('Value `nsegs` not yet provided') def _set_likelihoodcoef(self): self.likelihoodcoef = self.nsegs * np.log(70./self.rhohatmax**4) def _get_data_dictionary_to_save(self): d = dict(nsteps=self.nsteps, nwalkers=self.nwalkers, ntemps=self.ntemps, theta_keys=self.theta_keys, theta_prior=self.theta_prior, scatter_val=self.scatter_val, log10temperature_min=self.log10temperature_min, BSGL=self.BSGL, nsegs=self.nsegs) return d def _initiate_search_object(self): logging.info('Setting up search object') self.search = core.SemiCoherentSearch( label=self.label, outdir=self.outdir, tref=self.tref, nsegs=self.nsegs, sftfilepattern=self.sftfilepattern, binary=self.binary, BSGL=self.BSGL, minStartTime=self.minStartTime, maxStartTime=self.maxStartTime, minCoverFreq=self.minCoverFreq, maxCoverFreq=self.maxCoverFreq, detectors=self.detectors, injectSources=self.injectSources, assumeSqrtSX=self.assumeSqrtSX) def logp(self, theta_vals, theta_prior, theta_keys, search): H = [self._generic_lnprior(**theta_prior[key])(p) for p, key in zip(theta_vals, theta_keys)] return np.sum(H) def logl(self, theta, search): for j, theta_i in enumerate(self.theta_idxs): self.fixed_theta[theta_i] = theta[j] FS = search.run_semi_coherent_computefstatistic_single_point( *self.fixed_theta) return FS + self.likelihoodcoef class MCMCFollowUpSearch(MCMCSemiCoherentSearch): """ A follow up procudure increasing the coherence time in a zoom See parent MCMCSemiCoherentSearch for a list of all additional parameters """ def _get_data_dictionary_to_save(self): d = dict(nwalkers=self.nwalkers, ntemps=self.ntemps, theta_keys=self.theta_keys, theta_prior=self.theta_prior, scatter_val=self.scatter_val, log10temperature_min=self.log10temperature_min, BSGL=self.BSGL, run_setup=self.run_setup) return d def update_search_object(self): logging.info('Update search object') self.search.init_computefstatistic_single_point() def get_width_from_prior(self, prior, key): if prior[key]['type'] == 'unif': return prior[key]['upper'] - prior[key]['lower'] def get_mid_from_prior(self, prior, key): if prior[key]['type'] == 'unif': return .5*(prior[key]['upper'] + prior[key]['lower']) def read_setup_input_file(self, run_setup_input_file): with open(run_setup_input_file, 'r+') as f: d = pickle.load(f) return d def write_setup_input_file(self, run_setup_input_file, NstarMax, Nsegs0, nsegs_vals, Nstar_vals, theta_prior): d = dict(NstarMax=NstarMax, Nsegs0=Nsegs0, nsegs_vals=nsegs_vals, theta_prior=theta_prior, Nstar_vals=Nstar_vals) with open(run_setup_input_file, 'w+') as f: pickle.dump(d, f) def check_old_run_setup(self, old_setup, **kwargs): try: truths = [val == old_setup[key] for key, val in kwargs.iteritems()] if all(truths): return True else: logging.info( "Old setup doesn't match one of NstarMax, Nsegs0 or prior") except KeyError as e: logging.info( 'Error found when comparing with old setup: {}'.format(e)) return False def init_run_setup(self, run_setup=None, NstarMax=1000, Nsegs0=None, log_table=True, gen_tex_table=True): if run_setup is None and Nsegs0 is None: raise ValueError( 'You must either specify the run_setup, or Nsegs0 and NStarMax' ' from which the optimal run_setup can be estimated') if run_setup is None: logging.info('No run_setup provided') run_setup_input_file = '{}/{}_run_setup.p'.format( self.outdir, self.label) if os.path.isfile(run_setup_input_file): logging.info('Checking old setup input file {}'.format( run_setup_input_file)) old_setup = self.read_setup_input_file(run_setup_input_file) if self.check_old_run_setup(old_setup, NstarMax=NstarMax, Nsegs0=Nsegs0, theta_prior=self.theta_prior): logging.info( 'Using old setup with NstarMax={}, Nsegs0={}'.format( NstarMax, Nsegs0)) nsegs_vals = old_setup['nsegs_vals'] Nstar_vals = old_setup['Nstar_vals'] generate_setup = False else: generate_setup = True else: generate_setup = True if generate_setup: nsegs_vals, Nstar_vals = ( optimal_setup_functions.get_optimal_setup( NstarMax, Nsegs0, self.tref, self.minStartTime, self.maxStartTime, self.theta_prior, self.search.detector_names)) self.write_setup_input_file(run_setup_input_file, NstarMax, Nsegs0, nsegs_vals, Nstar_vals, self.theta_prior) run_setup = [((self.nsteps[0], 0), nsegs, False) for nsegs in nsegs_vals[:-1]] run_setup.append( ((self.nsteps[0], self.nsteps[1]), nsegs_vals[-1], False)) else: logging.info('Calculating the number of templates for this setup') Nstar_vals = [] for i, rs in enumerate(run_setup): rs = list(rs) if len(rs) == 2: rs.append(False) if np.shape(rs[0]) == (): rs[0] = (rs[0], 0) run_setup[i] = rs if args.no_template_counting: Nstar_vals.append([1, 1, 1]) else: Nstar = optimal_setup_functions.get_Nstar_estimate( rs[1], self.tref, self.minStartTime, self.maxStartTime, self.theta_prior, self.search.detector_names) Nstar_vals.append(Nstar) if log_table: logging.info('Using run-setup as follows:') logging.info( 'Stage | nburn | nprod | nsegs | Tcoh d | resetp0 | Nstar') for i, rs in enumerate(run_setup): Tcoh = (self.maxStartTime - self.minStartTime) / rs[1] / 86400 if Nstar_vals[i] is None: vtext = 'N/A' else: vtext = '{:0.3e}'.format(int(Nstar_vals[i])) logging.info('{} | {} | {} | {} | {} | {} | {}'.format( str(i).ljust(5), str(rs[0][0]).ljust(5), str(rs[0][1]).ljust(5), str(rs[1]).ljust(5), '{:6.1f}'.format(Tcoh), str(rs[2]).ljust(7), vtext)) if gen_tex_table: filename = '{}/{}_run_setup.tex'.format(self.outdir, self.label) with open(filename, 'w+') as f: f.write(r'\begin{tabular}{c|ccc}' + '\n') f.write(r'Stage & $N_\mathrm{seg}$ &' r'$T_\mathrm{coh}^{\rm days}$ &' r'$\mathcal{N}^*$ \\ \hline' '\n') for i, rs in enumerate(run_setup): Tcoh = float( self.maxStartTime - self.minStartTime)/rs[1]/86400 line = r'{} & {} & {} & {} \\' + '\n' if Nstar_vals[i] is None: Nstar = 'N/A' else: Nstar = Nstar_vals[i] line = line.format(i, rs[1], '{:1.1f}'.format(Tcoh), helper_functions.texify_float(Nstar)) f.write(line) f.write(r'\end{tabular}' + '\n') if args.setup_only: logging.info("Exit as requested by setup_only flag") sys.exit() else: return run_setup def run(self, run_setup=None, proposal_scale_factor=2, NstarMax=10, Nsegs0=None, create_plots=True, log_table=True, gen_tex_table=True, fig=None, axes=None, return_fig=False, **kwargs): """ Run the follow-up with the given run_setup Parameters ---------- run_setup: list of tuples, optional proposal_scale_factor: float The proposal scale factor used by the sampler, see Goodman & Weare (2010). If the acceptance fraction is too low, you can raise it by decreasing the a parameter; and if it is too high, you can reduce it by increasing the a parameter [Foreman-Mackay (2013)]. create_plots: bool If true, save trace plots of the walkers c: int The minimum number of autocorrelation times needed to trust the result when estimating the autocorrelation time (see emcee.autocorr.integrated_time for further details. Default is 5 **kwargs: Passed to _plot_walkers to control the figures """ self.nsegs = 1 self._initiate_search_object() run_setup = self.init_run_setup( run_setup, NstarMax=NstarMax, Nsegs0=Nsegs0, log_table=log_table, gen_tex_table=gen_tex_table) self.run_setup = run_setup self.old_data_is_okay_to_use = self._check_old_data_is_okay_to_use() if self.old_data_is_okay_to_use is True: logging.warning('Using saved data from {}'.format( self.pickle_path)) d = self.get_saved_data_dictionary() self.samples = d['samples'] self.lnprobs = d['lnprobs'] self.lnlikes = d['lnlikes'] self.all_lnlikelihood = d['all_lnlikelihood'] self.nsegs = run_setup[-1][1] return nsteps_total = 0 for j, ((nburn, nprod), nseg, reset_p0) in enumerate(run_setup): if j == 0: p0 = self._generate_initial_p0() p0 = self._apply_corrections_to_p0(p0) elif reset_p0: p0 = self._get_new_p0(sampler) p0 = self._apply_corrections_to_p0(p0) # self._check_initial_points(p0) else: p0 = sampler.chain[:, :, -1, :] self.nsegs = nseg self._set_likelihoodcoef() self.search.nsegs = nseg self.update_search_object() self.search.init_semicoherent_parameters() sampler = emcee.PTSampler( self.ntemps, self.nwalkers, self.ndim, self.logl, self.logp, logpargs=(self.theta_prior, self.theta_keys, self.search), loglargs=(self.search,), betas=self.betas, a=proposal_scale_factor) Tcoh = (self.maxStartTime-self.minStartTime)/nseg/86400. logging.info(('Running {}/{} with {} steps and {} nsegs ' '(Tcoh={:1.2f} days)').format( j+1, len(run_setup), (nburn, nprod), nseg, Tcoh)) sampler = self._run_sampler(sampler, p0, nburn=nburn, nprod=nprod) logging.info('Max detection statistic of run was {}'.format( np.max(sampler.lnlikelihood))) if create_plots: fig, axes = self._plot_walkers( sampler, symbols=self.theta_symbols, fig=fig, axes=axes, nprod=nprod, xoffset=nsteps_total, **kwargs) for ax in axes[:self.ndim]: ax.axvline(nsteps_total, color='k', ls='--', lw=0.25) nsteps_total += nburn+nprod samples = sampler.chain[0, :, nburn:, :].reshape((-1, self.ndim)) lnprobs = sampler.lnprobability[0, :, nburn:].reshape((-1)) lnlikes = sampler.lnlikelihood[0, :, nburn:].reshape((-1)) all_lnlikelihood = sampler.lnlikelihood self.samples = samples self.lnprobs = lnprobs self.lnlikes = lnlikes self.all_lnlikelihood = all_lnlikelihood self._save_data(sampler, samples, lnprobs, lnlikes, all_lnlikelihood) if create_plots: try: fig.tight_layout() except (ValueError, RuntimeError) as e: logging.warning('Tight layout encountered {}'.format(e)) if return_fig: return fig, axes else: fig.savefig('{}/{}_walkers.png'.format( self.outdir, self.label)) class MCMCTransientSearch(MCMCSearch): """ MCMC search for a transient signal using ComputeFstat See parent MCMCSearch for a list of all additional parameters, here we list only the additional init parameters of this class. """ symbol_dictionary = dict( F0='$f$', F1='$\dot{f}$', F2='$\ddot{f}$', Alpha=r'$\alpha$', Delta='$\delta$', transient_tstart='$t_\mathrm{start}$', transient_duration='$\Delta T$') unit_dictionary = dict( F0='Hz', F1='Hz/s', F2='Hz/s$^2$', Alpha=r'rad', Delta='rad', transient_tstart='s', transient_duration='s') transform_dictionary = dict( transient_duration={'multiplier': 1/86400., 'unit': 'day', 'symbol': 'Transient duration'}, transient_tstart={ 'multiplier': 1/86400., 'subtractor': 'minStartTime', 'unit': 'day', 'label': 'Transient start-time \n days after minStartTime'} ) def _initiate_search_object(self): logging.info('Setting up search object') self.search = core.ComputeFstat( tref=self.tref, sftfilepattern=self.sftfilepattern, minCoverFreq=self.minCoverFreq, maxCoverFreq=self.maxCoverFreq, detectors=self.detectors, transient=True, minStartTime=self.minStartTime, maxStartTime=self.maxStartTime, BSGL=self.BSGL, binary=self.binary, injectSources=self.injectSources) def logl(self, theta, search): for j, theta_i in enumerate(self.theta_idxs): self.fixed_theta[theta_i] = theta[j] in_theta = copy.copy(self.fixed_theta) in_theta[1] = in_theta[0] + in_theta[1] if in_theta[1] > self.maxStartTime: return -np.inf FS = search.run_computefstatistic_single_point(*in_theta) return FS + self.likelihoodcoef def _unpack_input_theta(self): full_theta_keys = ['transient_tstart', 'transient_duration', 'F0', 'F1', 'F2', 'Alpha', 'Delta'] if self.binary: full_theta_keys += [ 'asini', 'period', 'ecc', 'tp', 'argp'] full_theta_keys_copy = copy.copy(full_theta_keys) full_theta_symbols = [r'$t_{\rm start}$', r'$\Delta T$', '$f$', '$\dot{f}$', '$\ddot{f}$', r'$\alpha$', r'$\delta$'] if self.binary: full_theta_symbols += [ 'asini', 'period', 'period', 'ecc', 'tp', 'argp'] self.theta_keys = [] fixed_theta_dict = {} for key, val in self.theta_prior.iteritems(): if type(val) is dict: fixed_theta_dict[key] = 0 self.theta_keys.append(key) elif type(val) in [float, int, np.float64]: fixed_theta_dict[key] = val else: raise ValueError( 'Type {} of {} in theta not recognised'.format( type(val), key)) full_theta_keys_copy.pop(full_theta_keys_copy.index(key)) if len(full_theta_keys_copy) > 0: raise ValueError(('Input dictionary `theta` is missing the' 'following keys: {}').format( full_theta_keys_copy)) self.fixed_theta = [fixed_theta_dict[key] for key in full_theta_keys] self.theta_idxs = [full_theta_keys.index(k) for k in self.theta_keys] self.theta_symbols = [full_theta_symbols[i] for i in self.theta_idxs] idxs = np.argsort(self.theta_idxs) self.theta_idxs = [self.theta_idxs[i] for i in idxs] self.theta_symbols = [self.theta_symbols[i] for i in idxs] self.theta_keys = [self.theta_keys[i] for i in idxs]